fomesafen
(BGZZWXTVIYUUEY-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1cc(ccc1Oc1ccc(c(c1)C(=O)NS(=O)(=O)C)[N+](=O)[O-])C(F)(F)F
- Molecular Formula:
- C15H10ClF3N2O6S
- Molecular Weight:
- 438.763
- Log P:
- 5.7436
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 126.67
- CAS Number(s):
- 72178-02-0
Synonym(s)
1.
fomesafen
2.
5-(2-chloro-4-(trifluoromethyl)-phenoxy)-N-(methylsulfonyl)-2-nitrobenzamide
3.
fomesafen potassium
4.
fomesafen sodium
External Link(s)
| MeSH | C088563 |
| PubChem Compound | 51556 |
| ChEBI | 81925 |
| CHEMBL | CHEMBL1898629 |
| KEGG | cpd:C18736 |
| ZINC | 1851764 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Neuroleptic Malignant Syndrome | FAERS: 4 | US FAERS | |
| 2 | Completed Suicide | FAERS: 3 | US FAERS | |
| 3 | Activation syndrome | FAERS: 2 | US FAERS | |
| 4 | Arthralgia | FAERS: 2 | US FAERS | |
| 5 | Constipation | FAERS: 2 | US FAERS | |
| 6 | Dehydration | FAERS: 2 | US FAERS | |
| 7 | Eczema | FAERS: 2 | US FAERS | |
| 8 | Limb discomfort | FAERS: 2 | US FAERS | |
| 9 | Overdose | FAERS: 2 | US FAERS | |
| 10 | Agitation | FAERS: 1 | US FAERS | |
| 11 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 12 | Bradycardia | FAERS: 1 | US FAERS | |
| 13 | Epilepsy | FAERS: 1 | US FAERS | |
| 14 | Memory impairment | FAERS: 1 | US FAERS | |
| 15 | Norepinephrine increased | FAERS: 1 | US FAERS | |
| 16 | Pharyngitis | FAERS: 1 | US FAERS | |
| 17 | Polydipsia | FAERS: 1 | US FAERS | |
| 18 | Restlessness | FAERS: 1 | US FAERS | |
| 19 | Somnolence | FAERS: 1 | US FAERS | |
| 20 | Stomatitis | FAERS: 1 | US FAERS | |
| 21 | Porphyrias, Hepatic | 12758057 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.