Mepivacaine
(RETIMRUQNCDCQB-UHFFFAOYSA-N)
Structure
- SMILES
- CN1CCCCC1C(=O)Nc1c(C)cccc1C.Cl
- Molecular Formula:
- C15H23ClN2O
- Molecular Weight:
- 282.809
- Log P:
- 3.5391
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 32.34
- CAS Number(s):
- 1722-62-9
Synonym(s)
1.
Mepivacaine
2.
Carbocaine
3.
Carbocaïne
4.
Isocaine
5.
Isogaine
6.
Meaverin
7.
Mecain
8.
Mepihexal
9.
Mepivacain-Injektopas
10.
Mepivacaina Braun
11.
Mepivacaine Hydrochloride
12.
Mepivacaine Monohydrochloride
13.
Mepivastesin
14.
Polocaine
15.
Scandicain
16.
Scandicaine
17.
Scandinibsa
18.
Scandonest
19.
Mepivacain Injektopas
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 10 | US FAERS | |
| 2 | Tremor | FAERS: 9 | US FAERS | |
| 3 | Dizziness | FAERS: 7 | US FAERS | |
| 4 | Retinal Artery Occlusion | FAERS: 6 | US FAERS | |
| 5 | Angioedema | FAERS: 5 | US FAERS | |
| 6 | Drug ineffective | FAERS: 5 | US FAERS | |
| 7 | Dysarthria | FAERS: 5 | US FAERS | |
| 8 | Dysphonia | FAERS: 5 | US FAERS | |
| 9 | Headache | FAERS: 5 | US FAERS | |
| 10 | Visual Impairment | FAERS: 5 | US FAERS | |
| 11 | Bradycardia | FAERS: 4 | US FAERS | |
| 12 | Chest discomfort | FAERS: 4 | US FAERS | |
| 13 | Clonus | FAERS: 4 | US FAERS | |
| 14 | Erythema | FAERS: 4 | US FAERS | |
| 15 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 16 | Malaise | FAERS: 4 | US FAERS | |
| 17 | Medication Error | FAERS: 4 | US FAERS | |
| 18 | Syncope | FAERS: 4 | US FAERS | |
| 19 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 20 | Asthma | FAERS: 3 | US FAERS | |
| 21 | Diplopia | FAERS: 3 | US FAERS | |
| 22 | Dysgeusia | FAERS: 3 | US FAERS | |
| 23 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 24 | Hypotension | FAERS: 3 | US FAERS | |
| 25 | Nervousness | FAERS: 3 | US FAERS | |
| 26 | Palpitations | FAERS: 3 | US FAERS | |
| 27 | Product quality issue | FAERS: 3 | US FAERS | |
| 28 | Vomiting | FAERS: 3 | US FAERS | |
| 29 | Agitation | FAERS: 2 | US FAERS | |
| 30 | Amnesia | FAERS: 2 | US FAERS | |
| 31 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 32 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 33 | Drug level increased | FAERS: 2 | US FAERS | |
| 34 | Drug toxicity | FAERS: 2 | US FAERS | |
| 35 | Focal dyscognitive seizures | FAERS: 2 | US FAERS | |
| 36 | Neck Pain | FAERS: 2 | US FAERS | |
| 37 | No reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 38 | Pruritus | FAERS: 2 | US FAERS | |
| 39 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 40 | Screaming | FAERS: 2 | US FAERS | |
| 41 | Suspected product quality issue | FAERS: 2 | US FAERS | |
| 42 | Swelling | FAERS: 2 | US FAERS | |
| 43 | Tachycardia | FAERS: 2 | US FAERS | |
| 44 | Tinnitus | FAERS: 2 | US FAERS | |
| 45 | Urticaria | FAERS: 2 | US FAERS | |
| 46 | Vertigo | FAERS: 2 | US FAERS | |
| 47 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 48 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 49 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 50 | Anxiety | FAERS: 1 | US FAERS | |
| 51 | Asthenia | FAERS: 1 | US FAERS | |
| 52 | Back Pain | FAERS: 1 | US FAERS | |
| 53 | Bedridden | FAERS: 1 | US FAERS | |
| 54 | Blindness | FAERS: 1 | US FAERS | |
| 55 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 56 | Blood pH increased | FAERS: 1 | US FAERS | |
| 57 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 58 | Cardiomyopathy neonatal | FAERS: 1 | US FAERS | |
| 59 | Catheter site erythema | FAERS: 1 | US FAERS | |
| 60 | Catheter site infection | FAERS: 1 | US FAERS | |
| 61 | Choking sensation | FAERS: 1 | US FAERS | |
| 62 | Cold sweat | FAERS: 1 | US FAERS | |
| 63 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 64 | Conversion disorder | FAERS: 1 | US FAERS | |
| 65 | Crying | FAERS: 1 | US FAERS | |
| 66 | Cyanosis | FAERS: 1 | US FAERS | |
| 67 | Discomfort | FAERS: 1 | US FAERS | |
| 68 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 69 | Drug administration error | FAERS: 1 | US FAERS | |
| 70 | Eye irritation | FAERS: 1 | US FAERS | |
| 71 | Facial paralysis | FAERS: 1 | US FAERS | |
| 72 | Fatigue | FAERS: 1 | US FAERS | |
| 73 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 74 | Hemiplegia | FAERS: 1 | US FAERS | |
| 75 | Hepatitis B | FAERS: 1 | US FAERS | |
| 76 | Hoarseness | FAERS: 1 | US FAERS | |
| 77 | Hyperventilation | FAERS: 1 | US FAERS | |
| 78 | Hypospadias | FAERS: 1 | US FAERS | |
| 79 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 80 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 81 | Memory impairment | FAERS: 1 | US FAERS | |
| 82 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 83 | Muscle abscess | FAERS: 1 | US FAERS | |
| 84 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 85 | Neonatal respiratory depression | FAERS: 1 | US FAERS | |
| 86 | Overdose | FAERS: 1 | US FAERS | |
| 87 | Pallor | FAERS: 1 | US FAERS | |
| 88 | Post procedural complication | FAERS: 1 | US FAERS | |
| 89 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 90 | Presyncope | FAERS: 1 | US FAERS | |
| 91 | Procedural complication | FAERS: 1 | US FAERS | |
| 92 | Procedural vomiting | FAERS: 1 | US FAERS | |
| 93 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 94 | Product use issue | FAERS: 1 | US FAERS | |
| 95 | Purulence | FAERS: 1 | US FAERS | |
| 96 | Quadriplegia | FAERS: 1 | US FAERS | |
| 97 | Shock | FAERS: 1 | US FAERS | |
| 98 | Somnolence | FAERS: 1 | US FAERS | |
| 99 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 100 | Upper airway obstruction | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.