tioconazole
(QXHHHPZILQDDPS-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1ccc(c(c1)Cl)C(Cn1ccnc1)OCc1ccsc1Cl
- Type(s)
- Approved
- ATC code(s)
- D01AC07; G01AF08; G01AF20
- Molecular Formula:
- C16H13Cl3N2OS
- Molecular Weight:
- 387.711
- Log P:
- 5.8629
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 55.29
- CAS Number(s):
- 65899-73-2
Synonym(s)
1.
tioconazole
2.
Gyno-Trosyd
3.
Monistat 1-Day
4.
Mykontral
5.
Trosderm
6.
Trosid
7.
Trosyd
8.
Trosyl
9.
UK 20,349
10.
Vagistat
11.
Vagistat-1
External Link(s)
| MeSH | C020527 |
| PubChem Compound | 5482 |
| BindingDB | 50370218 |
| ChEBI | 77898 |
| CHEMBL | CHEMBL1200438 |
| DrugBank | DB01007 |
| DrugCentral | 2675 |
| KEGG | cpd:C08082 dr:D00890 |
| Therapeutic Target Database | D0CA6J |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 372 | OFFSIDES US FAERS | |
| 2 | Vaginal burning sensation | FAERS: 176 | OFFSIDES US FAERS | |
| 3 | Vulvovaginal burning sensation | FAERS: 116 | US FAERS | |
| 4 | Vulvovaginal discomfort | FAERS: 103 | OFFSIDES US FAERS | |
| 5 | Vulvovaginal swelling | FAERS: 85 | US FAERS | |
| 6 | Vaginal Discharge | FAERS: 78 | US FAERS | |
| 7 | Vulvovaginal pain | FAERS: 43 | US FAERS | |
| 8 | Vulvovaginal pruritus | FAERS: 43 | US FAERS | |
| 9 | Vaginal pain | FAERS: 36 | US FAERS | |
| 10 | Abdominal Pain | FAERS: 26 | OFFSIDES US FAERS | |
| 11 | Dysuria | FAERS: 23 | OFFSIDES US FAERS | |
| 12 | Hypersensitivity | FAERS: 19 | US FAERS | |
| 13 | Vulvovaginal erythema | FAERS: 18 | US FAERS | |
| 14 | Wrong technique in drug usage process | FAERS: 17 | OFFSIDES US FAERS | |
| 15 | Foreign body trauma | FAERS: 15 | OFFSIDES US FAERS | |
| 16 | Pruritus | FAERS: 13 | US FAERS | |
| 17 | Drug administration error | FAERS: 11 | OFFSIDES US FAERS | |
| 18 | Vaginal mycosis | FAERS: 11 | OFFSIDES US FAERS | |
| 19 | Nausea | FAERS: 10 | US FAERS | |
| 20 | Burning sensation | FAERS: 9 | OFFSIDES US FAERS | |
| 21 | Urticaria | FAERS: 8 | US FAERS | |
| 22 | Drug effect incomplete | FAERS: 7 | US FAERS | |
| 23 | Expired product administered | FAERS: 7 | US FAERS | |
| 24 | Pregnancy | FAERS: 7 | US FAERS | |
| 25 | Excoriation | FAERS: 6 | OFFSIDES US FAERS | |
| 26 | Pain | FAERS: 6 | US FAERS | |
| 27 | Drug exposure during pregnancy | FAERS: 5 | US FAERS | |
| 28 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 29 | Metrorrhagia | FAERS: 5 | US FAERS | |
| 30 | Skin irritation | FAERS: 5 | US FAERS | |
| 31 | Vomiting | FAERS: 5 | US FAERS | |
| 32 | Vulvovaginal mycotic infection | FAERS: 5 | US FAERS | |
| 33 | Abasia | FAERS: 4 | OFFSIDES US FAERS | |
| 34 | Back Pain | FAERS: 4 | US FAERS | |
| 35 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 36 | Medication Error | FAERS: 4 | US FAERS | |
| 37 | Abdominal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 38 | Bladder pain | FAERS: 3 | US FAERS | |
| 39 | Chills | FAERS: 3 | US FAERS | |
| 40 | Discomfort | FAERS: 3 | US FAERS | |
| 41 | Genital burning sensation | FAERS: 3 | US FAERS | |
| 42 | Headache | FAERS: 3 | US FAERS | |
| 43 | No adverse event | FAERS: 3 | US FAERS | |
