1-(((alpha-isobutanoyloxyethoxy)carbonyl)aminomethyl)-1-cyclohexaneacetic acid
(TZDUHAJSIBHXDL-UHFFFAOYSA-N)
Structure
- SMILES
- CC(OC(=O)C(C)C)OC(=O)NCC1(CCCCC1)CC(=O)O
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C16H27NO6
- Molecular Weight:
- 329.389
- Log P:
- 3.0739
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 101.93
- CAS Number(s):
- 478296-72-9
Synonym(s)
1.
1-(((alpha-isobutanoyloxyethoxy)carbonyl)aminomethyl)-1-cyclohexaneacetic acid
2.
XP 10569
3.
XP 11084
4.
XP 11239
5.
XP 12464
6.
XP 13512
7.
XP-10569
8.
XP-11084
9.
XP-11239
10.
XP-12464
11.
XP-13512
12.
XP10569
13.
XP11084
14.
XP11239
15.
XP12464
16.
XP13512
17.
gabapentin enacarbil
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 44 | US FAERS | |
| 2 | Toxicity to various agents | FAERS: 30 | US FAERS | |
| 3 | Dizziness | FAERS: 29 | US FAERS | |
| 4 | Product use in unapproved indication | FAERS: 27 | US FAERS | |
| 5 | Somnolence | FAERS: 22 | US FAERS | |
| 6 | Feeling abnormal | FAERS: 18 | US FAERS | |
| 7 | Headache | FAERS: 16 | US FAERS | |
| 8 | Drug ineffective for unapproved indication | FAERS: 15 | US FAERS | |
| 9 | Nausea | FAERS: 14 | US FAERS | |
| 10 | Pain | FAERS: 11 | US FAERS | |
| 11 | Accidental overdose | FAERS: 10 | US FAERS | |
| 12 | Drug effective for unapproved indication | FAERS: 10 | US FAERS | |
| 13 | Burning sensation | FAERS: 8 | US FAERS | |
| 14 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 15 | Anxiety | FAERS: 7 | US FAERS | |
| 16 | Completed Suicide | FAERS: 7 | US FAERS | |
| 17 | Fatigue | FAERS: 7 | US FAERS | |
| 18 | Vomiting | FAERS: 7 | US FAERS | |
| 19 | Wrong technique in product usage process | FAERS: 7 | US FAERS | |
| 20 | Impaired driving ability | FAERS: 6 | US FAERS | |
| 21 | Intentional product misuse | FAERS: 6 | US FAERS | |
| 22 | Malaise | FAERS: 6 | US FAERS | |
| 23 | Peripheral swelling | FAERS: 6 | US FAERS | |
| 24 | Pruritus | FAERS: 6 | US FAERS | |
| 25 | Infantile back arching | FAERS: 5 | US FAERS | |
| 26 | Overdose | FAERS: 5 | US FAERS | |
| 27 | Restless Legs Syndrome | FAERS: 5 | US FAERS | |
| 28 | Swelling | FAERS: 5 | US FAERS | |
| 29 | Tongue spasm | FAERS: 5 | US FAERS | |
| 30 | Adverse event | FAERS: 4 | US FAERS | |
| 31 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 32 | Neuralgia | FAERS: 4 | US FAERS | |
| 33 | Product prescribing issue | FAERS: 4 | US FAERS | |
| 34 | Unevaluable event | FAERS: 4 | US FAERS | |
| 35 | Urticaria | FAERS: 4 | US FAERS | |
| 36 | Vertigo | FAERS: 4 | US FAERS | |
| 37 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 38 | Amnesia | FAERS: 3 | US FAERS | |
| 39 | Drug abuse | FAERS: 3 | US FAERS | |
| 40 | Dysuria | FAERS: 3 | US FAERS | |
| 41 | Erythema | FAERS: 3 | US FAERS | |
| 42 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 43 | Memory impairment | FAERS: 3 | US FAERS | |
| 44 | Myalgia | FAERS: 3 | US FAERS | |
| 45 | Palpitations | FAERS: 3 | US FAERS | |
| 46 | Pneumonia | FAERS: 3 | US FAERS | |
| 47 | Product physical issue | FAERS: 3 | US FAERS | |
| 48 | Product quality issue | FAERS: 3 | US FAERS | |
| 49 | Tremor | FAERS: 3 | US FAERS | |
| 50 | Weight decreased | FAERS: 3 | US FAERS | |
| 51 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 52 | Anger | FAERS: 2 | US FAERS | |
| 53 | Arthralgia | FAERS: 2 | US FAERS | |
| 54 | Asthenia | FAERS: 2 | US FAERS | |
| 55 | Asthma | FAERS: 2 | US FAERS | |
| 56 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 57 | Chest discomfort | FAERS: 2 | US FAERS | |
| 58 | Constipation | FAERS: 2 | US FAERS | |
| 59 | Crying | FAERS: 2 | US FAERS | |
| 60 | Disorientation | FAERS: 2 | US FAERS | |
| 61 | Drug administration error | FAERS: 2 | US FAERS | |
| 62 | Dysarthria | FAERS: 2 | US FAERS | |
| 63 | Extra dose administered | FAERS: 2 | US FAERS | |
| 64 | Hypersomnia | FAERS: 2 | US FAERS | |
| 65 | Ileus | FAERS: 2 | US FAERS | |
| 66 | Impaired work ability | FAERS: 2 | US FAERS | |
| 67 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 68 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 69 | Laryngitis | FAERS: 2 | US FAERS | |
| 70 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 71 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 72 | Myoclonus | FAERS: 2 | US FAERS | |
| 73 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 74 | Oral pain | FAERS: 2 | US FAERS | |
| 75 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 76 | Product administration error | FAERS: 2 | US FAERS | |
| 77 | Product dose omission | FAERS: 2 | US FAERS | |
| 78 | Product use issue | FAERS: 2 | US FAERS | |
| 79 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 80 | Restlessness | FAERS: 2 | US FAERS | |
| 81 | Suicide attempt | FAERS: 2 | US FAERS | |
