tiotropium-olodaterol
(FENJBZDBFOCTNA-RXLHNOLISA-M)
Structure
- SMILES
- O=C(C(c1cccs1)(c1cccs1)O)OC1C[C@@H]2[C@@H]3[C@H]([C@H](C1)[N+]2(C)C)O3.COc1ccc(cc1)CC(NC[C@@H](c1cc(O)cc2c1OCC(=O)N2)O)(C)C.[Br-]
- Molecular Formula:
- C40H48BrN3O9S2
- Molecular Weight:
- 858.858
- Log P:
- 2.2134
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 5
- TPSA:
- 215.59
- CAS Number(s):
- 1589477-29-1
Synonym(s)
1.
tiotropium-olodaterol
2.
Spiolto Respimat
3.
Stiolto Respimat
External Link(s)
| MeSH | C000611386 |
| PubChem Compound | 16046056 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 74 | US FAERS | |
| 2 | Product quality issue | FAERS: 48 | US FAERS | |
| 3 | Malaise | FAERS: 23 | US FAERS | |
| 4 | Fatigue | FAERS: 18 | US FAERS | |
| 5 | Chest discomfort | FAERS: 17 | US FAERS | |
| 6 | Headache | FAERS: 17 | US FAERS | |
| 7 | Medication Error | FAERS: 16 | US FAERS | |
| 8 | Back Pain | FAERS: 15 | US FAERS | |
| 9 | Dysphonia | FAERS: 15 | US FAERS | |
| 10 | Dizziness | FAERS: 14 | US FAERS | |
| 11 | Pneumonia | FAERS: 12 | US FAERS | |
| 12 | Unevaluable event | FAERS: 12 | US FAERS | |
| 13 | Anxiety | FAERS: 11 | US FAERS | |
| 14 | Asthenia | FAERS: 11 | US FAERS | |
| 15 | Tremor | FAERS: 11 | US FAERS | |
| 16 | Chest Pain | FAERS: 10 | US FAERS | |
| 17 | Feeling jittery | FAERS: 10 | US FAERS | |
| 18 | Influenza | FAERS: 10 | US FAERS | |
| 19 | Oropharyngeal pain | FAERS: 10 | US FAERS | |
| 20 | Choking | FAERS: 9 | US FAERS | |
| 21 | Incorrect dose administered | FAERS: 9 | US FAERS | |
| 22 | Peripheral swelling | FAERS: 9 | US FAERS | |
| 23 | Accidental exposure to product | FAERS: 8 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 8 | US FAERS | |
| 25 | Retching | FAERS: 8 | US FAERS | |
| 26 | Throat irritation | FAERS: 8 | US FAERS | |
| 27 | Urinary Retention | FAERS: 8 | US FAERS | |
| 28 | Drug effect incomplete | FAERS: 7 | US FAERS | |
| 29 | Nausea | FAERS: 7 | US FAERS | |
| 30 | Productive Cough | FAERS: 7 | US FAERS | |
| 31 | Visual Impairment | FAERS: 7 | US FAERS | |
| 32 | Bronchitis | FAERS: 6 | US FAERS | |
| 33 | Memory impairment | FAERS: 6 | US FAERS | |
| 34 | Pruritus | FAERS: 6 | US FAERS | |
| 35 | Wheezing | FAERS: 6 | US FAERS | |
| 36 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 37 | Device malfunction | FAERS: 5 | US FAERS | |
| 38 | Lip swelling | FAERS: 5 | US FAERS | |
| 39 | Nasopharyngitis | FAERS: 5 | US FAERS | |
| 40 | Nervousness | FAERS: 5 | US FAERS | |
| 41 | Sinusitis | FAERS: 5 | US FAERS | |
| 42 | Adverse event | FAERS: 4 | US FAERS | |
| 43 | Alopecia | FAERS: 4 | US FAERS | |
| 44 | Asthma | FAERS: 4 | US FAERS | |
| 45 | Bronchospasm | FAERS: 4 | US FAERS | |
| 46 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 47 | Dysgeusia | FAERS: 4 | US FAERS | |
| 48 | Dyspepsia | FAERS: 4 | US FAERS | |
| 49 | Dysuria | FAERS: 4 | US FAERS | |
| 50 | Extra dose administered | FAERS: 4 | US FAERS | |
| 51 | Glaucoma | FAERS: 4 | US FAERS | |
| 52 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 53 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 54 | Overdose | FAERS: 4 | US FAERS | |
| 55 | Palpitations | FAERS: 4 | US FAERS | |
| 56 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 57 | Urticaria | FAERS: 4 | US FAERS | |
| 58 | Vomiting | FAERS: 4 | US FAERS | |
| 59 | Arthralgia | FAERS: 3 | US FAERS | |
| 60 | Burning sensation | FAERS: 3 | US FAERS | |
| 61 | Cataract | FAERS: 3 | US FAERS | |
| 62 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 63 | Constipation | FAERS: 3 | US FAERS | |
| 64 | Dementia | FAERS: 3 | US FAERS | |
| 65 | Disorientation | FAERS: 3 | US FAERS | |
| 66 | Erythema | FAERS: 3 | US FAERS | |
| 67 | Eye pain | FAERS: 3 | US FAERS | |
| 68 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 69 | Intracranial Aneurysm | FAERS: 3 | US FAERS | |
| 70 | Oral mucosal erythema | FAERS: 3 | US FAERS | |
| 71 | Oxygen saturation abnormal | FAERS: 3 | US FAERS | |
| 72 | Pain | FAERS: 3 | US FAERS | |
| 73 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 74 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 75 | Secretion discharge | FAERS: 3 | US FAERS | |
| 76 | Stress | FAERS: 3 | US FAERS | |
