ioxilan
(UUMLTINZBQPNGF-UHFFFAOYSA-N)
Structure
- SMILES
- OCCNC(=O)c1c(I)c(C(=O)NCC(CO)O)c(c(c1I)N(C(=O)C)CC(CO)O)I
- Type(s)
- Approved
- ATC code(s)
- V08AB12
- Molecular Formula:
- C18H24I3N3O8
- Molecular Weight:
- 791.112
- Log P:
- -0.2066
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 7
- TPSA:
- 179.66
- CAS Number(s):
- 107793-72-6
Synonym(s)
1.
ioxilan
2.
5-(N-2,3-dihydroxypropylacetamido)-2,4,6-triiodo-N-(2-hydroxyethyl)-N'-(2,3-dihydroxypropyl)isophthalamide
3.
Oxilan
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Urticaria | FAERS: 33 | SIDER US FAERS | |
| 2 | Vomiting | FAERS: 21 | SIDER US FAERS | |
| 3 | Nausea | FAERS: 15 | SIDER US FAERS | |
| 4 | Pruritus | FAERS: 15 | SIDER US FAERS | |
| 5 | Hypersensitivity | FAERS: 11 | SIDER US FAERS | |
| 6 | Sneezing | FAERS: 9 | US FAERS | |
| 7 | Contrast media reaction | FAERS: 8 | US FAERS | |
| 8 | Chest Pain | FAERS: 6 | US FAERS | |
| 9 | Erythema | FAERS: 5 | US FAERS | |
| 10 | Headache | FAERS: 5 | SIDER US FAERS | |
| 11 | Electrocardiogram abnormal | FAERS: 4 | US FAERS | |
| 12 | Hypotension | FAERS: 4 | SIDER US FAERS | |
| 13 | Atrial Fibrillation | FAERS: 3 | SIDER US FAERS | |
| 14 | Dizziness | FAERS: 3 | SIDER US FAERS | |
| 15 | Procedural complication | FAERS: 3 | US FAERS | |
| 16 | Bradycardia | FAERS: 2 | SIDER US FAERS | |
| 17 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 18 | Cheilitis | FAERS: 2 | US FAERS | |
| 19 | Chills | FAERS: 2 | SIDER US FAERS | |
| 20 | Choking | FAERS: 2 | US FAERS | |
| 21 | Dysarthria | FAERS: 2 | US FAERS | |
| 22 | Dysphemia | FAERS: 2 | US FAERS | |
| 23 | Dysphonia | FAERS: 2 | US FAERS | |
| 24 | Hemiparesis | FAERS: 2 | US FAERS | |
| 25 | Post procedural complication | FAERS: 2 | US FAERS | |
| 26 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 27 | Stomatitis | FAERS: 2 | US FAERS | |
| 28 | Tremor | FAERS: 2 | US FAERS | |
| 29 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 30 | Airway peak pressure increased | FAERS: 1 | US FAERS | |
| 31 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 32 | Angina Pectoris | FAERS: 1 | SIDER US FAERS | |
| 33 | Burning sensation | FAERS: 1 | US FAERS | |
| 34 | Conversion disorder | FAERS: 1 | US FAERS | |
| 35 | Cyanosis | FAERS: 1 | US FAERS | |
| 36 | Dysgeusia | FAERS: 1 | SIDER US FAERS | |
| 37 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 38 | Hypercreatininaemia | FAERS: 1 | US FAERS | |
| 39 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 40 | Injection site erythema | FAERS: 1 | US FAERS | |
| 41 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 42 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 43 | Muscle tightness | FAERS: 1 | US FAERS | |
| 44 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 45 | Neck Pain | FAERS: 1 | US FAERS | |
| 46 | Pain | FAERS: 1 | SIDER US FAERS | |
| 47 | Presyncope | FAERS: 1 | US FAERS | |
| 48 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 49 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 50 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 51 | Respiratory distress | FAERS: 1 | US FAERS | |
| 52 | Tachycardia | FAERS: 1 | SIDER US FAERS | |
| 53 | Throat irritation | FAERS: 1 | US FAERS | |
| 54 | Visual disturbance | FAERS: 1 | US FAERS | |
| 55 | Amblyopia | SIDER | ||
| 56 | Anorexia | SIDER | ||
| 57 | Anuria | SIDER | ||
| 58 | Asthenia | SIDER | ||
| 59 | Back Pain | SIDER | ||
| 60 | Bronchospasm | SIDER | ||
| 61 | Conjunctivitis | SIDER | ||
| 62 | Constipation | SIDER | ||
| 63 | Dermatitis | SIDER | ||
| 64 | Dyspepsia | SIDER | ||
| 65 | Dysuria | SIDER | ||
| 66 | Ileus | SIDER | ||
| 67 | Infection | SIDER | ||
| 68 | Kidney Diseases | 15926184 19539072 | CTD | |
| 69 | Muscle relaxant therapy | SIDER | ||
| 70 | Nystagmus | SIDER | ||
| 71 | Pharyngitis | SIDER | ||
| 72 | Renal Insufficiency | 18768415 | CTD | |
| 73 | Rhinitis | SIDER | ||
| 74 | Shock | SIDER | ||
| 75 | Somnolence | SIDER | ||
| 76 | Sweating | SIDER | ||
| 77 | Syncope | SIDER | ||
| 78 | Vasodilation procedure | SIDER | ||
| 79 | Vasodilation | SIDER | ||
| 80 | Vertigo | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.