4-phenylbutyric acid
(VPZRWNZGLKXFOE-UHFFFAOYSA-M)
Structure
- SMILES
- [O-]C(=O)CCCc1ccccc1.[Na+]
- Molecular Formula:
- C10H11NaO2
- Molecular Weight:
- 186.183
- Log P:
- 0.7592
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 0
- TPSA:
- 40.13
- CAS Number(s):
- 1716-12-7
Synonym(s)
1.
4-phenylbutyric acid
2.
4-phenylbutyrate
3.
4-phenylbutyric acid, calcium salt
4.
4-phenylbutyric acid, sodium salt
5.
Ammonaps
6.
Buphenyl
7.
sodium 4-phenylbutanoate
8.
sodium 4-phenylbutyrate
9.
sodium phenylbutyrate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Vomiting | FAERS: 6 | US FAERS | |
| 2 | Ammonia increased | FAERS: 5 | US FAERS | |
| 3 | Hyperammonaemic crisis | FAERS: 4 | US FAERS | |
| 4 | Dizziness | FAERS: 3 | US FAERS | |
| 5 | Amino acid level increased | FAERS: 2 | US FAERS | |
| 6 | Choking | FAERS: 2 | US FAERS | |
| 7 | Dehydration | FAERS: 2 | US FAERS | |
| 8 | Disease Progression | FAERS: 2 | US FAERS | |
| 9 | Drug ineffective | FAERS: 2 | US FAERS | |
| 10 | Dysgeusia | FAERS: 2 | US FAERS | |
| 11 | Dyspepsia | FAERS: 2 | US FAERS | |
| 12 | Infection | FAERS: 2 | US FAERS | |
| 13 | Pneumonia | FAERS: 2 | US FAERS | |
| 14 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 15 | Vertigo | FAERS: 2 | US FAERS | |
| 16 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 17 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 18 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 19 | Catheter site infection | FAERS: 1 | US FAERS | |
| 20 | Device related infection | FAERS: 1 | US FAERS | |
| 21 | Drug administration error | FAERS: 1 | US FAERS | |
| 22 | Eosinophilia | FAERS: 1 | US FAERS | |
| 23 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 24 | Expired product administered | FAERS: 1 | US FAERS | |
| 25 | Fatigue | FAERS: 1 | US FAERS | |
| 26 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 27 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 28 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 29 | Influenza | FAERS: 1 | US FAERS | |
| 30 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 31 | Leukocytosis | FAERS: 1 | US FAERS | |
| 32 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 33 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 34 | Mental impairment | FAERS: 1 | US FAERS | |
| 35 | Mental status changes | FAERS: 1 | US FAERS | |
| 36 | Nausea | FAERS: 1 | US FAERS | |
| 37 | Pregnancy with implant contraceptive | FAERS: 1 | US FAERS | |
| 38 | Product substitution issue | FAERS: 1 | US FAERS | |
| 39 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 40 | Rickets | FAERS: 1 | US FAERS | |
| 41 | Sepsis | FAERS: 1 | US FAERS | |
| 42 | Shock | FAERS: 1 | US FAERS | |
| 43 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 44 | Throat irritation | FAERS: 1 | US FAERS | |
| 45 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 46 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 47 | Urea cycle enzyme deficiency | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.