Bisoprolol fumarate and hydrochlorothiazide
(YPOQUAYRZPJZHW-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1cc2NCNS(=O)(=O)c2cc1S(=O)(=O)N.OC(COc1ccc(cc1)COCCOC(C)C)CNC(C)C
- Molecular Formula:
- C25H39ClN4O8S2
- Molecular Weight:
- 623.182
- Log P:
- 5.7342
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 5
- TPSA:
- 195.07
- CAS Number(s):
- 847780-86-3
Synonym(s)
1.
Bisoprolol fumarate and hydrochlorothiazide
External Link(s)
| PubChem Compound | 44153906 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 5 | US FAERS | |
| 2 | Headache | FAERS: 4 | US FAERS | |
| 3 | Dizziness | FAERS: 3 | US FAERS | |
| 4 | Feeling Cold | FAERS: 3 | US FAERS | |
| 5 | Malaise | FAERS: 3 | US FAERS | |
| 6 | Product substitution issue | FAERS: 3 | US FAERS | |
| 7 | Alopecia | FAERS: 2 | US FAERS | |
| 8 | Back Pain | FAERS: 2 | US FAERS | |
| 9 | Bradycardia | FAERS: 2 | US FAERS | |
| 10 | Chest discomfort | FAERS: 2 | US FAERS | |
| 11 | Drug ineffective | FAERS: 2 | US FAERS | |
| 12 | Expired product administered | FAERS: 2 | US FAERS | |
| 13 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 14 | Hypotension | FAERS: 2 | US FAERS | |
| 15 | Nausea | FAERS: 2 | US FAERS | |
| 16 | No adverse event | FAERS: 2 | US FAERS | |
| 17 | Pruritus | FAERS: 2 | US FAERS | |
| 18 | Transaminases increased | FAERS: 2 | US FAERS | |
| 19 | Urticaria | FAERS: 2 | US FAERS | |
| 20 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 21 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 22 | Amnesia | FAERS: 1 | US FAERS | |
| 23 | Anxiety | FAERS: 1 | US FAERS | |
| 24 | Asthenia | FAERS: 1 | US FAERS | |
| 25 | Blindness | FAERS: 1 | US FAERS | |
| 26 | Chills | FAERS: 1 | US FAERS | |
| 27 | Drug abuse | FAERS: 1 | US FAERS | |
| 28 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 29 | Dysphonia | FAERS: 1 | US FAERS | |
| 30 | Erythema | FAERS: 1 | US FAERS | |
| 31 | Eye pain | FAERS: 1 | US FAERS | |
| 32 | Feeling jittery | FAERS: 1 | US FAERS | |
| 33 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 34 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 35 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 36 | Mental status changes | FAERS: 1 | US FAERS | |
| 37 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 38 | Myalgia | FAERS: 1 | US FAERS | |
| 39 | Night sweats | FAERS: 1 | US FAERS | |
| 40 | Oral pain | FAERS: 1 | US FAERS | |
| 41 | Pain of skin | FAERS: 1 | US FAERS | |
| 42 | Polydipsia | FAERS: 1 | US FAERS | |
| 43 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 44 | Product quality issue | FAERS: 1 | US FAERS | |
| 45 | Rash erythematous | FAERS: 1 | US FAERS | |
| 46 | Restlessness | FAERS: 1 | US FAERS | |
| 47 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 48 | Suicide attempt | FAERS: 1 | US FAERS | |
| 49 | Swelling | FAERS: 1 | US FAERS | |
| 50 | Throat irritation | FAERS: 1 | US FAERS | |
| 51 | Tinnitus | FAERS: 1 | US FAERS | |
| 52 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 53 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.