Pilocarpine
(RNAICSBVACLLGM-GNAZCLTHSA-N)
Structure
- SMILES
- CC[C@@H]1C(=O)OC[C@@H]1Cc1cncn1C.Cl
- Molecular Formula:
- C11H17ClN2O2
- Molecular Weight:
- 244.718
- Log P:
- 1.9638
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 44.12
- CAS Number(s):
- 54-71-7
Synonym(s)
1.
Pilocarpine
2.
Isopilocarpine
3.
Isoptocarpine
4.
Ocusert
5.
Pilocarpine Hydrochloride
6.
Pilocarpine Mononitrate, (3S-cis)-Isomer
7.
Pilocarpine Nitrate
8.
Pilocarpine, Monohydrochloride, (3S-cis)-Isomer
9.
Salagen
10.
Hydrochloride, Pilocarpine
11.
Nitrate, Pilocarpine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 10 | US FAERS | |
| 2 | Mental status changes | FAERS: 8 | US FAERS | |
| 3 | Drug ineffective | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Eye pain | FAERS: 6 | US FAERS | |
| 5 | Eye irritation | FAERS: 5 | US FAERS | |
| 6 | Dizziness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Agitation | FAERS: 3 | US FAERS | |
| 8 | Cataract | FAERS: 3 | US FAERS | |
| 9 | Chills | FAERS: 3 | US FAERS | |
| 10 | Visual Impairment | FAERS: 3 | US FAERS | |
| 11 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 12 | Amnesia | FAERS: 2 | US FAERS | |
| 13 | Disorientation | FAERS: 2 | US FAERS | |
| 14 | Eyelid margin crusting | FAERS: 2 | US FAERS | |
| 15 | Eyelid pain | FAERS: 2 | US FAERS | |
| 16 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 17 | Idiosyncratic drug reaction | FAERS: 2 | US FAERS | |
| 18 | Impaired reasoning | FAERS: 2 | US FAERS | |
| 19 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 20 | Myopia | FAERS: 2 | US FAERS | |
| 21 | Nausea | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Toxic anterior segment syndrome | FAERS: 2 | US FAERS | |
| 23 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 24 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 25 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 26 | Anorexia | FAERS: 1 | US FAERS | |
| 27 | Arthritis | FAERS: 1 | US FAERS | |
| 28 | Asthenia | FAERS: 1 | US FAERS | |
| 29 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 30 | Blepharospasm | FAERS: 1 | US FAERS | |
| 31 | Burning sensation | FAERS: 1 | US FAERS | |
| 32 | Dementia | FAERS: 1 | US FAERS | |
| 33 | Dysgeusia | FAERS: 1 | US FAERS | |
| 34 | Fatigue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 36 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 37 | Glaucoma | FAERS: 1 | US FAERS | |
| 38 | Hypersomnia | FAERS: 1 | US FAERS | |
| 39 | Hypokinesia | FAERS: 1 | US FAERS | |
| 40 | Malaise | FAERS: 1 | US FAERS | |
| 41 | Mood swings | FAERS: 1 | US FAERS | |
| 42 | Mydriasis | FAERS: 1 | US FAERS | |
| 43 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 44 | Nervousness | FAERS: 1 | US FAERS | |
| 45 | Pain | FAERS: 1 | US FAERS | |
| 46 | Palpitations | FAERS: 1 | US FAERS | |
| 47 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 48 | Posterior capsule opacification | FAERS: 1 | US FAERS | |
| 49 | Presbyopia | FAERS: 1 | US FAERS | |
| 50 | Presyncope | FAERS: 1 | US FAERS | |
| 51 | Product design issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Product dose omission | FAERS: 1 | US FAERS | |
| 53 | Product dropper issue | FAERS: 1 | US FAERS | |
| 54 | Product use complaint | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Sinusitis | FAERS: 1 | US FAERS | |
| 56 | Tension Headache | FAERS: 1 | US FAERS | |
| 57 | Tremor | FAERS: 1 | US FAERS | |
| 58 | Urinary Retention | FAERS: 1 | US FAERS | |
| 59 | Vomiting | FAERS: 1 | US FAERS | |
| 60 | Wrong technique in product usage process | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Xanthopsia | FAERS: 1 | US FAERS | |
| 62 | Conjunctivitis | Canada Vigilance: 1 | Canada Vigilance | |
| 63 | Drug ineffective for unapproved indication | Canada Vigilance: 1 | Canada Vigilance | |
| 64 | Incorrect dose administered | Canada Vigilance: 1 | Canada Vigilance | |
| 65 | Overdose | Canada Vigilance: 1 | Canada Vigilance | |
| 66 | Product use in unapproved indication | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.