Nafcillin
(AYAPZOUDXCDGIF-FRFVDRIFSA-M)
Structure
- SMILES
- CCOc1ccc2c(c1C(=O)N[C@@H]1C(=O)N3[C@@H]1SC([C@@H]3C(=O)[O-])(C)C)cccc2.[Na+]
- Molecular Formula:
- C21H21N2NaO5S
- Molecular Weight:
- 436.457
- Log P:
- 1.4779
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 1
- TPSA:
- 124.07
- CAS Number(s):
- 985-16-0
Synonym(s)
1.
Nafcillin
2.
Naphthamidopenicillin
3.
Sodium Nafcillin
4.
Nafcil
5.
Nafcillin Sodium
6.
Nafcillin, Monosodium Salt, Anhydrous
7.
Nafcillin, Sodium
8.
Sodium, Nafcillin
External Link(s)
| MeSH | D009254 |
| PubChem Compound | 23667630 101534048 |
| ChEBI | 7448 |
| CHEMBL | CHEMBL1200344 |
| KEGG | cpd:C08124 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Hepatotoxicity | FAERS: 7 | US FAERS | |
| 2 | Renal tubular necrosis | FAERS: 7 | US FAERS | |
| 3 | Blood creatinine increased | FAERS: 6 | US FAERS | |
| 4 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 5 | Nausea | FAERS: 3 | US FAERS | |
| 6 | Pruritus | FAERS: 3 | US FAERS | |
| 7 | Vomiting | FAERS: 3 | US FAERS | |
| 8 | Arthralgia | FAERS: 2 | US FAERS | |
| 9 | Blood urea increased | FAERS: 2 | US FAERS | |
| 10 | Rash erythematous | FAERS: 2 | US FAERS | |
| 11 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 12 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 13 | Acidosis | FAERS: 1 | US FAERS | |
| 14 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 15 | Anuria | FAERS: 1 | US FAERS | |
| 16 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 17 | Bacteria stool identified | FAERS: 1 | US FAERS | |
| 18 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 19 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 20 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 21 | Bradycardia | FAERS: 1 | US FAERS | |
| 22 | Burning sensation | FAERS: 1 | US FAERS | |
| 23 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 24 | Chest Pain | FAERS: 1 | US FAERS | |
| 25 | Cholestasis | FAERS: 1 | US FAERS | |
| 26 | Chromaturia | FAERS: 1 | US FAERS | |
| 27 | Constipation | FAERS: 1 | US FAERS | |
| 28 | Dehydration | FAERS: 1 | US FAERS | |
| 29 | Drug screen positive | FAERS: 1 | US FAERS | |
| 30 | Fatigue | FAERS: 1 | US FAERS | |
| 31 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 32 | Flank Pain | FAERS: 1 | US FAERS | |
| 33 | Ileus | FAERS: 1 | US FAERS | |
| 34 | Incontinence | FAERS: 1 | US FAERS | |
| 35 | Joint swelling | FAERS: 1 | US FAERS | |
| 36 | Lethargy | FAERS: 1 | US FAERS | |
| 37 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 38 | Mental status changes | FAERS: 1 | US FAERS | |
| 39 | Nephrogenic Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 40 | Neutropenia | FAERS: 1 | US FAERS | |
| 41 | Sepsis | FAERS: 1 | US FAERS | |
| 42 | Septic Shock | FAERS: 1 | US FAERS | |
| 43 | Serum Sickness | FAERS: 1 | US FAERS | |
| 44 | Sneezing | FAERS: 1 | US FAERS | |
| 45 | Throat irritation | FAERS: 1 | US FAERS | |
| 46 | White blood cell count decreased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.