Levobupivacaine
(SIEYLFHKZGLBNX-NTISSMGPSA-N)
Structure
- SMILES
- CCCCN1CCCC[C@H]1C(=O)Nc1c(C)cccc1C.Cl
- Molecular Formula:
- C18H29ClN2O
- Molecular Weight:
- 324.889
- Log P:
- 4.7094
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 32.34
- CAS Number(s):
- 27262-48-2
Synonym(s)
1.
Levobupivacaine
2.
Chirocaine
3.
Levobupivacaine Hydrochloride
External Link(s)
| MeSH | D000077554 |
| PubChem Compound | 117965 49852293 |
| ChEBI | 31772 |
| CHEMBL | CHEMBL1200749 |
| KEGG | dr:D01287 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 4 | US FAERS | |
| 2 | Pain | FAERS: 2 | US FAERS | |
| 3 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 4 | Bradycardia | FAERS: 1 | US FAERS | |
| 5 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 6 | Complication of delivery | FAERS: 1 | US FAERS | |
| 7 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 8 | Headache | FAERS: 1 | US FAERS | |
| 9 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 10 | Hypotension | FAERS: 1 | US FAERS | |
| 11 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 12 | Meningitis | FAERS: 1 | US FAERS | |
| 13 | Monoplegia | FAERS: 1 | US FAERS | |
| 14 | Necrosis | FAERS: 1 | US FAERS | |
| 15 | Paresis | FAERS: 1 | US FAERS | |
| 16 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 17 | Product contamination | FAERS: 1 | US FAERS | |
| 18 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 19 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 20 | Uterine Rupture | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.