Ciloxan
(ARPUHYJMCVWYCZ-UHFFFAOYSA-N)
Structure
- SMILES
- Fc1cc2c(cc1N1CCNCC1)n(cc(c2=O)C(=O)O)C1CC1.O.Cl
- Molecular Formula:
- C17H21ClFN3O4
- Molecular Weight:
- 385.818
- Log P:
- 2.7148
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 4
- TPSA:
- 83.8
- CAS Number(s):
- 86393-32-0; 128074-72-6
Synonym(s)
1.
Ciloxan
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 2 | Drug ineffective | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Eye pain | FAERS: 3 | US FAERS | |
| 4 | Pruritus | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Corneal Opacity | FAERS: 2 | US FAERS | |
| 6 | Erythema | FAERS: 2 | US FAERS | |
| 7 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 8 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 9 | Mental impairment | FAERS: 2 | US FAERS | |
| 10 | Nausea | FAERS: 2 | US FAERS | |
| 11 | Ocular Toxicity | FAERS: 2 | US FAERS | |
| 12 | Urticaria | FAERS: 2 | US FAERS | |
| 13 | Acanthamoeba Infection | FAERS: 1 | US FAERS | |
| 14 | Application site reaction | FAERS: 1 | US FAERS | |
| 15 | Arthropathy | FAERS: 1 | US FAERS | |
| 16 | Asthenia | FAERS: 1 | US FAERS | |
| 17 | Blepharospasm | FAERS: 1 | US FAERS | |
| 18 | Blindness | FAERS: 1 | US FAERS | |
| 19 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 20 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 21 | Drug toxicity | FAERS: 1 | US FAERS | |
| 22 | Dysphonia | FAERS: 1 | US FAERS | |
| 23 | Eye inflammation | FAERS: 1 | US FAERS | |
| 24 | Headache | FAERS: 1 | US FAERS | |
| 25 | Hypopyon | FAERS: 1 | US FAERS | |
| 26 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 27 | Malaise | FAERS: 1 | US FAERS | |
| 28 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 29 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 30 | Pain | FAERS: 1 | US FAERS | |
| 31 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 32 | Photophobia | FAERS: 1 | US FAERS | |
| 33 | Product dropper issue | FAERS: 1 | US FAERS | |
| 34 | Product quality issue | FAERS: 1 | US FAERS | |
| 35 | Product substitution issue | FAERS: 1 | US FAERS | |
| 36 | Psoas Abscess | FAERS: 1 | US FAERS | |
| 37 | Skin reaction | FAERS: 1 | US FAERS | |
| 38 | Toxic anterior segment syndrome | FAERS: 1 | US FAERS | |
| 39 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 40 | Cellulitis | Canada Vigilance: 1 | Canada Vigilance | |
| 41 | Chest discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 42 | Dysarthria | Canada Vigilance: 1 | Canada Vigilance | |
| 43 | Flushing | Canada Vigilance: 1 | Canada Vigilance | |
| 44 | Visual Impairment | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.