Carisoprodol and aspirin
(WHBJKZYAFDJZPQ-UHFFFAOYSA-N)
Structure
- SMILES
- CC(=O)Oc1ccccc1C(=O)O.CCCC(COC(=O)N)(COC(=O)NC(C)C)C
- Molecular Formula:
- C21H32N2O8
- Molecular Weight:
- 440.487
- Log P:
- 4.4240
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 3
- TPSA:
- 154.25
- CAS Number(s):
- N/A
Synonym(s)
1.
Carisoprodol and aspirin
External Link(s)
| PubChem Compound | 24847791 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Toxicity to various agents | FAERS: 8 | US FAERS | |
| 2 | Angioedema | FAERS: 5 | US FAERS | |
| 3 | Tinnitus | FAERS: 5 | US FAERS | |
| 4 | Hyperventilation | FAERS: 4 | US FAERS | |
| 5 | Dehydration | FAERS: 3 | US FAERS | |
| 6 | Mental status changes | FAERS: 3 | US FAERS | |
| 7 | Nausea | FAERS: 3 | US FAERS | |
| 8 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 9 | Agitation | FAERS: 2 | US FAERS | |
| 10 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 11 | Completed Suicide | FAERS: 2 | US FAERS | |
| 12 | Kounis Syndrome | FAERS: 2 | US FAERS | |
| 13 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 14 | Overdose | FAERS: 2 | US FAERS | |
| 15 | Pruritus | FAERS: 2 | US FAERS | |
| 16 | Urticaria | FAERS: 2 | US FAERS | |
| 17 | Wheezing | FAERS: 2 | US FAERS | |
| 18 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 19 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 20 | Bradycardia | FAERS: 1 | US FAERS | |
| 21 | Bronchospasm | FAERS: 1 | US FAERS | |
| 22 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 23 | Chest Pain | FAERS: 1 | US FAERS | |
| 24 | Chills | FAERS: 1 | US FAERS | |
| 25 | Dyspepsia | FAERS: 1 | US FAERS | |
| 26 | Headache | FAERS: 1 | US FAERS | |
| 27 | Hypoxia | FAERS: 1 | US FAERS | |
| 28 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 29 | Pain | FAERS: 1 | US FAERS | |
| 30 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 31 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 32 | Respiratory distress | FAERS: 1 | US FAERS | |
| 33 | Second degree chemical burn of skin | FAERS: 1 | US FAERS | |
| 34 | Tachycardia | FAERS: 1 | US FAERS | |
| 35 | Tetany | FAERS: 1 | US FAERS | |
| 36 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 37 | Visual Impairment | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.