Adapalene, Benzoyl Peroxide Drug Combination
(UXWMHYHGBDEQJF-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(c1ccccc1)OOC(=O)c1ccccc1.COc1ccc(cc1C12CC3CC(C2)CC(C1)C3)c1ccc2c(c1)ccc(c2)C(=O)O
- Molecular Formula:
- C42H38O7
- Molecular Weight:
- 654.747
- Log P:
- 9.2968
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 99.13
- CAS Number(s):
- 1194805-81-6
Synonym(s)
1.
Adapalene, Benzoyl Peroxide Drug Combination
2.
Adapalene - Benzoyl Peroxide Drug Combination
3.
Adapalene Benzoyl Peroxide Drug Combination
4.
Adapalene-Benzoyl Peroxide Drug Combination
5.
Epiduo
External Link(s)
| MeSH | D000068801 |
| PubChem Compound | 23653552 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Erythema | FAERS: 87 | US FAERS | |
| 2 | Dry skin | FAERS: 50 | US FAERS | |
| 3 | Pruritus | FAERS: 41 | US FAERS | |
| 4 | Drug ineffective | FAERS: 37 | US FAERS | |
| 5 | Pain of skin | FAERS: 26 | US FAERS | |
| 6 | Acne | FAERS: 25 | US FAERS | |
| 7 | Skin irritation | FAERS: 18 | US FAERS | |
| 8 | Application site erythema | FAERS: 15 | US FAERS | |
| 9 | Hypersensitivity | FAERS: 13 | US FAERS | |
| 10 | Application site dryness | FAERS: 9 | US FAERS | |
| 11 | Application site pain | FAERS: 8 | US FAERS | |
| 12 | Dermatitis | FAERS: 8 | US FAERS | |
| 13 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 14 | Swelling | FAERS: 7 | US FAERS | |
| 15 | Burning sensation | FAERS: 6 | US FAERS | |
| 16 | Urticaria | FAERS: 6 | US FAERS | |
| 17 | Accidental exposure to product | FAERS: 5 | US FAERS | |
| 18 | Alopecia | FAERS: 5 | US FAERS | |
| 19 | Angioedema | FAERS: 5 | US FAERS | |
| 20 | Application site exfoliation | FAERS: 5 | US FAERS | |
| 21 | Application site pruritus | FAERS: 5 | US FAERS | |
| 22 | Chemical burn of skin | FAERS: 5 | US FAERS | |
| 23 | Chemical injury | FAERS: 5 | US FAERS | |
| 24 | Pain | FAERS: 5 | US FAERS | |
| 25 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 26 | Facial Pain | FAERS: 4 | US FAERS | |
| 27 | Headache | FAERS: 4 | US FAERS | |
| 28 | Application site burn | FAERS: 3 | US FAERS | |
| 29 | Application site swelling | FAERS: 3 | US FAERS | |
| 30 | Arthralgia | FAERS: 3 | US FAERS | |
| 31 | Emotional distress | FAERS: 3 | US FAERS | |
| 32 | Application site irritation | FAERS: 2 | US FAERS | |
| 33 | Application site rash | FAERS: 2 | US FAERS | |
| 34 | Application site warmth | FAERS: 2 | US FAERS | |
| 35 | Crying | FAERS: 2 | US FAERS | |
| 36 | Dizziness | FAERS: 2 | US FAERS | |
| 37 | Expired drug administered | FAERS: 2 | US FAERS | |
| 38 | Eye pain | FAERS: 2 | US FAERS | |
| 39 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 40 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 41 | Overdose | FAERS: 2 | US FAERS | |
| 42 | Papule | FAERS: 2 | US FAERS | |
| 43 | Product use issue | FAERS: 2 | US FAERS | |
| 44 | Rash erythematous | FAERS: 2 | US FAERS | |
| 45 | Scab | FAERS: 2 | US FAERS | |
| 46 | Skin discomfort | FAERS: 2 | US FAERS | |
| 47 | Skin tightness | FAERS: 2 | US FAERS | |
| 48 | Vertigo | FAERS: 2 | US FAERS | |
| 49 | Anxiety | FAERS: 1 | US FAERS | |
| 50 | Application site eczema | FAERS: 1 | US FAERS | |
| 51 | Application site hypersensitivity | FAERS: 1 | US FAERS | |
| 52 | Application site inflammation | FAERS: 1 | US FAERS | |
| 53 | Blindness | FAERS: 1 | US FAERS | |
| 54 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 55 | Cellulitis | FAERS: 1 | US FAERS | |
| 56 | Chloasma | FAERS: 1 | US FAERS | |
| 57 | Corneal exfoliation | FAERS: 1 | US FAERS | |
| 58 | Dilated pores | FAERS: 1 | US FAERS | |
| 59 | Drug administration error | FAERS: 1 | US FAERS | |
| 60 | Eczema weeping | FAERS: 1 | US FAERS | |
| 61 | Eczema | FAERS: 1 | US FAERS | |
| 62 | Educational problem | FAERS: 1 | US FAERS | |
| 63 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 64 | Expired product administered | FAERS: 1 | US FAERS | |
| 65 | Eye irritation | FAERS: 1 | US FAERS | |
| 66 | Eyelid exfoliation | FAERS: 1 | US FAERS | |
| 67 | Eyelid pain | FAERS: 1 | US FAERS | |
| 68 | Eyelid skin dryness | FAERS: 1 | US FAERS | |
| 69 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 70 | Impetigo | FAERS: 1 | US FAERS | |
| 71 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 72 | Inflammation | FAERS: 1 | US FAERS | |
| 73 | Influenza | FAERS: 1 | US FAERS | |
| 74 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 75 | Joint swelling | FAERS: 1 | US FAERS | |
| 76 | Lethargy | FAERS: 1 | US FAERS | |
| 77 | Lip erythema | FAERS: 1 | US FAERS | |
| 78 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 79 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 80 | Medication residue present | FAERS: 1 | US FAERS | |
| 81 | Photophobia | FAERS: 1 | US FAERS | |
| 82 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 83 | Product package associated injury | FAERS: 1 | US FAERS | |
| 84 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 85 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 86 | Secretion discharge | FAERS: 1 | US FAERS | |
| 87 | Skin Erosion | FAERS: 1 | US FAERS | |
| 88 | Skin Induration | FAERS: 1 | US FAERS | |
| 89 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 90 | Skin lesion | FAERS: 1 | US FAERS | |
| 91 | Skin reaction | FAERS: 1 | US FAERS | |
| 92 | Skin test positive | FAERS: 1 | US FAERS | |
| 93 | Sunburn | FAERS: 1 | US FAERS | |
| 94 | Tachycardia | FAERS: 1 | US FAERS | |
| 95 | Therapy cessation | FAERS: 1 | US FAERS | |
| 96 | Throat irritation | FAERS: 1 | US FAERS | |
| 97 | Visual Impairment | FAERS: 1 | US FAERS | |
| 98 | Vomiting | FAERS: 1 | US FAERS | |
| 99 | Weight decreased | FAERS: 1 | US FAERS | |
| 100 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 101 | Wrong technique in product usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.