Trifluridine
(VSQQQLOSPVPRAZ-RRKCRQDMSA-N)
Structure
- SMILES
- OC[C@H]1O[C@H](C[C@@H]1O)n1cc(c(=O)[nH]c1=O)C(F)(F)F
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01BC59; S01AD02
- Molecular Formula:
- C10H11F3N2O5
- Molecular Weight:
- 296.200
- Log P:
- -0.8039
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 3
- TPSA:
- 104.55
- CAS Number(s):
- 70-00-8
Synonym(s)
1.
Trifluridine
2.
Trifluorothymidine
3.
2'-deoxy-5-(trifluoromethyl)uridine
4.
5-Trifluoromethyl-2'-deoxyuridine
5.
TFT Ophtiole
6.
Triflumann
7.
Trifluoridine
8.
Viromidin
9.
Virophta
10.
Viroptic
11.
5 Trifluoromethyl 2' deoxyuridine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Eye pain | FAERS: 9 | US FAERS | |
| 3 | Eye irritation | FAERS: 7 | US FAERS | |
| 4 | Hypersensitivity | FAERS: 4 | SIDER US FAERS | |
| 5 | Incorrect product storage | FAERS: 4 | US FAERS | |
| 6 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 7 | Product container issue | FAERS: 4 | US FAERS | |
| 8 | Medication Error | FAERS: 3 | US FAERS | |
| 9 | Pain | FAERS: 3 | SIDER US FAERS | |
| 10 | Photophobia | FAERS: 3 | US FAERS | |
| 11 | Product quality issue | FAERS: 3 | US FAERS | |
| 12 | Product storage error | FAERS: 3 | US FAERS | |
| 13 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 14 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 15 | Dizziness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Drug administration error | FAERS: 2 | US FAERS | |
| 17 | Ear discomfort | FAERS: 2 | US FAERS | |
| 18 | Extra dose administered | FAERS: 2 | US FAERS | |
| 19 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 20 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 21 | Product use issue | FAERS: 2 | US FAERS | |
| 22 | Pruritus | FAERS: 2 | US FAERS | |
| 23 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 24 | Application site burn | FAERS: 1 | US FAERS | |
| 25 | Application site pain | FAERS: 1 | US FAERS | |
| 26 | Asthenia | FAERS: 1 | US FAERS | |
| 27 | Blindness | FAERS: 1 | US FAERS | |
| 28 | Colitis | FAERS: 1 | US FAERS | |
| 29 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 30 | Erythema | FAERS: 1 | US FAERS | |
| 31 | Eye Infection | FAERS: 1 | US FAERS | |
| 32 | Eye inflammation | FAERS: 1 | US FAERS | |
| 33 | Eye ulcer | FAERS: 1 | US FAERS | |
| 34 | Fatigue | FAERS: 1 | US FAERS | |
| 35 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 36 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 37 | Incorrect dose administered by product | FAERS: 1 | US FAERS | |
| 38 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 39 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 40 | Keratopathy | FAERS: 1 | SIDER US FAERS | |
| 41 | Malaise | FAERS: 1 | US FAERS | |
| 42 | Multiple allergies | FAERS: 1 | US FAERS | |
| 43 | Neck Pain | FAERS: 1 | US FAERS | |
| 44 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 45 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 46 | Product administration error | FAERS: 1 | US FAERS | |
| 47 | Product complaint | FAERS: 1 | US FAERS | |
| 48 | Product dropper issue | FAERS: 1 | US FAERS | |
| 49 | Product leakage | FAERS: 1 | US FAERS | |
| 50 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 51 | Thermal burn | FAERS: 1 | US FAERS | |
| 52 | Throat irritation | FAERS: 1 | US FAERS | |
| 53 | Corneal stromal edema | SIDER | ||
| 54 | Incorrect product administration duration | Canada Vigilance: 1 | Canada Vigilance | |
| 55 | Keratitis sicca | SIDER | ||
| 56 | Nausea | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 57 | Necrosis | 19816940 | CTD | |
| 58 | Product supply issue | Canada Vigilance: 1 | Canada Vigilance | |
| 59 | Punctate keratitis | SIDER | ||
| 60 | Superficial punctate keratopathy | SIDER | ||
| 61 | Toxicity to various agents | Canada Vigilance: 1 | Canada Vigilance | |
| 62 | Tremor | Canada Vigilance: 1 | Canada Vigilance | |
| 63 | Vital dye staining cornea present | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.