Econazole
(DDXORDQKGIZAME-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1ccc(cc1)COC(c1ccc(cc1Cl)Cl)Cn1cncc1.[O-][N+](=O)O
- Molecular Formula:
- C18H16Cl3N3O4
- Molecular Weight:
- 444.696
- Log P:
- 5.9769
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 93.1
- CAS Number(s):
- 24169-02-6; 68797-31-9
Synonym(s)
1.
Econazole
2.
Econazole Nitrate
3.
Ekonazole
4.
Gyno-Pervaryl 150
5.
Gyno-Pevaril
6.
Gyno-Pevaryl
7.
Pevaryl
8.
Gyno Pervaryl 150
9.
Gyno Pevaril
10.
Gyno Pevaryl
11.
GynoPevaril
12.
Nitrate, Econazole
External Link(s)
| MeSH | D004464 |
| PubChem Compound | 68589 |
| CHEMBL | CHEMBL1201049 |
| KEGG | cpd:C08069 dr:D00881 |
| Therapeutic Target Database | D0J1CL |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 7 | US FAERS | |
| 2 | Pruritus | FAERS: 4 | US FAERS | |
| 3 | Burning sensation | FAERS: 3 | US FAERS | |
| 4 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 5 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 6 | Nausea | FAERS: 3 | US FAERS | |
| 7 | Pain | FAERS: 3 | US FAERS | |
| 8 | Poisoning | FAERS: 3 | US FAERS | |
| 9 | Application site burn | FAERS: 2 | US FAERS | |
| 10 | Cellulitis | FAERS: 2 | US FAERS | |
| 11 | Deafness | FAERS: 2 | US FAERS | |
| 12 | Erythema | FAERS: 2 | US FAERS | |
| 13 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 14 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 15 | Urticaria | FAERS: 2 | US FAERS | |
| 16 | Vomiting | FAERS: 2 | US FAERS | |
| 17 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 18 | Application site discharge | FAERS: 1 | US FAERS | |
| 19 | Application site erythema | FAERS: 1 | US FAERS | |
| 20 | Application site hypersensitivity | FAERS: 1 | US FAERS | |
| 21 | Application site pain | FAERS: 1 | US FAERS | |
| 22 | Application site reaction | FAERS: 1 | US FAERS | |
| 23 | Application site swelling | FAERS: 1 | US FAERS | |
| 24 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 25 | Chemical injury | FAERS: 1 | US FAERS | |
| 26 | Chills | FAERS: 1 | US FAERS | |
| 27 | Device malfunction | FAERS: 1 | US FAERS | |
| 28 | Dizziness | FAERS: 1 | US FAERS | |
| 29 | Drug dose omission | FAERS: 1 | US FAERS | |
| 30 | Eczema | FAERS: 1 | US FAERS | |
| 31 | Expired product administered | FAERS: 1 | US FAERS | |
| 32 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 33 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 34 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 35 | Mononeuritis | FAERS: 1 | US FAERS | |
| 36 | Mouth swelling | FAERS: 1 | US FAERS | |
| 37 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 38 | Palpitations | FAERS: 1 | US FAERS | |
| 39 | Post procedural complication | FAERS: 1 | US FAERS | |
| 40 | Product substitution issue | FAERS: 1 | US FAERS | |
| 41 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 42 | Product use issue | FAERS: 1 | US FAERS | |
| 43 | Rash erythematous | FAERS: 1 | US FAERS | |
| 44 | Swelling | FAERS: 1 | US FAERS | |
| 45 | Thermal burn | FAERS: 1 | US FAERS | |
| 46 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 47 | Tremor | FAERS: 1 | US FAERS | |
| 48 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 49 | Urinary Retention | FAERS: 1 | US FAERS | |
| 50 | Vertigo | FAERS: 1 | US FAERS | |
| 51 | Wrong drug administered | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.