plerixafor octahydrochloride
(YIQPUIGJQJDJOS-UHFFFAOYSA-N)
Structure
- SMILES
- C1CNCCN(CCCNCCNC1)Cc1ccc(cc1)CN1CCNCCCNCCNCCC1
- Type(s)
- Approved
- ATC code(s)
- L03AX16
- Molecular Formula:
- C28H54N8
- Molecular Weight:
- 502.782
- Log P:
- 2.2644
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 6
- TPSA:
- 78.66
- CAS Number(s):
- 110078-46-1
Synonym(s)
1.
plerixafor octahydrochloride
2.
1,1'-(1,4-phenylenebis(methylene))bis(1,4,8,11-tetraazacyclotetradecane)octahydrochloride dihydrate
3.
1,1'-(1,4-phenylenebis-(methylene))-bis-1,4,8,11-tetraazacyclotetradecane octahydrochloride dihydrate
4.
AMD 3100
5.
AMD 3329
6.
AMD-3100
7.
AMD-3329
8.
AMD3100
9.
JM 3100
10.
JM3100
11.
RPA bicyclam
12.
bicyclam
13.
mezobil
14.
mozobil
15.
plerixafor
16.
plerixafor hydrochloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 6 | SIDER US FAERS | |
| 2 | Blood stem cell transplant failure | FAERS: 5 | US FAERS | |
| 3 | Febrile Neutropenia | FAERS: 5 | US FAERS | |
| 4 | Drug ineffective | FAERS: 4 | US FAERS | |
| 5 | Hypersensitivity | FAERS: 4 | SIDER US FAERS | |
| 6 | Sepsis | FAERS: 4 | US FAERS | |
| 7 | Vomiting | FAERS: 4 | SIDER US FAERS | |
| 8 | Asthenia | FAERS: 3 | SIDER US FAERS | |
| 9 | Chest Pain | FAERS: 3 | US FAERS | |
| 10 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 11 | Erythema | FAERS: 3 | SIDER US FAERS | |
| 12 | Procedural complication | FAERS: 3 | US FAERS | |
| 13 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 14 | Abdominal Pain | FAERS: 2 | SIDER US FAERS | |
| 15 | Abdominal discomfort | FAERS: 2 | SIDER US FAERS | |
| 16 | Anaphylactic shock | FAERS: 2 | SIDER US FAERS | |
| 17 | Blood stem cell harvest failure | FAERS: 2 | US FAERS | |
| 18 | Ileus | FAERS: 2 | US FAERS | |
| 19 | Infection | FAERS: 2 | US FAERS | |
| 20 | Injection site erythema | FAERS: 2 | US FAERS | |
| 21 | Injection site urticaria | FAERS: 2 | US FAERS | |
| 22 | Malaise | FAERS: 2 | SIDER US FAERS | |
| 23 | Multiple Myeloma | FAERS: 2 | US FAERS | |
| 24 | Musculoskeletal Pain | FAERS: 2 | SIDER US FAERS | |
| 25 | Myeloma recurrence | FAERS: 2 | US FAERS | |
| 26 | Pain | FAERS: 2 | SIDER US FAERS | |
| 27 | Product storage error | FAERS: 2 | US FAERS | |
| 28 | Pruritus | FAERS: 2 | SIDER US FAERS | |
| 29 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 30 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 31 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 32 | Anxiety | FAERS: 1 | US FAERS | |
| 33 | Aphasia | FAERS: 1 | US FAERS | |
| 34 | Arthralgia | FAERS: 1 | SIDER US FAERS | |
| 35 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 36 | Chest discomfort | FAERS: 1 | US FAERS | |
| 37 | Chills | FAERS: 1 | US FAERS | |
| 38 | Cytopenia | FAERS: 1 | US FAERS | |
| 39 | Disease Progression | FAERS: 1 | US FAERS | |
| 40 | Emotional distress | FAERS: 1 | US FAERS | |
| 41 | Engraft failure | FAERS: 1 | US FAERS | |
| 42 | Fatigue | FAERS: 1 | SIDER US FAERS | |
| 43 | Feeling abnormal | FAERS: 1 | SIDER US FAERS | |
| 44 | Flatulence | FAERS: 1 | SIDER US FAERS | |
| 45 | Flushing | FAERS: 1 | US FAERS | |
| 46 | Gastritis | FAERS: 1 | US FAERS | |
| 47 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 48 | Headache | FAERS: 1 | SIDER US FAERS | |
| 49 | Hypoxia | FAERS: 1 | US FAERS | |
| 50 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 51 | Injection Site Reaction | FAERS: 1 | SIDER US FAERS | |
| 52 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 53 | Lip swelling | FAERS: 1 | US FAERS | |
| 54 | Lymphocyte count abnormal | FAERS: 1 | US FAERS | |
| 55 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 56 | Medical device complication | FAERS: 1 | US FAERS | |
| 57 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 58 | Neutropenia | FAERS: 1 | US FAERS | |
| 59 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 60 | Night sweats | FAERS: 1 | US FAERS | |
| 61 | No adverse event | FAERS: 1 | US FAERS | |
| 62 | Palpitations | FAERS: 1 | US FAERS | |
| 63 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 64 | Plasmacytoma | FAERS: 1 | US FAERS | |
| 65 | Pneumocystis jiroveci pneumonia | FAERS: 1 | US FAERS | |
| 66 | Pneumonia | FAERS: 1 | US FAERS | |
| 67 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 68 | Radiculopathy | FAERS: 1 | US FAERS | |
| 69 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 70 | Retching | FAERS: 1 | US FAERS | |
| 71 | Septic Shock | FAERS: 1 | US FAERS | |
| 72 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 73 | Splenomegaly | FAERS: 1 | SIDER US FAERS | |
| 74 | Swelling | FAERS: 1 | SIDER US FAERS | |
| 75 | Therapy cessation | FAERS: 1 | US FAERS | |
| 76 | Transplant | FAERS: 1 | US FAERS | |
| 77 | Visual Impairment | FAERS: 1 | US FAERS | |
| 78 | treatment failure | FAERS: 1 | US FAERS | |
| 79 | Constipation | SIDER | ||
| 80 | Deafness | Canada Vigilance: 1 | Canada Vigilance | |
| 81 | Dermatitis | SIDER | ||
| 82 | Discomfort | SIDER | ||
| 83 | Dizziness | SIDER | ||
| 84 | Dyspepsia | SIDER | ||
| 85 | Gastrointestinal Pain | SIDER | ||
| 86 | Induration | SIDER | ||
| 87 | Inflammation | SIDER | ||
| 88 | Leukostasis | SIDER | ||
| 89 | Musculoskeletal discomfort | SIDER | ||
| 90 | Periorbital swelling | SIDER | ||
| 91 | Shock | SIDER | ||
| 92 | Syncope | SIDER | ||
| 93 | Upset stomach | SIDER | ||
| 94 | Urticaria | SIDER | ||
| 95 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.