| 44 | Penile swelling | FAERS: 3 | OFFSIDES US FAERS | |
| 45 | Swelling | FAERS: 3 | US FAERS | |
| 46 | Vulvovaginal rash | FAERS: 3 | US FAERS | |
| 47 | Erythema | FAERS: 2 | US FAERS | |
| 48 | Genital pain | FAERS: 2 | US FAERS | |
| 49 | Genital swelling | FAERS: 2 | OFFSIDES US FAERS | |
| 50 | Inflammation | FAERS: 2 | US FAERS | |
| 51 | Malaise | FAERS: 2 | US FAERS | |
| 52 | Vaginal exfoliation | FAERS: 2 | US FAERS | |
| 53 | Vaginal mucosal blistering | FAERS: 2 | US FAERS | |
| 54 | Vulvovaginal inflammation | FAERS: 2 | US FAERS | |
| 55 | Vulvovaginal injury | FAERS: 2 | US FAERS | |
| 56 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 57 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 58 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 59 | Application site erythema | FAERS: 1 | US FAERS | |
| 60 | Application site exfoliation | FAERS: 1 | US FAERS | |
| 61 | Application site pain | FAERS: 1 | US FAERS | |
| 62 | Application site pruritus | FAERS: 1 | US FAERS | |
| 63 | Application site reaction | FAERS: 1 | US FAERS | |
| 64 | Application site swelling | FAERS: 1 | US FAERS | |
| 65 | Application site vesicles | FAERS: 1 | US FAERS | |
| 66 | Application site warmth | FAERS: 1 | US FAERS | |
| 67 | Breast tenderness | FAERS: 1 | US FAERS | |
| 68 | Chemical injury | FAERS: 1 | US FAERS | |
| 69 | Craniosynostosis | FAERS: 1 | US FAERS | |
| 70 | Crying | FAERS: 1 | US FAERS | |
| 71 | Dizziness | FAERS: 1 | US FAERS | |
| 72 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 73 | Dry skin | FAERS: 1 | US FAERS | |
| 74 | Dyspareunia | FAERS: 1 | US FAERS | |
| 75 | Erectile dysfunction | FAERS: 1 | OFFSIDES US FAERS | |
| 76 | Extra dose administered | FAERS: 1 | US FAERS | |
| 77 | Eye irritation | FAERS: 1 | US FAERS | |
| 78 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 79 | Genital injury | FAERS: 1 | US FAERS | |
| 80 | Genitalia external painful | FAERS: 1 | US FAERS | |
| 81 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 82 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 83 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 84 | Nerve injury | FAERS: 1 | US FAERS | |
| 85 | Nodule | FAERS: 1 | US FAERS | |
| 86 | Pain of skin | FAERS: 1 | US FAERS | |
| 87 | Perineal pain | FAERS: 1 | US FAERS | |
| 88 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 89 | Product administration error | FAERS: 1 | US FAERS | |
| 90 | Product label issue | FAERS: 1 | US FAERS | |
| 91 | Product quality issue | FAERS: 1 | US FAERS | |
| 92 | Rash erythematous | FAERS: 1 | US FAERS | |
| 93 | Syncope | FAERS: 1 | US FAERS | |
| 94 | Thermal burn | FAERS: 1 | US FAERS | |
| 95 | Tremor | FAERS: 1 | US FAERS | |
| 96 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 97 | Vaginitis | FAERS: 1 | US FAERS | |
| 98 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 99 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 100 | Abnormal cervical smear | OFFSIDES | ||
| 101 | Circumstance or information capable of leading to medication error | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.