Asenapine maleate
(VSWBSWWIRNCQIJ-HUUCEWRRSA-N)
Structure
- SMILES
- Clc1ccc2c(c1)[C@H]1CN(C[C@@H]1c1c(O2)cccc1)C
- Molecular Formula:
- C17H16ClNO
- Molecular Weight:
- 285.768
- Log P:
- 4.1964
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 0
- TPSA:
- 12.47
- CAS Number(s):
- 65576-45-6; 85650-56-2
Synonym(s)
1.
Asenapine maleate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Vomiting | FAERS: 6 | US FAERS | |
| 2 | Dysgeusia | FAERS: 5 | US FAERS | |
| 3 | Burning sensation | FAERS: 4 | US FAERS | |
| 4 | Completed Suicide | FAERS: 3 | US FAERS | |
| 5 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 6 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 7 | Drug administration error | FAERS: 2 | US FAERS | |
| 8 | Erythema | FAERS: 2 | US FAERS | |
| 9 | Fatigue | FAERS: 2 | US FAERS | |
| 10 | Hypotension | FAERS: 2 | US FAERS | |
| 11 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 12 | Suicide attempt | FAERS: 2 | US FAERS | |
| 13 | Urticaria | FAERS: 2 | US FAERS | |
| 14 | Vertigo | FAERS: 2 | US FAERS | |
| 15 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 16 | Akathisia | FAERS: 1 | US FAERS | |
| 17 | Anxiety | FAERS: 1 | US FAERS | |
| 18 | Arthralgia | FAERS: 1 | US FAERS | |
| 19 | Disease recurrence | FAERS: 1 | US FAERS | |
| 20 | Disorientation | FAERS: 1 | US FAERS | |
| 21 | Dizziness | FAERS: 1 | US FAERS | |
| 22 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 23 | Dysarthria | FAERS: 1 | US FAERS | |
| 24 | Headache | FAERS: 1 | US FAERS | |
| 25 | Hypersomnia | FAERS: 1 | US FAERS | |
| 26 | Impaired work ability | FAERS: 1 | US FAERS | |
| 27 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 28 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 29 | Lip swelling | FAERS: 1 | US FAERS | |
| 30 | Nausea | FAERS: 1 | US FAERS | |
| 31 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 32 | Oral pain | FAERS: 1 | US FAERS | |
| 33 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 34 | Pruritus | FAERS: 1 | US FAERS | |
| 35 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 36 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 37 | Restlessness | FAERS: 1 | US FAERS | |
| 38 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 39 | Urinary Incontinence | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.