Daclatasvir dihydrochloride
(BVZLLUDATICXCI-JMSCDMLISA-N)
Structure
- SMILES
- COC(=O)N[C@H](C(=O)N1CCC[C@H]1c1ncc([nH]1)c1ccc(cc1)c1ccc(cc1)c1cnc([nH]1)[C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)OC)C(C)C.Cl.Cl
- Molecular Formula:
- C40H52Cl2N8O6
- Molecular Weight:
- 811.797
- Log P:
- 8.4836
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 6
- TPSA:
- 174.64
- CAS Number(s):
- 1009119-65-6
Synonym(s)
1.
Daclatasvir dihydrochloride
External Link(s)
| PubChem Compound | 25154713 |
| ChEBI | 83800 |
| CHEMBL | CHEMBL2303621 |
| KEGG | dr:D10105 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Hepatic Encephalopathy | FAERS: 4 | US FAERS | |
| 2 | Dizziness | FAERS: 3 | US FAERS | |
| 3 | Drug ineffective | FAERS: 3 | US FAERS | |
| 4 | Hepatitis | FAERS: 3 | US FAERS | |
| 5 | Fatigue | FAERS: 2 | US FAERS | |
| 6 | Hepatitis C | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Lymphoma | FAERS: 2 | US FAERS | |
| 8 | Malaise | FAERS: 2 | US FAERS | |
| 9 | Nausea | FAERS: 2 | US FAERS | |
| 10 | Vertigo | FAERS: 2 | US FAERS | |
| 11 | jaundice | FAERS: 2 | US FAERS | |
| 12 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 13 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 14 | Ammonia increased | FAERS: 1 | US FAERS | |
| 15 | Amnesia | FAERS: 1 | US FAERS | |
| 16 | Ascites | FAERS: 1 | US FAERS | |
| 17 | Asphyxia | FAERS: 1 | US FAERS | |
| 18 | Back Pain | FAERS: 1 | US FAERS | |
| 19 | Bronchitis | FAERS: 1 | US FAERS | |
| 20 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 21 | Chromaturia | FAERS: 1 | US FAERS | |
| 22 | Colitis | FAERS: 1 | US FAERS | |
| 23 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 24 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 25 | Cyst removal | FAERS: 1 | US FAERS | |
| 26 | Cyst | FAERS: 1 | US FAERS | |
| 27 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 28 | Dehydration | FAERS: 1 | US FAERS | |
| 29 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 30 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 31 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 32 | Dyspepsia | FAERS: 1 | US FAERS | |
| 33 | Feeling Cold | FAERS: 1 | US FAERS | |
| 34 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 35 | Headache | FAERS: 1 | US FAERS | |
| 36 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 37 | Herpes Zoster Oticus | FAERS: 1 | US FAERS | |
| 38 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 39 | Influenza | FAERS: 1 | US FAERS | |
| 40 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 41 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 42 | Pneumonia | FAERS: 1 | US FAERS | |
| 43 | Pregnancy on contraceptive | FAERS: 1 | US FAERS | |
| 44 | Product use issue | FAERS: 1 | US FAERS | |
| 45 | Schizophrenia | FAERS: 1 | US FAERS | |
| 46 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 47 | Transplant | FAERS: 1 | US FAERS | |
| 48 | Tremor | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.