alogliptin
(ZSBOMTDTBDDKMP-OAHLLOKOSA-N)
Structure
- SMILES
- N#Cc1ccccc1Cn1c(cc(=O)n(c1=O)C)N1CCC[C@H](C1)N
- Type(s)
- Approved
- ATC code(s)
- A10BD09; A10BD13; A10BH04
- Molecular Formula:
- C18H21N5O2
- Molecular Weight:
- 339.392
- Log P:
- 1.1598
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 97.05
- CAS Number(s):
- 850649-61-5
Synonym(s)
1.
alogliptin
2.
2-((6-((3R)-3-aminopiperidin-1-yl)-3-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)methyl) benzonitrile
3.
SYR 322
4.
SYR-322
5.
SYR322
6.
nesina
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pancreatitis | FAERS: 5 | SIDER US FAERS | |
| 2 | Pruritus | FAERS: 4 | US FAERS | |
| 3 | Chest Pain | FAERS: 3 | US FAERS | |
| 4 | Drug ineffective | FAERS: 3 | US FAERS | |
| 5 | Back Pain | FAERS: 2 | US FAERS | |
| 6 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 7 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 8 | Eczema | FAERS: 2 | US FAERS | |
| 9 | Erythema | FAERS: 2 | US FAERS | |
| 10 | Headache | FAERS: 2 | SIDER US FAERS | |
| 11 | Infection | FAERS: 2 | US FAERS | |
| 12 | Malaise | FAERS: 2 | US FAERS | |
| 13 | Nausea | FAERS: 2 | US FAERS | |
| 14 | Urticaria | FAERS: 2 | SIDER US FAERS | |
| 15 | Vomiting | FAERS: 2 | US FAERS | |
| 16 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 17 | Adverse event | FAERS: 1 | US FAERS | |
| 18 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 19 | Amnesia | FAERS: 1 | US FAERS | |
| 20 | Anxiety | FAERS: 1 | US FAERS | |
| 21 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 22 | Bronchitis | FAERS: 1 | US FAERS | |
| 23 | Burning sensation | FAERS: 1 | US FAERS | |
| 24 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 25 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 26 | Diplopia | FAERS: 1 | US FAERS | |
| 27 | Dropped head syndrome | FAERS: 1 | US FAERS | |
| 28 | Dyspepsia | FAERS: 1 | US FAERS | |
| 29 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 30 | Eye pain | FAERS: 1 | US FAERS | |
| 31 | Fatigue | FAERS: 1 | US FAERS | |
| 32 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 33 | Lip swelling | FAERS: 1 | US FAERS | |
| 34 | Lung consolidation | FAERS: 1 | US FAERS | |
| 35 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 36 | Nervousness | FAERS: 1 | US FAERS | |
| 37 | Pain | FAERS: 1 | US FAERS | |
| 38 | Palpitations | FAERS: 1 | US FAERS | |
| 39 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 40 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 41 | Pharyngitis | FAERS: 1 | US FAERS | |
| 42 | Pneumonia | FAERS: 1 | US FAERS | |
| 43 | Product dose omission | FAERS: 1 | US FAERS | |
| 44 | Retching | FAERS: 1 | US FAERS | |
| 45 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 46 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 47 | Somnolence | FAERS: 1 | US FAERS | |
| 48 | Tremor | FAERS: 1 | US FAERS | |
| 49 | Ulcer | FAERS: 1 | US FAERS | |
| 50 | jaundice | FAERS: 1 | US FAERS | |
| 51 | Anaphylactic shock | SIDER | ||
| 52 | Angioedema | SIDER | ||
| 53 | Dermatitis | SIDER | ||
| 54 | Diabetes Mellitus | SIDER | ||
| 55 | Hypersensitivity | SIDER | ||
| 56 | Nasopharyngitis | SIDER | ||
| 57 | Serum Sickness | SIDER | ||
| 58 | Stevens-Johnson Syndrome | 25811541 | CTD SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.