azilsartan medoxomil
(QJFSABGVXDWMIW-UHFFFAOYSA-N)
Structure
- SMILES
- CCOc1nc2c(n1Cc1ccc(cc1)c1ccccc1c1noc(=O)[nH]1)c(ccc2)C(=O)OCc1oc(=O)oc1C
- Type(s)
- Approved; Investigational
- ATC code(s)
- C09CA09; C09DA09
- Molecular Formula:
- C30H24N4O8
- Molecular Weight:
- 568.534
- Log P:
- 4.7052
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 1
- TPSA:
- 155.59
- CAS Number(s):
- 863031-21-4
Synonym(s)
1.
azilsartan medoxomil
2.
TAK 491
3.
TAK-491
4.
TAK491
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 27 | US FAERS | |
| 2 | Headache | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Drug ineffective | FAERS: 21 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 4 | Incorrect product storage | FAERS: 16 | US FAERS | |
| 5 | Poor quality drug administered | FAERS: 16 | US FAERS | |
| 6 | Wrong technique in product usage process | FAERS: 16 | US FAERS | |
| 7 | Hypotension | FAERS: 15 | US FAERS | |
| 8 | Malaise | FAERS: 15 | US FAERS | |
| 9 | Product quality issue | FAERS: 15 | US FAERS | |
| 10 | Nausea | FAERS: 14 | US FAERS | |
| 11 | Feeling abnormal | FAERS: 11 | US FAERS | |
| 12 | Fatigue | FAERS: 9 | US FAERS | |
| 13 | Angioedema | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Product closure removal difficult | FAERS: 8 | US FAERS | |
| 15 | Asthenia | FAERS: 7 | US FAERS | |
| 16 | Product contamination | FAERS: 6 | US FAERS | |
| 17 | Product storage error | FAERS: 6 | US FAERS | |
| 18 | Vomiting | FAERS: 6 | US FAERS | |
| 19 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 20 | Peripheral swelling | FAERS: 5 | US FAERS | |
| 21 | Syncope | FAERS: 5 | US FAERS | |
| 22 | Weight decreased | FAERS: 5 | US FAERS | |
| 23 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 24 | Chest Pain | FAERS: 4 | US FAERS | |
| 25 | Product container issue | FAERS: 4 | US FAERS | |
| 26 | Product dispensing error | FAERS: 4 | US FAERS | |
| 27 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 28 | Alopecia | FAERS: 3 | US FAERS | |
| 29 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 30 | Chest discomfort | FAERS: 3 | US FAERS | |
| 31 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 32 | Dysphonia | FAERS: 3 | US FAERS | |
| 33 | Expired product administered | FAERS: 3 | US FAERS | |
| 34 | Lethargy | FAERS: 3 | US FAERS | |
| 35 | Myalgia | FAERS: 3 | US FAERS | |
| 36 | Palpitations | FAERS: 3 | US FAERS | |
| 37 | Product physical issue | FAERS: 3 | US FAERS | |
| 38 | Arthralgia | FAERS: 2 | US FAERS | |
| 39 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 40 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 41 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 42 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 43 | Bone pain | FAERS: 2 | US FAERS | |
| 44 | Drug dose omission | FAERS: 2 | US FAERS | |
| 45 | Gout | FAERS: 2 | US FAERS | |
| 46 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 47 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 48 | Lip swelling | FAERS: 2 | US FAERS | |
| 49 | Prescribed underdose | FAERS: 2 | US FAERS | |
| 50 | Product packaging issue | FAERS: 2 | US FAERS | |
| 51 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 52 | Unevaluable event | FAERS: 2 | US FAERS | |
| 53 | Withdrawal hypertension | FAERS: 2 | US FAERS | |
| 54 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 55 | Accidental exposure to product packaging | FAERS: 1 | US FAERS | |
| 56 | Adverse event | FAERS: 1 | US FAERS | |
| 57 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 58 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 59 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 60 | Back Pain | FAERS: 1 | US FAERS | |
| 61 | Blindness | FAERS: 1 | US FAERS | |
| 62 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 63 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 64 | Blood pressure inadequately controlled | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 66 | Burning sensation | FAERS: 1 | US FAERS | |
| 67 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 68 | Chromaturia | FAERS: 1 | US FAERS | |
| 69 | Constipation | FAERS: 1 | US FAERS | |
| 70 | Cyanosis | FAERS: 1 | US FAERS | |
| 71 | Dehydration | FAERS: 1 | US FAERS | |
| 72 | Dependence | FAERS: 1 | US FAERS | |
| 73 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 74 | Discomfort | FAERS: 1 | US FAERS | |
| 75 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 76 | Dystonia | FAERS: 1 | US FAERS | |
| 77 | Dysuria | FAERS: 1 | US FAERS | |
| 78 | Emotional disorder | FAERS: 1 | US FAERS | |
| 79 | Erection increased | FAERS: 1 | US FAERS | |
| 80 | Febrile infection | FAERS: 1 | US FAERS | |
| 81 | Feeling jittery | FAERS: 1 | US FAERS | |
| 82 | Impaired work ability | FAERS: 1 | US FAERS | |
| 83 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 84 | Incoherent | FAERS: 1 | US FAERS | |
| 85 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 86 | Limb discomfort | FAERS: 1 | US FAERS | |
| 87 | Memory impairment | FAERS: 1 | US FAERS | |
| 88 | Mouth swelling | FAERS: 1 | US FAERS | |
| 89 | Muscle tightness | FAERS: 1 | US FAERS | |
| 90 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 91 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 92 | Neck Pain | FAERS: 1 | US FAERS | |
| 93 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 94 | Nervousness | FAERS: 1 | US FAERS | |
| 95 | Nocturia | FAERS: 1 | US FAERS | |
| 96 | Oral pain | FAERS: 1 | US FAERS | |
| 97 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 98 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 99 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 100 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 101 | Pneumonia | FAERS: 1 | US FAERS | |
| 102 | Presyncope | FAERS: 1 | US FAERS | |
| 103 | Product distribution issue | FAERS: 1 | US FAERS | |
| 104 | Product dose omission | FAERS: 1 | US FAERS | |
| 105 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 106 | Product prescribing error | FAERS: 1 | US FAERS | |
| 107 | Product size issue | FAERS: 1 | US FAERS | |
| 108 | Product substitution issue | FAERS: 1 | US FAERS | |
| 109 | Product use complaint | FAERS: 1 | US FAERS | |
| 110 | Pruritus | FAERS: 1 | US FAERS | |
| 111 | Purpura | FAERS: 1 | US FAERS | |
| 112 | Rash erythematous | FAERS: 1 | US FAERS | |
| 113 | Rebound effect | FAERS: 1 | US FAERS | |
| 114 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 115 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 116 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 117 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 118 | Sluggishness | FAERS: 1 | US FAERS | |
| 119 | Somnolence | FAERS: 1 | US FAERS | |
| 120 | Tachycardia | FAERS: 1 | US FAERS | |
| 121 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 122 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 123 | Urticaria | FAERS: 1 | US FAERS | |
| 124 | Vertigo | FAERS: 1 | US FAERS | |
| 125 | Visual Impairment | FAERS: 1 | US FAERS | |
| 126 | Wheezing | FAERS: 1 | US FAERS | |
| 127 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 128 | Hypersensitivity | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.