| 82 | Therapeutic product effect decreased | FAERS: 2 | US FAERS | |
| 83 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 84 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 85 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 86 | Agitation | FAERS: 1 | US FAERS | |
| 87 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 88 | Alopecia | FAERS: 1 | US FAERS | |
| 89 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 90 | Anion Gap | FAERS: 1 | US FAERS | |
| 91 | Aphonia | FAERS: 1 | US FAERS | |
| 92 | Arthritis | FAERS: 1 | US FAERS | |
| 93 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 94 | Back Pain | FAERS: 1 | US FAERS | |
| 95 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 96 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 97 | Cellulitis | FAERS: 1 | US FAERS | |
| 98 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 99 | Chest Pain | FAERS: 1 | US FAERS | |
| 100 | Choking | FAERS: 1 | US FAERS | |
| 101 | Chorea | FAERS: 1 | US FAERS | |
| 102 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 103 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 104 | Death of relative | FAERS: 1 | US FAERS | |
| 105 | Dehydration | FAERS: 1 | US FAERS | |
| 106 | Delirium | FAERS: 1 | US FAERS | |
| 107 | Dependence | FAERS: 1 | US FAERS | |
| 108 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 109 | Discomfort | FAERS: 1 | US FAERS | |
| 110 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 111 | Dyspepsia | FAERS: 1 | US FAERS | |
| 112 | Dysphonia | FAERS: 1 | US FAERS | |
| 113 | Dystonia | FAERS: 1 | US FAERS | |
| 114 | Enuresis | FAERS: 1 | US FAERS | |
| 115 | Eosinophilic colitis | FAERS: 1 | US FAERS | |
| 116 | Flatulence | FAERS: 1 | US FAERS | |
| 117 | Formication | FAERS: 1 | US FAERS | |
| 118 | Fracture | FAERS: 1 | US FAERS | |
| 119 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 120 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 121 | Hypomania | FAERS: 1 | US FAERS | |
| 122 | Hypophagia | FAERS: 1 | US FAERS | |
| 123 | Hypotension | FAERS: 1 | US FAERS | |
| 124 | Hypoxia | FAERS: 1 | US FAERS | |
| 125 | Immobile | FAERS: 1 | US FAERS | |
| 126 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 127 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 128 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 129 | Lethargy | FAERS: 1 | US FAERS | |
| 130 | Leukocytosis | FAERS: 1 | US FAERS | |
| 131 | Limb discomfort | FAERS: 1 | US FAERS | |
| 132 | Limb injury | FAERS: 1 | US FAERS | |
| 133 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 134 | Medication residue present | FAERS: 1 | US FAERS | |
| 135 | Mental impairment | FAERS: 1 | US FAERS | |
| 136 | Middle insomnia | FAERS: 1 | US FAERS | |
| 137 | Mood swings | FAERS: 1 | US FAERS | |
| 138 | Mouth swelling | FAERS: 1 | US FAERS | |
| 139 | Muscle tightness | FAERS: 1 | US FAERS | |
| 140 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 141 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 142 | Nerve injury | FAERS: 1 | US FAERS | |
| 143 | Nervousness | FAERS: 1 | US FAERS | |
| 144 | No adverse event | FAERS: 1 | US FAERS | |
| 145 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 146 | Ocular icterus | FAERS: 1 | US FAERS | |
| 147 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 148 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 149 | Product dispensing error | FAERS: 1 | US FAERS | |
| 150 | Product storage error | FAERS: 1 | US FAERS | |
| 151 | Product use complaint | FAERS: 1 | US FAERS | |
| 152 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 153 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 154 | Rash erythematous | FAERS: 1 | US FAERS | |
| 155 | Renal pain | FAERS: 1 | US FAERS | |
| 156 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 157 | Schizophrenia | FAERS: 1 | US FAERS | |
| 158 | Screaming | FAERS: 1 | US FAERS | |
| 159 | Slow speech | FAERS: 1 | US FAERS | |
| 160 | Somnambulism | FAERS: 1 | US FAERS | |
| 161 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 162 | Tachycardia | FAERS: 1 | US FAERS | |
| 163 | Therapeutic product effective for unapproved indication | FAERS: 1 | US FAERS | |
| 164 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 165 | Thermal burn | FAERS: 1 | US FAERS | |
| 166 | Thermoanaesthesia | FAERS: 1 | US FAERS | |
| 167 | Throat irritation | FAERS: 1 | US FAERS | |
| 168 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 169 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 170 | Urinary Retention | FAERS: 1 | US FAERS | |
| 171 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 172 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 173 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.