glycerol phenylbutyrate
(ZSDBFLMJVAGKOU-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(OC(COC(=O)CCCc1ccccc1)COC(=O)CCCc1ccccc1)CCCc1ccccc1
- Type(s)
- Approved
- ATC code(s)
- A16AX09
- Molecular Formula:
- C33H38O6
- Molecular Weight:
- 530.651
- Log P:
- 6.0533
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 0
- TPSA:
- 78.9
- CAS Number(s):
- 611168-24-2
Synonym(s)
1.
glycerol phenylbutyrate
2.
HPN 100
3.
HPN-100
4.
HPN100
5.
Ravicti
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Ammonia increased | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Vomiting | FAERS: 40 | US FAERS | |
| 3 | Headache | FAERS: 20 | US FAERS | |
| 4 | Malaise | FAERS: 16 | US FAERS | |
| 5 | Nausea | FAERS: 14 | US FAERS | |
| 6 | Drug dose omission | FAERS: 13 | US FAERS | |
| 7 | Fatigue | FAERS: 13 | US FAERS | |
| 8 | Hyperammonaemic crisis | FAERS: 11 | US FAERS | |
| 9 | Influenza | FAERS: 11 | US FAERS | |
| 10 | Somnolence | FAERS: 10 | US FAERS | |
| 11 | Dizziness | FAERS: 8 | US FAERS | |
| 12 | Nasopharyngitis | FAERS: 8 | US FAERS | |
| 13 | Lethargy | FAERS: 7 | US FAERS | |
| 14 | Dehydration | FAERS: 6 | US FAERS | |
| 15 | Pneumonia | FAERS: 6 | US FAERS | |
| 16 | Amino acid level increased | FAERS: 5 | US FAERS | |
| 17 | Drug ineffective | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Hypophagia | FAERS: 5 | US FAERS | |
| 19 | Tremor | FAERS: 5 | US FAERS | |
| 20 | Weight decreased | FAERS: 5 | US FAERS | |
| 21 | Amino acid level decreased | FAERS: 4 | US FAERS | |
| 22 | Ammonia abnormal | FAERS: 4 | US FAERS | |
| 23 | Asthenia | FAERS: 4 | US FAERS | |
| 24 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 25 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 26 | Intentional product misuse | FAERS: 4 | US FAERS | |
| 27 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 28 | Pancreatitis | FAERS: 4 | US FAERS | |
| 29 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 30 | Bronchitis | FAERS: 3 | US FAERS | |
| 31 | Chest Pain | FAERS: 3 | US FAERS | |
| 32 | Constipation | FAERS: 3 | US FAERS | |
| 33 | Depressed mood | FAERS: 3 | US FAERS | |
| 34 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 35 | Pain | FAERS: 3 | US FAERS | |
| 36 | Retching | FAERS: 3 | US FAERS | |
| 37 | Thirst | FAERS: 3 | US FAERS | |
| 38 | Transplant | FAERS: 3 | US FAERS | |
| 39 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 40 | Anxiety | FAERS: 2 | US FAERS | |
| 41 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 42 | Burning sensation | FAERS: 2 | US FAERS | |
| 43 | Chills | FAERS: 2 | US FAERS | |
| 44 | Crying | FAERS: 2 | US FAERS | |
| 45 | Diet refusal | FAERS: 2 | US FAERS | |
| 46 | Drooling | FAERS: 2 | US FAERS | |
| 47 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 48 | Epistaxis | FAERS: 2 | US FAERS | |
| 49 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 50 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 51 | Infection | FAERS: 2 | US FAERS | |
| 52 | Joint injury | FAERS: 2 | US FAERS | |
| 53 | Memory impairment | FAERS: 2 | US FAERS | |
| 54 | Mental status changes | FAERS: 2 | US FAERS | |
| 55 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 56 | No adverse event | FAERS: 2 | US FAERS | |
| 57 | Product dose omission | FAERS: 2 | US FAERS | |
| 58 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 59 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 60 | Unevaluable event | FAERS: 2 | US FAERS | |
| 61 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 62 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 63 | Acidosis | FAERS: 1 | US FAERS | |
| 64 | Agitation | FAERS: 1 | US FAERS | |
| 65 | Alopecia | FAERS: 1 | US FAERS | |
| 66 | Amnesia | FAERS: 1 | US FAERS | |
| 67 | Animal bite | FAERS: 1 | US FAERS | |
