Eucreas
(UOXXTZDTECBLDK-FRWZKJFKSA-N)
Structure
- SMILES
- CN(C(=N)N=C(N)N)C.N#C[C@H]1CCCN1C(=O)CNC12CC3CC(C1)CC(C2)(C3)O
- Molecular Formula:
- C21H36N8O2
- Molecular Weight:
- 432.563
- Log P:
- 1.7596
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 5
- TPSA:
- 167.85
- CAS Number(s):
- 1198772-16-5
Synonym(s)
1.
Eucreas
External Link(s)
| PubChem Compound | 121488163 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abdominal Pain | FAERS: 13 | US FAERS | |
| 2 | Flatulence | FAERS: 10 | US FAERS | |
| 3 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 4 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 5 | Nausea | FAERS: 3 | US FAERS | |
| 6 | Pancreatitis | FAERS: 3 | US FAERS | |
| 7 | Tachycardia | FAERS: 3 | US FAERS | |
| 8 | Angioedema | FAERS: 2 | US FAERS | |
| 9 | Biopsy kidney abnormal | FAERS: 2 | US FAERS | |
| 10 | Biopsy skin abnormal | FAERS: 2 | US FAERS | |
| 11 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 12 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 13 | Cataract operation | FAERS: 2 | US FAERS | |
| 14 | Cataract | FAERS: 2 | US FAERS | |
| 15 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 16 | Cyst | FAERS: 2 | US FAERS | |
| 17 | Dermatitis | FAERS: 2 | US FAERS | |
| 18 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 19 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 20 | Hepatitis | FAERS: 2 | US FAERS | |
| 21 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 22 | Lipase increased | FAERS: 2 | US FAERS | |
| 23 | Malaise | FAERS: 2 | US FAERS | |
| 24 | Nephrosclerosis | FAERS: 2 | US FAERS | |
| 25 | Obesity | FAERS: 2 | US FAERS | |
| 26 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 27 | Proteinuria | FAERS: 2 | US FAERS | |
| 28 | QRS axis abnormal | FAERS: 2 | US FAERS | |
| 29 | Ultrasound scan abnormal | FAERS: 2 | US FAERS | |
| 30 | Urticaria | FAERS: 2 | US FAERS | |
| 31 | Weight decreased | FAERS: 2 | US FAERS | |
| 32 | jaundice | FAERS: 2 | US FAERS | |
| 33 | Anuria | FAERS: 1 | US FAERS | |
| 34 | Arthropod bite | FAERS: 1 | US FAERS | |
| 35 | Asthenia | FAERS: 1 | US FAERS | |
| 36 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 37 | Burning sensation | FAERS: 1 | US FAERS | |
| 38 | Chills | FAERS: 1 | US FAERS | |
| 39 | Chromaturia | FAERS: 1 | US FAERS | |
| 40 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 41 | Disorientation | FAERS: 1 | US FAERS | |
| 42 | Dizziness | FAERS: 1 | US FAERS | |
| 43 | Drug ineffective | FAERS: 1 | US FAERS | |
| 44 | Dyspepsia | FAERS: 1 | US FAERS | |
| 45 | Eczema | FAERS: 1 | US FAERS | |
| 46 | Erysipelas | FAERS: 1 | US FAERS | |
| 47 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 48 | Headache | FAERS: 1 | US FAERS | |
| 49 | Hepatitis C | FAERS: 1 | US FAERS | |
| 50 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 51 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 52 | Lip swelling | FAERS: 1 | US FAERS | |
| 53 | Myalgia | FAERS: 1 | US FAERS | |
| 54 | Necrosis | FAERS: 1 | US FAERS | |
| 55 | Overdose | FAERS: 1 | US FAERS | |
| 56 | Palpitations | FAERS: 1 | US FAERS | |
| 57 | Petechiae | FAERS: 1 | US FAERS | |
| 58 | Product quality issue | FAERS: 1 | US FAERS | |
| 59 | Pruritus | FAERS: 1 | US FAERS | |
| 60 | Renal Colic | FAERS: 1 | US FAERS | |
| 61 | Renal cyst | FAERS: 1 | US FAERS | |
| 62 | Renal pain | FAERS: 1 | US FAERS | |
| 63 | Secretion discharge | FAERS: 1 | US FAERS | |
| 64 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 65 | Somnolence | FAERS: 1 | US FAERS | |
| 66 | Syncope | FAERS: 1 | US FAERS | |
| 67 | Transaminases increased | FAERS: 1 | US FAERS | |
| 68 | Tremor | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.