Ivosidenib
(WIJZXSAJMHAVGX-DHLKQENFSA-N)
Structure
- SMILES
- N#Cc1ccnc(c1)N1C(=O)CC[C@H]1C(=O)N([C@@H](c1ccccc1Cl)C(=O)NC1CC(C1)(F)F)c1cncc(c1)F
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C28H22ClF3N6O3
- Molecular Weight:
- 582.961
- Log P:
- 4.7805
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 1
- TPSA:
- 119.29
- CAS Number(s):
- 1448347-49-6
Synonym(s)
1.
Ivosidenib
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 7 | US FAERS | |
| 2 | Drug ineffective | FAERS: 4 | US FAERS | |
| 3 | Asthenia | FAERS: 3 | US FAERS | |
| 4 | Malaise | FAERS: 3 | US FAERS | |
| 5 | Pruritus | FAERS: 3 | US FAERS | |
| 6 | Arthritis | FAERS: 2 | US FAERS | |
| 7 | Ascites | FAERS: 2 | US FAERS | |
| 8 | Disease Progression | FAERS: 2 | US FAERS | |
| 9 | Dizziness | FAERS: 2 | US FAERS | |
| 10 | Headache | FAERS: 2 | US FAERS | |
| 11 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 12 | Platelet count abnormal | FAERS: 2 | US FAERS | |
| 13 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 14 | Arthralgia | FAERS: 1 | US FAERS | |
| 15 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 16 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 17 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 18 | Bradycardia | FAERS: 1 | US FAERS | |
| 19 | Extra dose administered | FAERS: 1 | US FAERS | |
| 20 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 21 | Gout | FAERS: 1 | US FAERS | |
| 22 | Hospice Care | FAERS: 1 | US FAERS | |
| 23 | Influenza | FAERS: 1 | US FAERS | |
| 24 | Joint injury | FAERS: 1 | US FAERS | |
| 25 | Leukocytosis | FAERS: 1 | US FAERS | |
| 26 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 27 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 28 | Muscle strain | FAERS: 1 | US FAERS | |
| 29 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 30 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 31 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 32 | Nausea | FAERS: 1 | US FAERS | |
| 33 | Nodule | FAERS: 1 | US FAERS | |
| 34 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 35 | Pain | FAERS: 1 | US FAERS | |
| 36 | Palpitations | FAERS: 1 | US FAERS | |
| 37 | Papule | FAERS: 1 | US FAERS | |
| 38 | Paranoia | FAERS: 1 | US FAERS | |
| 39 | Product administration error | FAERS: 1 | US FAERS | |
| 40 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 41 | Rosacea | FAERS: 1 | US FAERS | |
| 42 | Therapy cessation | FAERS: 1 | US FAERS | |
| 43 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 44 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.