AG-221
(DYLUUSLLRIQKOE-UHFFFAOYSA-N)
Structure
- SMILES
- CC(CNc1nc(Nc2ccnc(c2)C(F)(F)F)nc(n1)c1cccc(n1)C(F)(F)F)(O)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XX59
- Molecular Formula:
- C19H17F6N7O
- Molecular Weight:
- 473.375
- Log P:
- 4.4386
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 108.74
- CAS Number(s):
- 1446502-11-9
Synonym(s)
1.
AG-221
2.
enasidenib
External Link(s)
| MeSH | C000605269 |
| PubChem Compound | 89683805 |
| ChEBI | 145374 |
| CHEMBL | CHEMBL3989908 |
| DrugBank | DB13874 |
| DrugCentral | 5251 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 8960 |
| KEGG | dr:D10901 |
| ZINC | 222731806 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Pneumonia | FAERS: 15 | US FAERS | |
| 4 | Full blood count decreased | FAERS: 13 | US FAERS | |
| 5 | White blood cell count decreased | FAERS: 13 | US FAERS | |
| 6 | Drug ineffective | FAERS: 12 | US FAERS | |
| 7 | IDH differentiation syndrome | FAERS: 12 | US FAERS | |
| 8 | Sepsis | FAERS: 10 | US FAERS | |
| 9 | Febrile Neutropenia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Thrombocytopenia | FAERS: 8 | US FAERS | |
| 11 | Arthralgia | FAERS: 7 | US FAERS | |
| 12 | Asthenia | FAERS: 7 | US FAERS | |
| 13 | Septic Shock | FAERS: 7 | US FAERS | |
| 14 | Acute promyelocytic leukaemia differentiation syndrome | FAERS: 6 | US FAERS | |
| 15 | Headache | FAERS: 6 | US FAERS | |
| 16 | Constipation | FAERS: 5 | US FAERS | |
| 17 | Disease Progression | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Dysgeusia | FAERS: 5 | US FAERS | |
| 19 | Influenza | FAERS: 5 | US FAERS | |
| 20 | Pancytopenia | FAERS: 5 | US FAERS | |
| 21 | Dizziness | FAERS: 4 | US FAERS | |
| 22 | Epistaxis | FAERS: 4 | US FAERS | |
| 23 | Infection | FAERS: 4 | US FAERS | |
| 24 | Joint swelling | FAERS: 4 | US FAERS | |
| 25 | Malaise | FAERS: 4 | US FAERS | |
| 26 | Neutropenia | FAERS: 4 | US FAERS | |
| 27 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 28 | Bone pain | FAERS: 3 | US FAERS | |
| 29 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 30 | Myalgia | FAERS: 3 | US FAERS | |
| 31 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 32 | Pruritus | FAERS: 3 | US FAERS | |
| 33 | Vomiting | FAERS: 3 | US FAERS | |
| 34 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 35 | Back Pain | FAERS: 2 | US FAERS | |
| 36 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 37 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 38 | Leukocytosis | FAERS: 2 | US FAERS | |
| 39 | Multiple allergies | FAERS: 2 | US FAERS | |
| 40 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 41 | Product dose omission | FAERS: 2 | US FAERS | |
| 42 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 43 | Sleep Talking | FAERS: 2 | US FAERS | |
| 44 | Unevaluable event | FAERS: 2 | US FAERS | |
| 45 | jaundice | FAERS: 2 | US FAERS | |
| 46 | treatment failure | FAERS: 2 | US FAERS | |
| 47 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 48 | Ageusia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Anosmia | FAERS: 1 | US FAERS | |
| 50 | Anxiety | FAERS: 1 | US FAERS | |
| 51 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 52 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 53 | Blast cell count decreased | FAERS: 1 | US FAERS | |
| 54 | Blast cell count increased | FAERS: 1 | US FAERS | |
| 55 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 56 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 57 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 58 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 59 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 60 | Blood uric acid abnormal | FAERS: 1 | US FAERS | |
| 61 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 62 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 63 | Cellulitis | FAERS: 1 | US FAERS | |
| 64 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 65 | Chest Pain | FAERS: 1 | US FAERS | |
| 66 | Choking | FAERS: 1 | US FAERS | |
| 67 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 68 | Colitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Cytopenia | FAERS: 1 | US FAERS | |
| 70 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 71 | Dehydration | FAERS: 1 | US FAERS | |
| 72 | Depressed mood | FAERS: 1 | US FAERS | |
| 73 | Diplopia | FAERS: 1 | US FAERS | |
| 74 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 75 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 76 | Dry skin | FAERS: 1 | US FAERS | |
| 77 | Eczema | FAERS: 1 | US FAERS | |
| 78 | Enterocolitis | FAERS: 1 | US FAERS | |
| 79 | Erythema | FAERS: 1 | US FAERS | |
| 80 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 81 | Flatulence | FAERS: 1 | US FAERS | |
| 82 | Gait inability | FAERS: 1 | US FAERS | |
| 83 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 84 | Hepatitis C | FAERS: 1 | US FAERS | |
| 85 | Hernia | FAERS: 1 | US FAERS | |
| 86 | Hypersomnia | FAERS: 1 | US FAERS | |
| 87 | Hypogeusia | FAERS: 1 | US FAERS | |
| 88 | Hypotension | FAERS: 1 | US FAERS | |
| 89 | Hypoxia | FAERS: 1 | US FAERS | |
| 90 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 91 | Joint stiffness | FAERS: 1 | US FAERS | |
| 92 | Leukopenia | FAERS: 1 | US FAERS | |
| 93 | Lip swelling | FAERS: 1 | US FAERS | |
| 94 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 95 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 96 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 97 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 98 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 99 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 100 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 101 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 102 | Pain | FAERS: 1 | US FAERS | |
| 103 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 104 | Pericarditis | FAERS: 1 | US FAERS | |
| 105 | Presyncope | FAERS: 1 | US FAERS | |
| 106 | Productive Cough | FAERS: 1 | US FAERS | |
| 107 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 108 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 109 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 110 | Rash erythematous | FAERS: 1 | US FAERS | |
| 111 | Renal pain | FAERS: 1 | US FAERS | |
| 112 | Somnolence | FAERS: 1 | US FAERS | |
| 113 | Starvation | FAERS: 1 | US FAERS | |
| 114 | Stress | FAERS: 1 | US FAERS | |
| 115 | Syncope | FAERS: 1 | US FAERS | |
| 116 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 117 | Thrombosis | FAERS: 1 | US FAERS | |
| 118 | Transaminases increased | FAERS: 1 | US FAERS | |
| 119 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 120 | Weight decreased | FAERS: 1 | US FAERS | |
| 121 | White blood cell count abnormal | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.