| 77 | Tongue discomfort | FAERS: 3 | US FAERS | |
| 78 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 79 | Weight decreased | FAERS: 3 | US FAERS | |
| 80 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 81 | Aphonia | FAERS: 2 | US FAERS | |
| 82 | Arthritis | FAERS: 2 | US FAERS | |
| 83 | Choking sensation | FAERS: 2 | US FAERS | |
| 84 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 85 | Depressed mood | FAERS: 2 | US FAERS | |
| 86 | Device Failure | FAERS: 2 | US FAERS | |
| 87 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 88 | Euphoric mood | FAERS: 2 | US FAERS | |
| 89 | Facial Pain | FAERS: 2 | US FAERS | |
| 90 | Glossitis | FAERS: 2 | US FAERS | |
| 91 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 92 | Joint swelling | FAERS: 2 | US FAERS | |
| 93 | Limb discomfort | FAERS: 2 | US FAERS | |
| 94 | Macular degeneration | FAERS: 2 | US FAERS | |
| 95 | Mouth swelling | FAERS: 2 | US FAERS | |
| 96 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 97 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 98 | No adverse event | FAERS: 2 | US FAERS | |
| 99 | Respiratory distress | FAERS: 2 | US FAERS | |
| 100 | Sneezing | FAERS: 2 | US FAERS | |
| 101 | Somnolence | FAERS: 2 | US FAERS | |
| 102 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 103 | Stomatitis | FAERS: 2 | US FAERS | |
| 104 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 105 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 106 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 107 | Accidental overdose | FAERS: 1 | US FAERS | |
| 108 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 109 | Amnesia | FAERS: 1 | US FAERS | |
| 110 | Anger | FAERS: 1 | US FAERS | |
| 111 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 112 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 113 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 114 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 115 | Aphasia | FAERS: 1 | US FAERS | |
| 116 | Asphyxia | FAERS: 1 | US FAERS | |
| 117 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 118 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 119 | Back disorder | FAERS: 1 | US FAERS | |
| 120 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 121 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 122 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 123 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 124 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 125 | Bone pain | FAERS: 1 | US FAERS | |
| 126 | Breast discomfort | FAERS: 1 | US FAERS | |
| 127 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 128 | Catheter placement | FAERS: 1 | US FAERS | |
| 129 | Chills | FAERS: 1 | US FAERS | |
| 130 | Chromaturia | FAERS: 1 | US FAERS | |
| 131 | Chronic throat clearing | FAERS: 1 | US FAERS | |
| 132 | Coccidioidomycosis | FAERS: 1 | US FAERS | |
| 133 | Cold sweat | FAERS: 1 | US FAERS | |
| 134 | Cyanosis | FAERS: 1 | US FAERS | |
| 135 | Deafness | FAERS: 1 | US FAERS | |
| 136 | Dental caries | FAERS: 1 | US FAERS | |
| 137 | Device difficult to use | FAERS: 1 | US FAERS | |
| 138 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 139 | Discomfort | FAERS: 1 | US FAERS | |
| 140 | Disease recurrence | FAERS: 1 | US FAERS | |
| 141 | Diverticulitis | FAERS: 1 | US FAERS | |
| 142 | Drug effect faster than expected | FAERS: 1 | US FAERS | |
| 143 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 144 | Drug screen positive | FAERS: 1 | US FAERS | |
| 145 | Dry skin | FAERS: 1 | US FAERS | |
| 146 | Dyschromatopsia | FAERS: 1 | US FAERS | |
| 147 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 148 | Emotional disorder | FAERS: 1 | US FAERS | |
| 149 | Enterobiasis | FAERS: 1 | US FAERS | |
| 150 | Epistaxis | FAERS: 1 | US FAERS | |
| 151 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 152 | Eye irritation | FAERS: 1 | US FAERS | |
| 153 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 154 | Fibrosis | FAERS: 1 | US FAERS | |
| 155 | Flushing | FAERS: 1 | US FAERS | |
| 156 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 157 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 158 | Head discomfort | FAERS: 1 | US FAERS | |
