homosalate
(WSSJONWNBBTCMG-UHFFFAOYSA-N)
Structure
- SMILES
- CC1CC(OC(=O)c2ccccc2O)CC(C1)(C)C
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C16H22O3
- Molecular Weight:
- 262.344
- Log P:
- 3.7638
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 46.53
- CAS Number(s):
- 118-56-9; 8045-71-4
Synonym(s)
1.
homosalate
2.
3,3,5-trimethylcyclohexyl salicylate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Sunburn | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 21 | US FAERS | |
| 3 | Eye irritation | FAERS: 21 | US FAERS | |
| 4 | Circumstance or information capable of leading to medication error | FAERS: 11 | US FAERS | |
| 5 | Eye pain | FAERS: 10 | US FAERS | |
| 6 | Accidental exposure to product | FAERS: 9 | US FAERS | |
| 7 | Erythema | FAERS: 8 | US FAERS | |
| 8 | Product expiration date issue | FAERS: 8 | US FAERS | |
| 9 | Hypersensitivity | FAERS: 6 | US FAERS | |
| 10 | Expired product administered | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Product lot number issue | FAERS: 4 | US FAERS | |
| 12 | Pain | FAERS: 3 | US FAERS | |
| 13 | Product quality issue | FAERS: 3 | US FAERS | |
| 14 | Unevaluable event | FAERS: 3 | US FAERS | |
| 15 | Urticaria | FAERS: 3 | US FAERS | |
| 16 | Accidental exposure | FAERS: 2 | US FAERS | |
| 17 | Chemical injury | FAERS: 2 | US FAERS | |
| 18 | Crying | FAERS: 2 | US FAERS | |
| 19 | Dry skin | FAERS: 2 | US FAERS | |
| 20 | Expired drug administered | FAERS: 2 | US FAERS | |
| 21 | Malaise | FAERS: 2 | US FAERS | |
| 22 | Pruritus | FAERS: 2 | US FAERS | |
| 23 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 24 | Skin hypertrophy | FAERS: 2 | US FAERS | |
| 25 | Skin tightness | FAERS: 2 | US FAERS | |
| 26 | Asthenia | FAERS: 1 | US FAERS | |
| 27 | Burning sensation | FAERS: 1 | US FAERS | |
| 28 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 29 | Disability | FAERS: 1 | US FAERS | |
| 30 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 31 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 32 | Eye Infection | FAERS: 1 | US FAERS | |
| 33 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 34 | Hair injury | FAERS: 1 | US FAERS | |
| 35 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 36 | Medication Error | FAERS: 1 | US FAERS | |
| 37 | Medulloblastoma | FAERS: 1 | US FAERS | |
| 38 | Nausea | FAERS: 1 | US FAERS | |
| 39 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 40 | Pain of skin | FAERS: 1 | US FAERS | |
| 41 | Papule | FAERS: 1 | US FAERS | |
| 42 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 43 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 44 | Product label confusion | FAERS: 1 | US FAERS | |
| 45 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 46 | Rash erythematous | FAERS: 1 | US FAERS | |
| 47 | Skin necrosis | FAERS: 1 | US FAERS | |
| 48 | Skin reaction | FAERS: 1 | US FAERS | |
| 49 | Solar lentigo | FAERS: 1 | US FAERS | |
| 50 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 51 | Scab | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.