Nitrofurantoin (monohydrate/macrocrystals)
(BSLHEIMRYGTUBN-UAEFFNJYSA-N)
Structure
- SMILES
- O=C1NC(=O)N(C1)/N=C/c1ccc(o1)[N+](=O)[O-].O=C1NC(=O)N(C1)/N=C/c1ccc(o1)[N+](=O)[O-]
- Molecular Formula:
- C16H12N8O10
- Molecular Weight:
- 476.314
- Log P:
- 1.7268
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 2
- TPSA:
- 241.46
- CAS Number(s):
- N/A
Synonym(s)
1.
Nitrofurantoin (monohydrate/macrocrystals)
External Link(s)
| PubChem Compound | 24848111 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 6 | US FAERS | |
| 2 | Asthenia | FAERS: 5 | US FAERS | |
| 3 | Chills | FAERS: 5 | US FAERS | |
| 4 | Nausea | FAERS: 5 | US FAERS | |
| 5 | Malaise | FAERS: 4 | US FAERS | |
| 6 | Myalgia | FAERS: 4 | US FAERS | |
| 7 | Vomiting | FAERS: 4 | US FAERS | |
| 8 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 9 | Chest Pain | FAERS: 3 | US FAERS | |
| 10 | Dizziness | FAERS: 3 | US FAERS | |
| 11 | Fatigue | FAERS: 3 | US FAERS | |
| 12 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 13 | Pruritus | FAERS: 3 | US FAERS | |
| 14 | Arthralgia | FAERS: 2 | US FAERS | |
| 15 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 16 | Burning sensation | FAERS: 2 | US FAERS | |
| 17 | Chromaturia | FAERS: 2 | US FAERS | |
| 18 | Somnolence | FAERS: 2 | US FAERS | |
| 19 | Urticaria | FAERS: 2 | US FAERS | |
| 20 | Abasia | FAERS: 1 | US FAERS | |
| 21 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 22 | Back Pain | FAERS: 1 | US FAERS | |
| 23 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 24 | Bone pain | FAERS: 1 | US FAERS | |
| 25 | Constipation | FAERS: 1 | US FAERS | |
| 26 | Dehydration | FAERS: 1 | US FAERS | |
| 27 | Depressed mood | FAERS: 1 | US FAERS | |
| 28 | Dermatitis | FAERS: 1 | US FAERS | |
| 29 | Diplopia | FAERS: 1 | US FAERS | |
| 30 | Drug ineffective | FAERS: 1 | US FAERS | |
| 31 | Dysgeusia | FAERS: 1 | US FAERS | |
| 32 | Dyspepsia | FAERS: 1 | US FAERS | |
| 33 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 34 | Facial Pain | FAERS: 1 | US FAERS | |
| 35 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 36 | Flatulence | FAERS: 1 | US FAERS | |
| 37 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 38 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 39 | Immobile | FAERS: 1 | US FAERS | |
| 40 | Impaired work ability | FAERS: 1 | US FAERS | |
| 41 | Influenza | FAERS: 1 | US FAERS | |
| 42 | Lethargy | FAERS: 1 | US FAERS | |
| 43 | Lung Injury | FAERS: 1 | US FAERS | |
| 44 | Mental impairment | FAERS: 1 | US FAERS | |
| 45 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 46 | Neuralgia | FAERS: 1 | US FAERS | |
| 47 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 48 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 49 | Pain | FAERS: 1 | US FAERS | |
| 50 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 51 | Pneumonia | FAERS: 1 | US FAERS | |
| 52 | Poisoning | FAERS: 1 | US FAERS | |
| 53 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 54 | Purpura | FAERS: 1 | US FAERS | |
| 55 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 56 | Sepsis | FAERS: 1 | US FAERS | |
| 57 | Swelling | FAERS: 1 | US FAERS | |
| 58 | Throat irritation | FAERS: 1 | US FAERS | |
| 59 | Tremor | FAERS: 1 | US FAERS | |
| 60 | Visual Impairment | FAERS: 1 | US FAERS | |
| 61 | Weight decreased | FAERS: 1 | US FAERS | |
| 62 | Wheezing | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.