| 68 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 69 | Asthma | FAERS: 1 | US FAERS | |
| 70 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 71 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 72 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 73 | Brain Death | FAERS: 1 | US FAERS | |
| 74 | Cellulitis | FAERS: 1 | US FAERS | |
| 75 | Clumsiness | FAERS: 1 | US FAERS | |
| 76 | Croup infectious | FAERS: 1 | US FAERS | |
| 77 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 78 | Disorientation | FAERS: 1 | US FAERS | |
| 79 | Dry skin | FAERS: 1 | US FAERS | |
| 80 | Dysarthria | FAERS: 1 | US FAERS | |
| 81 | Dysgeusia | FAERS: 1 | US FAERS | |
| 82 | Dysuria | FAERS: 1 | US FAERS | |
| 83 | Emotional disorder | FAERS: 1 | US FAERS | |
| 84 | Emotional distress | FAERS: 1 | US FAERS | |
| 85 | Expired product administered | FAERS: 1 | US FAERS | |
| 86 | Eye inflammation | FAERS: 1 | US FAERS | |
| 87 | Food Allergy | FAERS: 1 | US FAERS | |
| 88 | Food craving | FAERS: 1 | US FAERS | |
| 89 | Gastric infection | FAERS: 1 | US FAERS | |
| 90 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 91 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 92 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 93 | Gastrostomy tube site complication | FAERS: 1 | US FAERS | |
| 94 | Gastrostomy | FAERS: 1 | US FAERS | |
| 95 | Gingivitis | FAERS: 1 | US FAERS | |
| 96 | Gout | FAERS: 1 | US FAERS | |
| 97 | Hunger | FAERS: 1 | US FAERS | |
| 98 | Hyperphagia | FAERS: 1 | US FAERS | |
| 99 | Hypokinesia | FAERS: 1 | US FAERS | |
| 100 | Hypoxia | FAERS: 1 | US FAERS | |
| 101 | Hysterectomy | FAERS: 1 | US FAERS | |
| 102 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 103 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 104 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 105 | Laceration | FAERS: 1 | US FAERS | |
| 106 | Limb operation | FAERS: 1 | US FAERS | |
| 107 | Liquid product physical issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Liver scan abnormal | FAERS: 1 | US FAERS | |
| 109 | Malabsorption | FAERS: 1 | US FAERS | |
| 110 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 111 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 112 | Medical device site infection | FAERS: 1 | US FAERS | |
| 113 | Mesoblastic Nephroma | FAERS: 1 | US FAERS | |
| 114 | Nocturia | FAERS: 1 | US FAERS | |
| 115 | Oncologic complication | FAERS: 1 | US FAERS | |
| 116 | Palpitations | FAERS: 1 | US FAERS | |
| 117 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 118 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 119 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 120 | Product quality issue | FAERS: 1 | US FAERS | |
| 121 | Pruritus | FAERS: 1 | US FAERS | |
| 122 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 123 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 124 | Screaming | FAERS: 1 | US FAERS | |
| 125 | Selective eating disorder | FAERS: 1 | US FAERS | |
| 126 | Sepsis | FAERS: 1 | US FAERS | |
| 127 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 128 | Sinusitis | FAERS: 1 | US FAERS | |
| 129 | Slow speech | FAERS: 1 | US FAERS | |
| 130 | Stomatitis | FAERS: 1 | US FAERS | |
| 131 | Stress | FAERS: 1 | US FAERS | |
| 132 | Stridor | FAERS: 1 | US FAERS | |
| 133 | Syncope | FAERS: 1 | US FAERS | |
| 134 | Throat irritation | FAERS: 1 | US FAERS | |
| 135 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 136 | Tooth Infection | FAERS: 1 | US FAERS | |
| 137 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 138 | Vertigo | FAERS: 1 | US FAERS | |
| 139 | Visual Impairment | FAERS: 1 | US FAERS | |
| 140 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 141 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.