2-(Dimethylamino)ethyl 2-(hydroxycyclopentyl)-2-phenylacetate, chloride
(RHKZVMUBMXGOLL-UHFFFAOYSA-N)
Structure
- SMILES
- CN(CCOC(=O)C(C1(O)CCCC1)c1ccccc1)C.Cl
- Molecular Formula:
- C17H26ClNO3
- Molecular Weight:
- 327.846
- Log P:
- 2.9821
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 49.77
- CAS Number(s):
- 5870-29-1; 60452-46-2
Synonym(s)
1.
2-(Dimethylamino)ethyl 2-(hydroxycyclopentyl)-2-phenylacetate, chloride
2.
Cyclopentolate hydrochloride
3.
2-(Dimethylamino)ethyl 2-(1-hydroxycyclopentyl)-2-phenylacetate;hydron;chloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Mydriasis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Headache | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Vomiting | FAERS: 12 | US FAERS | |
| 5 | Eye irritation | FAERS: 11 | US FAERS | |
| 6 | Nausea | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Disorientation | FAERS: 10 | US FAERS | |
| 8 | Somnolence | FAERS: 10 | US FAERS | |
| 9 | Eye pain | FAERS: 9 | US FAERS | |
| 10 | Photophobia | FAERS: 9 | US FAERS | |
| 11 | Bradycardia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Erythema | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Malaise | FAERS: 5 | US FAERS | |
| 14 | Visual Impairment | FAERS: 5 | US FAERS | |
| 15 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 16 | Hypotension | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Medication Error | FAERS: 4 | US FAERS | |
| 18 | Tachycardia | FAERS: 4 | US FAERS | |
| 19 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 20 | Amnesia | FAERS: 3 | US FAERS | |
| 21 | Ataxia | FAERS: 3 | US FAERS | |
| 22 | Delirium | FAERS: 3 | US FAERS | |
| 23 | Drug toxicity | FAERS: 3 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Hemiparesis | FAERS: 3 | US FAERS | |
| 26 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 27 | Infection | FAERS: 3 | US FAERS | |
| 28 | No reaction on previous exposure to drug | FAERS: 3 | US FAERS | |
| 29 | Abasia | FAERS: 2 | US FAERS | |
| 30 | Asthenia | FAERS: 2 | US FAERS | |
| 31 | Chest discomfort | FAERS: 2 | US FAERS | |
| 32 | Dacryostenosis acquired | FAERS: 2 | US FAERS | |
| 33 | Depressed Level of Consciousness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Drug ineffective | FAERS: 2 | US FAERS | |
| 35 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 36 | Dysarthria | FAERS: 2 | US FAERS | |
| 37 | Expired product administered | FAERS: 2 | US FAERS | |
| 38 | Grip strength | FAERS: 2 | US FAERS | |
| 39 | Overdose | FAERS: 2 | US FAERS | |
| 40 | Pallor | FAERS: 2 | US FAERS | |
| 41 | Restlessness | FAERS: 2 | US FAERS | |
| 42 | Retrograde amnesia | FAERS: 2 | US FAERS | |
| 43 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 44 | Accidental overdose | FAERS: 1 | US FAERS | |
| 45 | Acute psychosis | FAERS: 1 | US FAERS | |
| 46 | Agitation | FAERS: 1 | US FAERS | |
| 47 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 48 | Angioedema | FAERS: 1 | US FAERS | |
| 49 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 50 | Anxiety | FAERS: 1 | US FAERS | |
| 51 | Aphasia | FAERS: 1 | US FAERS | |
| 52 | Asthma | FAERS: 1 | US FAERS | |
| 53 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 54 | Blindness | FAERS: 1 | US FAERS | |
| 55 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 56 | Conduct Disorder | FAERS: 1 | US FAERS | |
| 57 | Crying | FAERS: 1 | US FAERS | |
| 58 | Dermatitis | FAERS: 1 | US FAERS | |
| 59 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 60 | Dysgeusia | FAERS: 1 | US FAERS | |
| 61 | Dysphemia | FAERS: 1 | US FAERS | |
| 62 | Expired drug administered | FAERS: 1 | US FAERS | |
| 63 | Fatigue | FAERS: 1 | US FAERS | |
| 64 | Flatulence | FAERS: 1 | US FAERS | |
| 65 | Flushing | FAERS: 1 | US FAERS | |
| 66 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 67 | Gaze palsy | FAERS: 1 | US FAERS | |
| 68 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 69 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 70 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 71 | Head discomfort | FAERS: 1 | US FAERS | |
| 72 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 73 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 74 | Larynx irritation | FAERS: 1 | US FAERS | |
| 75 | Limb discomfort | FAERS: 1 | US FAERS | |
| 76 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 77 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 78 | Nervousness | FAERS: 1 | US FAERS | |
| 79 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 80 | Palpitations | FAERS: 1 | US FAERS | |
| 81 | Personality Change | FAERS: 1 | US FAERS | |
| 82 | Pneumonia | FAERS: 1 | US FAERS | |
| 83 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 84 | Product quality issue | FAERS: 1 | US FAERS | |
| 85 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 86 | Quadriparesis | FAERS: 1 | US FAERS | |
| 87 | Slow speech | FAERS: 1 | US FAERS | |
| 88 | Staring | FAERS: 1 | US FAERS | |
| 89 | Syncope | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Thirst | FAERS: 1 | US FAERS | |
| 91 | Truancy | FAERS: 1 | US FAERS | |
| 92 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 93 | Urticaria | FAERS: 1 | US FAERS | |
| 94 | Hyperkinesia | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.