Aclidinium
(ASMXXROZKSBQIH-VITNCHFBSA-N)
Structure
- SMILES
- O=C(C(c1cccs1)(c1cccs1)O)O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2
- Type(s)
- Approved
- ATC code(s)
- R03AL05; R03BB05
- Molecular Formula:
- C26H30NO4S2+
- Molecular Weight:
- 484.651
- Log P:
- 4.6256
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 112.24
- CAS Number(s):
- 727649-81-2
Synonym(s)
1.
Aclidinium
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Urinary Retention | FAERS: 5 | SIDER US FAERS | |
| 2 | Headache | FAERS: 3 | SIDER US FAERS | |
| 3 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 4 | Chest discomfort | FAERS: 2 | US FAERS | |
| 5 | Dysphonia | FAERS: 2 | SIDER US FAERS | |
| 6 | Epistaxis | FAERS: 2 | US FAERS | |
| 7 | Nasopharyngitis | FAERS: 2 | SIDER US FAERS | |
| 8 | Pneumonia | FAERS: 2 | US FAERS | |
| 9 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 10 | Tachycardia | FAERS: 2 | SIDER US FAERS | |
| 11 | Agitation | FAERS: 1 | US FAERS | |
| 12 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 13 | Anuria | FAERS: 1 | US FAERS | |
| 14 | Bronchospasm | FAERS: 1 | US FAERS | |
| 15 | Chest Pain | FAERS: 1 | US FAERS | |
| 16 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 17 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 18 | Dehydration | FAERS: 1 | US FAERS | |
| 19 | Device dislocation | FAERS: 1 | US FAERS | |
| 20 | Diplopia | FAERS: 1 | US FAERS | |
| 21 | Dry skin | FAERS: 1 | US FAERS | |
| 22 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 23 | Fatigue | FAERS: 1 | US FAERS | |
| 24 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 25 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 26 | Hypotension | FAERS: 1 | US FAERS | |
| 27 | Malaise | FAERS: 1 | US FAERS | |
| 28 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 29 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 30 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 31 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 32 | Product quality issue | FAERS: 1 | US FAERS | |
| 33 | Productive Cough | FAERS: 1 | US FAERS | |
| 34 | Sinusitis | FAERS: 1 | SIDER US FAERS | |
| 35 | Skin tightness | FAERS: 1 | US FAERS | |
| 36 | Swelling | FAERS: 1 | US FAERS | |
| 37 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 38 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 39 | Bladder neck obstruction | SIDER | ||
| 40 | Diabetes Mellitus | SIDER | ||
| 41 | Infection | SIDER | ||
| 42 | Infestation | SIDER | ||
| 43 | Rhinitis | SIDER | ||
| 44 | Toothache | SIDER | ||
| 45 | Vomiting | SIDER | ||
| 46 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.