| 159 | Hernia | FAERS: 1 | US FAERS | |
| 160 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 161 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 162 | Hyperventilation | FAERS: 1 | US FAERS | |
| 163 | Hypotension | FAERS: 1 | US FAERS | |
| 164 | Hypoxia | FAERS: 1 | US FAERS | |
| 165 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 166 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 167 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 168 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 169 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 170 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 171 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 172 | Lethargy | FAERS: 1 | US FAERS | |
| 173 | Limb injury | FAERS: 1 | US FAERS | |
| 174 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 175 | Lung hypoinflation | FAERS: 1 | US FAERS | |
| 176 | Lymphoma | FAERS: 1 | US FAERS | |
| 177 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 178 | Maximal Voluntary Ventilation | FAERS: 1 | US FAERS | |
| 179 | Medication monitoring error | FAERS: 1 | US FAERS | |
| 180 | Mental impairment | FAERS: 1 | US FAERS | |
| 181 | Microsleep | FAERS: 1 | US FAERS | |
| 182 | Mood swings | FAERS: 1 | US FAERS | |
| 183 | Mumps | FAERS: 1 | US FAERS | |
| 184 | Muscle strain | FAERS: 1 | US FAERS | |
| 185 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 186 | Myalgia | FAERS: 1 | US FAERS | |
| 187 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 188 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 189 | Off label use of device | FAERS: 1 | US FAERS | |
| 190 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 191 | Oral discharge | FAERS: 1 | US FAERS | |
| 192 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 193 | Oral infection | FAERS: 1 | US FAERS | |
| 194 | Oral pain | FAERS: 1 | US FAERS | |
| 195 | Osteoporosis | FAERS: 1 | US FAERS | |
| 196 | Oxygen Consumption | FAERS: 1 | US FAERS | |
| 197 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 198 | Panic Disorder | FAERS: 1 | US FAERS | |
| 199 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 200 | Pharyngitis | FAERS: 1 | US FAERS | |
| 201 | Photophobia | FAERS: 1 | US FAERS | |
| 202 | Pneumonectomy | FAERS: 1 | US FAERS | |
| 203 | Pneumothorax | FAERS: 1 | US FAERS | |
| 204 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 205 | Post procedural complication | FAERS: 1 | US FAERS | |
| 206 | Product adhesion issue | FAERS: 1 | US FAERS | |
| 207 | Product dispensing error | FAERS: 1 | US FAERS | |
| 208 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 209 | Product packaging issue | FAERS: 1 | US FAERS | |
| 210 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 211 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 212 | Product use issue | FAERS: 1 | US FAERS | |
| 213 | Prosopagnosia | FAERS: 1 | US FAERS | |
| 214 | Prosthetic cardiac valve thrombosis | FAERS: 1 | US FAERS | |
| 215 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 216 | Regurgitation | FAERS: 1 | US FAERS | |
| 217 | Renal mass | FAERS: 1 | US FAERS | |
| 218 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 219 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 220 | Sinus pain | FAERS: 1 | US FAERS | |
| 221 | Sputum retention | FAERS: 1 | US FAERS | |
| 222 | Sudden death | FAERS: 1 | US FAERS | |
| 223 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 224 | Swelling | FAERS: 1 | US FAERS | |
| 225 | Tachycardia | FAERS: 1 | US FAERS | |
| 226 | Teeth brittle | FAERS: 1 | US FAERS | |
| 227 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 228 | Tongue erythema | FAERS: 1 | US FAERS | |
| 229 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 230 | Tooth Infection | FAERS: 1 | US FAERS | |
| 231 | Toothache | FAERS: 1 | US FAERS | |
| 232 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 233 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 234 | Vertigo | FAERS: 1 | US FAERS | |
| 235 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 236 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 237 | Wrong product administered | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.