Lupaneta Pack
(VNYWTQDXEQSSJK-RSBWEERYSA-N)
Structure
- SMILES
- CC(=O)O.C#C[C@@]1(CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12)OC(=O)C.CCNC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2c1cccc2)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H]1CCC(=O)N1)CO)CC(C)C)CC(C)C)CCCN=C(N)N
- Molecular Formula:
- C83H116N16O17
- Molecular Weight:
- 1609.910
- Log P:
- 7.5106
- Hydrogen Bond Acceptor:
- 31
- Hydrogen Bond Donor:
- 16
- TPSA:
- 512.21
- CAS Number(s):
- N/A
Synonym(s)
1.
Lupaneta Pack
External Link(s)
| PubChem Compound | 90643432 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pelvic Pain | FAERS: 15 | US FAERS | |
| 2 | Abdominal Pain | FAERS: 13 | US FAERS | |
| 3 | Drug ineffective | FAERS: 10 | US FAERS | |
| 4 | Night sweats | FAERS: 9 | US FAERS | |
| 5 | Metrorrhagia | FAERS: 8 | US FAERS | |
| 6 | Dizziness | FAERS: 7 | US FAERS | |
| 7 | Drug dose omission | FAERS: 7 | US FAERS | |
| 8 | Headache | FAERS: 7 | US FAERS | |
| 9 | Menorrhagia | FAERS: 7 | US FAERS | |
| 10 | Nausea | FAERS: 7 | US FAERS | |
| 11 | Pain | FAERS: 7 | US FAERS | |
| 12 | Arthralgia | FAERS: 6 | US FAERS | |
| 13 | Back Pain | FAERS: 6 | US FAERS | |
| 14 | Chest Pain | FAERS: 5 | US FAERS | |
| 15 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 16 | Mood swings | FAERS: 5 | US FAERS | |
| 17 | Anxiety | FAERS: 4 | US FAERS | |
| 18 | Endometriosis | FAERS: 4 | US FAERS | |
| 19 | Injection site pain | FAERS: 4 | US FAERS | |
| 20 | Vomiting | FAERS: 4 | US FAERS | |
| 21 | Weight decreased | FAERS: 4 | US FAERS | |
| 22 | Alopecia | FAERS: 3 | US FAERS | |
| 23 | Bone pain | FAERS: 3 | US FAERS | |
| 24 | Crying | FAERS: 3 | US FAERS | |
| 25 | Nervousness | FAERS: 3 | US FAERS | |
| 26 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 27 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 28 | Amnesia | FAERS: 2 | US FAERS | |
| 29 | Blood urine present | FAERS: 2 | US FAERS | |
| 30 | Cystitis | FAERS: 2 | US FAERS | |
| 31 | Emotional disorder | FAERS: 2 | US FAERS | |
| 32 | Fatigue | FAERS: 2 | US FAERS | |
| 33 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 34 | Memory impairment | FAERS: 2 | US FAERS | |
| 35 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 36 | Swelling | FAERS: 2 | US FAERS | |
| 37 | Thrombosis | FAERS: 2 | US FAERS | |
| 38 | Visual Impairment | FAERS: 2 | US FAERS | |
| 39 | Vulvovaginal pain | FAERS: 2 | US FAERS | |
| 40 | Abasia | FAERS: 1 | US FAERS | |
| 41 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 42 | Acne | FAERS: 1 | US FAERS | |
| 43 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 44 | Agitation | FAERS: 1 | US FAERS | |
| 45 | Asthenia | FAERS: 1 | US FAERS | |
| 46 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 47 | Burning sensation | FAERS: 1 | US FAERS | |
| 48 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 49 | Chills | FAERS: 1 | US FAERS | |
| 50 | Constipation | FAERS: 1 | US FAERS | |
| 51 | Dehydration | FAERS: 1 | US FAERS | |
| 52 | Depressed mood | FAERS: 1 | US FAERS | |
| 53 | Dysgeusia | FAERS: 1 | US FAERS | |
| 54 | Dyspepsia | FAERS: 1 | US FAERS | |
| 55 | Dysuria | FAERS: 1 | US FAERS | |
| 56 | Expired product administered | FAERS: 1 | US FAERS | |
| 57 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 58 | Hysterectomy | FAERS: 1 | US FAERS | |
| 59 | Impaired work ability | FAERS: 1 | US FAERS | |
| 60 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 61 | Infection | FAERS: 1 | US FAERS | |
| 62 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 63 | Injection site hypersensitivity | FAERS: 1 | US FAERS | |
| 64 | Injection site mass | FAERS: 1 | US FAERS | |
| 65 | Insurance issue | FAERS: 1 | US FAERS | |
| 66 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 67 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 68 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 69 | Laparoscopy | FAERS: 1 | US FAERS | |
| 70 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 71 | Malaise | FAERS: 1 | US FAERS | |
| 72 | Muscle tightness | FAERS: 1 | US FAERS | |
| 73 | Myalgia | FAERS: 1 | US FAERS | |
| 74 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 75 | Neuralgia | FAERS: 1 | US FAERS | |
| 76 | Osteopenia | FAERS: 1 | US FAERS | |
| 77 | Palpitations | FAERS: 1 | US FAERS | |
| 78 | Product quality issue | FAERS: 1 | US FAERS | |
| 79 | Retching | FAERS: 1 | US FAERS | |
| 80 | Skin lesion | FAERS: 1 | US FAERS | |
| 81 | Stomatitis | FAERS: 1 | US FAERS | |
| 82 | Tachycardia | FAERS: 1 | US FAERS | |
| 83 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 84 | Toothache | FAERS: 1 | US FAERS | |
| 85 | Tremor | FAERS: 1 | US FAERS | |
| 86 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 87 | Uterine spasm | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.