methenamine hippurate
(ROAIXOJGRFKICW-UHFFFAOYSA-N)
Structure
- SMILES
- C1N2CN3CN1CN(C2)C3.O=C(c1ccccc1)NCC(=O)O
- Molecular Formula:
- C15H21N5O3
- Molecular Weight:
- 319.359
- Log P:
- -0.3763
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 79.36
- CAS Number(s):
- 5714-73-8
Synonym(s)
1.
methenamine hippurate
2.
Hip-Rex
3.
Hiprex
4.
Urex
5.
Urotractan
6.
hexamine hippurate
External Link(s)
| MeSH | C011481 |
| PubChem Compound | 21945 |
| ChEBI | 6825 |
| CHEMBL | CHEMBL1201104 |
| KEGG | dr:D00855 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dehydration | FAERS: 2 | US FAERS | |
| 2 | Dizziness | FAERS: 2 | US FAERS | |
| 3 | Headache | FAERS: 2 | US FAERS | |
| 4 | No adverse event | FAERS: 2 | US FAERS | |
| 5 | Weight decreased | FAERS: 2 | US FAERS | |
| 6 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 7 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 8 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 9 | Arthralgia | FAERS: 1 | US FAERS | |
| 10 | Arthropathy | FAERS: 1 | US FAERS | |
| 11 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 12 | Chromaturia | FAERS: 1 | US FAERS | |
| 13 | Constipation | FAERS: 1 | US FAERS | |
| 14 | Drug ineffective | FAERS: 1 | US FAERS | |
| 15 | Dysgeusia | FAERS: 1 | US FAERS | |
| 16 | False positive investigation result | FAERS: 1 | US FAERS | |
| 17 | Hyperventilation | FAERS: 1 | US FAERS | |
| 18 | Hypophagia | FAERS: 1 | US FAERS | |
| 19 | Hypotension | FAERS: 1 | US FAERS | |
| 20 | Inflammation | FAERS: 1 | US FAERS | |
| 21 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 22 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 23 | Myalgia | FAERS: 1 | US FAERS | |
| 24 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 25 | Nausea | FAERS: 1 | US FAERS | |
| 26 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 27 | Product quality issue | FAERS: 1 | US FAERS | |
| 28 | Product storage error | FAERS: 1 | US FAERS | |
| 29 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 30 | Stomatitis | FAERS: 1 | US FAERS | |
| 31 | Swelling | FAERS: 1 | US FAERS | |
| 32 | Throat irritation | FAERS: 1 | US FAERS | |
| 33 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 34 | pH urine decreased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.