Solifenacin Succinate
(FBOUYBDGKBSUES-VXKWHMMOSA-N)
Structure
- SMILES
- O=C(N1CCc2c([C@@H]1c1ccccc1)cccc2)O[C@H]1CN2CCC1CC2
- Type(s)
- Approved
- ATC code(s)
- G04BD08; G04CA53
- Molecular Formula:
- C23H26N2O2
- Molecular Weight:
- 362.465
- Log P:
- 3.7407
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 32.78
- CAS Number(s):
- 242478-37-1
Synonym(s)
1.
Solifenacin Succinate
2.
2(1H)-Isoquinolinecarboxylic acid, 3,4-dihydro-1-phenyl-,1- azabicyclo(2.2.2)oct-3-yl ester, (R-(R*,S*))-
3.
Quinuclidin-3'-yl-1-phenyl-1,2,3,4-tetrahydroisoquinoline-2-carboxylate monosuccinate
4.
Solifenacin
5.
Vesicare
6.
YM 905
7.
YM905
8.
905, YM
9.
Succinate, Solifenacin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 11 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 2 | Cerebrovascular accident | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Urinary Incontinence | FAERS: 6 | US FAERS | |
| 4 | Constipation | FAERS: 4 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 5 | Malaise | FAERS: 4 | US FAERS | |
| 6 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 7 | Arthritis | FAERS: 3 | US FAERS | |
| 8 | Drug dose omission | FAERS: 3 | US FAERS | |
| 9 | Fatigue | FAERS: 3 | SIDER US FAERS | |
| 10 | Headache | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 12 | Pain | FAERS: 3 | US FAERS | |
| 13 | Syncope | FAERS: 3 | US FAERS | |
| 14 | Urinary Retention | FAERS: 3 | SIDER US FAERS | |
| 15 | Back disorder | FAERS: 2 | US FAERS | |
| 16 | Bladder prolapse | FAERS: 2 | US FAERS | |
| 17 | Dizziness | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 18 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 19 | Memory impairment | FAERS: 2 | US FAERS | |
| 20 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 21 | Nausea | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Thrombosis | FAERS: 2 | US FAERS | |
| 23 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 24 | Ageusia | FAERS: 1 | US FAERS | |
| 25 | Alopecia | FAERS: 1 | US FAERS | |
| 26 | Amnesia | FAERS: 1 | US FAERS | |
| 27 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 28 | Anuria | FAERS: 1 | US FAERS | |
| 29 | Aphasia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Arthralgia | FAERS: 1 | US FAERS | |
| 31 | Asthenia | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 32 | Back Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 34 | Bladder pain | FAERS: 1 | SIDER US FAERS | |
| 35 | Blindness | FAERS: 1 | US FAERS | |
| 36 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 37 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 38 | Burning sensation | FAERS: 1 | US FAERS | |
| 39 | Cataract | FAERS: 1 | US FAERS | |
| 40 | Cellulitis | FAERS: 1 | US FAERS | |
| 41 | Chest discomfort | FAERS: 1 | US FAERS | |
| 42 | Deafness | FAERS: 1 | US FAERS | |
| 43 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 44 | Delirium | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 45 | Dementia | FAERS: 1 | US FAERS | |
| 46 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 47 | Discomfort | FAERS: 1 | US FAERS | |
| 48 | Drug administration error | FAERS: 1 | US FAERS | |
| 49 | Dysuria | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 50 | Ecchymosis | FAERS: 1 | US FAERS | |
| 51 | Eczema | FAERS: 1 | US FAERS | |
| 52 | Enuresis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Erythema | FAERS: 1 | US FAERS | |
| 54 | Expired product administered | FAERS: 1 | US FAERS | |
| 55 | Feeling abnormal | FAERS: 1 | SIDER US FAERS | |
| 56 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 57 | Fracture | FAERS: 1 | US FAERS | |
| 58 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 59 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 60 | Hypersensitivity | FAERS: 1 | SIDER US FAERS | |
| 61 | Impaired work ability | FAERS: 1 | US FAERS | |
| 62 | Incontinence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Infection | FAERS: 1 | SIDER US FAERS | |
| 64 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 65 | Joint injury | FAERS: 1 | US FAERS | |
| 66 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 67 | Lichen Planus | FAERS: 1 | US FAERS | |
| 68 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 69 | Myocardial strain | FAERS: 1 | US FAERS | |
| 70 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 71 | Orchitis | FAERS: 1 | US FAERS | |
| 72 | Overdose | FAERS: 1 | US FAERS | |
| 73 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 74 | Post procedural complication | FAERS: 1 | US FAERS | |
| 75 | Product packaging issue | FAERS: 1 | US FAERS | |
| 76 | Product supply issue | FAERS: 1 | US FAERS | |
| 77 | Prolapse repair | FAERS: 1 | US FAERS | |
| 78 | Pruritus | FAERS: 1 | SIDER US FAERS | |
| 79 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 80 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 81 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 82 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 83 | Renal pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 85 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 86 | Somnolence | FAERS: 1 | SIDER US FAERS | |
| 87 | Stupor | FAERS: 1 | US FAERS | |
| 88 | Swelling | FAERS: 1 | US FAERS | |
| 89 | Tachycardia | FAERS: 1 | SIDER US FAERS | |
| 90 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 91 | Urethral Stenosis | FAERS: 1 | US FAERS | |
| 92 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 93 | Visual Impairment | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 95 | Weight decreased | FAERS: 1 | US FAERS | |
| 96 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 97 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 98 | prostatitis | FAERS: 1 | US FAERS | |
| 99 | Abdominal Pain | SIDER | ||
| 100 | Abdominal discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 101 | Anaphylactic shock | SIDER | ||
| 102 | Angioedema | SIDER | ||
| 103 | Atrial Fibrillation | SIDER | ||
| 104 | Cystitis | SIDER | ||
| 105 | Dermatitis | SIDER | ||
| 106 | Dry skin | SIDER | ||
| 107 | Dysgeusia | SIDER | ||
| 108 | Dyspepsia | SIDER | ||
| 109 | Dysphonia | SIDER | ||
| 110 | Erythema Multiforme | SIDER | ||
| 111 | Gastrointestinal Pain | SIDER | ||
| 112 | Glaucoma | SIDER | ||
| 113 | Ileus | SIDER | ||
| 114 | Infestation | SIDER | ||
| 115 | Influenza | SIDER | ||
| 116 | Intestinal Obstruction | SIDER | ||
| 117 | Malnutrition | SIDER | ||
| 118 | Nocturia | Canada Vigilance: 4 | Canada Vigilance | |
| 119 | Palpitations | SIDER | ||
| 120 | Pharyngitis | SIDER | ||
| 121 | Product substitution issue | Canada Vigilance: 13 | Canada Vigilance | |
| 122 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 123 | Urinary tract infection | SIDER | ||
| 124 | Urticaria | SIDER | ||
| 125 | Vomiting | Canada Vigilance: 1 | Canada Vigilance SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.