Ambenonium Chloride
(DXUUXWKFVDVHIK-UHFFFAOYSA-N)
Structure
- SMILES
- CC[N+](Cc1ccccc1Cl)(CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)CC.[Cl-].[Cl-]
- Molecular Formula:
- C28H42Cl4N4O2
- Molecular Weight:
- 608.471
- Log P:
- -0.5710
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 58.2
- CAS Number(s):
- 115-79-7; 52022-31-8
Synonym(s)
1.
Ambenonium Chloride
2.
Mytelase
3.
Chloride, Ambenonium
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 2 | Malaise | FAERS: 2 | US FAERS | |
| 3 | Pain | FAERS: 2 | US FAERS | |
| 4 | Asthenia | FAERS: 1 | US FAERS | |
| 5 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 6 | Back Pain | FAERS: 1 | US FAERS | |
| 7 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 8 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 9 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 10 | Myalgia | FAERS: 1 | US FAERS | |
| 11 | Nausea | FAERS: 1 | US FAERS | |
| 12 | Overdose | FAERS: 1 | US FAERS | |
| 13 | Polyhydramnios | FAERS: 1 | US FAERS | |
| 14 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 15 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 16 | Vertigo | FAERS: 1 | US FAERS | |
| 17 | Visual disturbance | FAERS: 1 | US FAERS | |
| 18 | Vomiting | FAERS: 1 | US FAERS | |
| 19 | Abdominal Pain | 11132996 | CTD | |
| 20 | Angina Pectoris | 11132996 | CTD | |
| 21 | Diarrhea | 11132996 | CTD | |
| 22 | Hypotension | 8010419 | CTD | |
| 23 | Myasthenia Gravis | 11132996 | CTD | |
| 24 | Sialorrhea | 11132996 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.