GDC-0973
(BSMCAPRUBJMWDF-KRWDZBQOSA-N)
Structure
- SMILES
- Ic1ccc(c(c1)F)Nc1c(ccc(c1F)F)C(=O)N1CC(C1)(O)[C@@H]1CCCCN1
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE38
- Molecular Formula:
- C21H21F3IN3O2
- Molecular Weight:
- 531.310
- Log P:
- 4.1208
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 64.6
- CAS Number(s):
- 934660-93-2
Synonym(s)
1.
GDC-0973
2.
(3,4-difluoro-2-(2-fluoro-4-iodophenylamino)phenyl)(3-hydroxy-3-(piperidin-2-yl)azetidin-1-yl)methanone
3.
XL518
4.
cobimetinib
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Intentional product use issue | FAERS: 7 | US FAERS | |
| 2 | No adverse event | FAERS: 7 | US FAERS | |
| 3 | Fatigue | FAERS: 5 | US FAERS | |
| 4 | Acne | FAERS: 3 | US FAERS | |
| 5 | Alopecia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 7 | Myalgia | FAERS: 3 | US FAERS | |
| 8 | Nausea | FAERS: 3 | US FAERS | |
| 9 | Vomiting | FAERS: 3 | US FAERS | |
| 10 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 11 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 12 | Disease Progression | FAERS: 2 | US FAERS | |
| 13 | Dizziness | FAERS: 2 | US FAERS | |
| 14 | Dyspepsia | FAERS: 2 | US FAERS | |
| 15 | Hypersomnia | FAERS: 2 | US FAERS | |
| 16 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 17 | Pneumonia | FAERS: 2 | US FAERS | |
| 18 | Skin toxicity | FAERS: 2 | US FAERS | |
| 19 | Toxic Epidermal Necrolysis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 20 | Visual Impairment | FAERS: 2 | US FAERS | |
| 21 | Abasia | FAERS: 1 | US FAERS | |
| 22 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 23 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 24 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 25 | Amnesia | FAERS: 1 | US FAERS | |
| 26 | Anger | FAERS: 1 | US FAERS | |
| 27 | Arthralgia | FAERS: 1 | US FAERS | |
| 28 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 29 | Asthenia | FAERS: 1 | US FAERS | |
| 30 | Blindness | FAERS: 1 | US FAERS | |
| 31 | Capillary Leak Syndrome | FAERS: 1 | US FAERS | |
| 32 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 33 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 34 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 35 | Chills | FAERS: 1 | US FAERS | |
| 36 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 37 | Dehydration | FAERS: 1 | US FAERS | |
| 38 | Dermatitis | FAERS: 1 | US FAERS | |
| 39 | Discomfort | FAERS: 1 | US FAERS | |
| 40 | Drug ineffective | FAERS: 1 | US FAERS | |
| 41 | Dry skin | FAERS: 1 | US FAERS | |
| 42 | Dysgeusia | FAERS: 1 | US FAERS | |
| 43 | Epistaxis | FAERS: 1 | US FAERS | |
| 44 | Flatulence | FAERS: 1 | US FAERS | |
| 45 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 46 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 47 | Gastrointestinal toxicity | FAERS: 1 | US FAERS | |
| 48 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 49 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 50 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 51 | Lip swelling | FAERS: 1 | US FAERS | |
| 52 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 53 | Malaise | FAERS: 1 | US FAERS | |
| 54 | Muscle tightness | FAERS: 1 | US FAERS | |
| 55 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 56 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 57 | Neutropenia | FAERS: 1 | US FAERS | |
| 58 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 59 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 60 | Product storage error | FAERS: 1 | US FAERS | |
| 61 | Pruritus | FAERS: 1 | US FAERS | |
| 62 | Purulence | FAERS: 1 | US FAERS | |
| 63 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 64 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 65 | Syncope | FAERS: 1 | US FAERS | |
| 66 | Thrombocytopenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Tracheal fistula | FAERS: 1 | US FAERS | |
| 68 | Tremor | FAERS: 1 | US FAERS | |
| 69 | Urticaria | FAERS: 1 | US FAERS | |
| 70 | Uveitis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.