Bedaquiline fumarate
(ZLVSPMRFRHMMOY-WWCCMVHESA-N)
Structure
- SMILES
- OC(=O)/C=C/C(=O)O.COc1nc2ccc(cc2cc1[C@H]([C@](c1cccc2c1cccc2)(CCN(C)C)O)c1ccccc1)Br
- Molecular Formula:
- C36H35BrN2O6
- Molecular Weight:
- 671.577
- Log P:
- 6.8423
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 3
- TPSA:
- 120.19
- CAS Number(s):
- 845533-86-0
Synonym(s)
1.
Bedaquiline fumarate
External Link(s)
| PubChem Compound | 24812732 |
| ChEBI | 72295 |
| CHEMBL | CHEMBL2105700 |
| KEGG | dr:D09873 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Hepatotoxicity | FAERS: 11 | US FAERS | |
| 2 | Adverse event | FAERS: 4 | US FAERS | |
| 3 | Nausea | FAERS: 3 | US FAERS | |
| 4 | Vomiting | FAERS: 3 | US FAERS | |
| 5 | Dizziness | FAERS: 2 | US FAERS | |
| 6 | Headache | FAERS: 2 | US FAERS | |
| 7 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 8 | Pancreatitis | FAERS: 2 | US FAERS | |
| 9 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 10 | Pruritus | FAERS: 2 | US FAERS | |
| 11 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 12 | Acne | FAERS: 1 | US FAERS | |
| 13 | Alopecia | FAERS: 1 | US FAERS | |
| 14 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 15 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 16 | Bradycardia | FAERS: 1 | US FAERS | |
| 17 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 18 | Chills | FAERS: 1 | US FAERS | |
| 19 | Constipation | FAERS: 1 | US FAERS | |
| 20 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 21 | Drug diversion | FAERS: 1 | US FAERS | |
| 22 | Drug ineffective | FAERS: 1 | US FAERS | |
| 23 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 24 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 25 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 26 | Epididymitis | FAERS: 1 | US FAERS | |
| 27 | Hepatitis B | FAERS: 1 | US FAERS | |
| 28 | Ileus | FAERS: 1 | US FAERS | |
| 29 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 30 | Infection | FAERS: 1 | US FAERS | |
| 31 | Infestation | FAERS: 1 | US FAERS | |
| 32 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 33 | Lymphoma | FAERS: 1 | US FAERS | |
| 34 | Onychoclasis | FAERS: 1 | US FAERS | |
| 35 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 36 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 37 | Sputum culture positive | FAERS: 1 | US FAERS | |
| 38 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 39 | Tinnitus | FAERS: 1 | US FAERS | |
| 40 | Tonsillitis | FAERS: 1 | US FAERS | |
| 41 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 42 | Transaminases increased | FAERS: 1 | US FAERS | |
| 43 | Tuberculoma of central nervous system | FAERS: 1 | US FAERS | |
| 44 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 45 | nervous system disorder | FAERS: 1 | US FAERS | |
| 46 | prostatitis | FAERS: 1 | US FAERS | |
| 47 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.