Technetium Tc 99m oxidronate
(SIJNDWFHVBDXDY-IEOVAKBOSA-N)
Structure
- SMILES
- OC(P(=O)(O)O)P(=O)(O)O.[99Tc]
- Type(s)
- Approved
- ATC code(s)
- V09BA01
- Molecular Formula:
- CH6O7P2Tc
- Molecular Weight:
- 290.908
- Log P:
- -1.3848
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 5
- TPSA:
- 154.91
- CAS Number(s):
- 72945-61-0
Synonym(s)
1.
Technetium Tc 99m oxidronate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Contrast media reaction | FAERS: 3 | US FAERS | |
| 2 | Bone pain | FAERS: 2 | US FAERS | |
| 3 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 4 | Injection site cellulitis | FAERS: 2 | US FAERS | |
| 5 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 6 | Arthralgia | FAERS: 1 | US FAERS | |
| 7 | Asthenia | FAERS: 1 | US FAERS | |
| 8 | Asthma | FAERS: 1 | US FAERS | |
| 9 | Burning sensation | FAERS: 1 | US FAERS | |
| 10 | Headache | FAERS: 1 | US FAERS | |
| 11 | Injection site atrophy | FAERS: 1 | US FAERS | |
| 12 | Injection site erythema | FAERS: 1 | US FAERS | |
| 13 | Injection site pain | FAERS: 1 | US FAERS | |
| 14 | Petechiae | FAERS: 1 | US FAERS | |
| 15 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 16 | Syncope | FAERS: 1 | US FAERS | |
| 17 | Thrombocytopenia | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.