10-propargyl-10-deazaaminopterin
(OGSBUKJUDHAQEA-WMCAAGNKSA-N)
Structure
- SMILES
- C#CCC(c1ccc(cc1)C(=O)N[C@H](C(=O)O)CCC(=O)O)Cc1cnc2c(n1)c(N)nc(n2)N
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01BA05
- Molecular Formula:
- C23H23N7O5
- Molecular Weight:
- 477.473
- Log P:
- 2.5349
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 5
- TPSA:
- 207.3
- CAS Number(s):
- 146464-95-1
Synonym(s)
1.
10-propargyl-10-deazaaminopterin
2.
pralatrexate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Disease Progression | FAERS: 24 | US FAERS | |
| 2 | Stomatitis | FAERS: 23 | US FAERS | |
| 3 | Malignant neoplasm progression | FAERS: 17 | US FAERS | |
| 4 | Neutropenia | FAERS: 7 | SIDER US FAERS | |
| 5 | Stevens-Johnson Syndrome | FAERS: 7 | 25811541 | CTD US FAERS |
| 6 | Febrile Neutropenia | FAERS: 5 | US FAERS | |
| 7 | Pancytopenia | FAERS: 5 | SIDER US FAERS | |
| 8 | Thrombocytopenia | FAERS: 5 | SIDER US FAERS | |
| 9 | Cellulitis | FAERS: 4 | US FAERS | |
| 10 | Neutrophil count decreased | FAERS: 4 | US FAERS | |
| 11 | Pneumonia | FAERS: 4 | US FAERS | |
| 12 | Toxic Epidermal Necrolysis | FAERS: 4 | SIDER US FAERS | |
| 13 | Abdominal Pain | FAERS: 3 | SIDER US FAERS | |
| 14 | Agitation | FAERS: 3 | US FAERS | |
| 15 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 16 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 17 | Chest Pain | FAERS: 3 | US FAERS | |
| 18 | Erythema | FAERS: 3 | US FAERS | |
| 19 | Fatigue | FAERS: 3 | SIDER US FAERS | |
| 20 | Vomiting | FAERS: 3 | SIDER US FAERS | |
| 21 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 22 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 23 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 24 | Ascites | FAERS: 2 | US FAERS | |
| 25 | Asthenia | FAERS: 2 | SIDER US FAERS | |
| 26 | Biliary dilatation | FAERS: 2 | US FAERS | |
| 27 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 28 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 29 | Catheter site cellulitis | FAERS: 2 | US FAERS | |
| 30 | Dehydration | FAERS: 2 | SIDER US FAERS | |
| 31 | Device related infection | FAERS: 2 | US FAERS | |
| 32 | Drug dose omission | FAERS: 2 | US FAERS | |
| 33 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 34 | Lymphoma | FAERS: 2 | US FAERS | |
| 35 | Mycosis Fungoides | FAERS: 2 | US FAERS | |
| 36 | Oral pain | FAERS: 2 | US FAERS | |
| 37 | Pneumonitis | FAERS: 2 | US FAERS | |
| 38 | Sepsis | FAERS: 2 | SIDER US FAERS | |
| 39 | jaundice | FAERS: 2 | US FAERS | |
| 40 | Abscess | FAERS: 1 | US FAERS | |
| 41 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 42 | Back Pain | FAERS: 1 | SIDER US FAERS | |
| 43 | Bedridden | FAERS: 1 | US FAERS | |
| 44 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 45 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 46 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 47 | Candidiasis | FAERS: 1 | US FAERS | |
| 48 | Chills | FAERS: 1 | US FAERS | |
| 49 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 50 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 51 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 52 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 53 | Drug administration error | FAERS: 1 | US FAERS | |
| 54 | Drug ineffective | FAERS: 1 | US FAERS | |
| 55 | Enteritis | FAERS: 1 | US FAERS | |
| 56 | Epistaxis | FAERS: 1 | SIDER US FAERS | |
| 57 | Epstein-Barr virus associated lymphoma | FAERS: 1 | US FAERS | |
| 58 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 59 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 60 | Excoriation | FAERS: 1 | US FAERS | |
| 61 | Facial Pain | FAERS: 1 | US FAERS | |
| 62 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 63 | Folliculitis | FAERS: 1 | US FAERS | |
| 64 | Genital Herpes | FAERS: 1 | US FAERS | |
| 65 | Gout | FAERS: 1 | US FAERS | |
| 66 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 67 | Herpes simplex serology positive | FAERS: 1 | US FAERS | |
| 68 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 69 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 70 | Hypophagia | FAERS: 1 | US FAERS | |
| 71 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 72 | Ileus | FAERS: 1 | US FAERS | |
| 73 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 74 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 75 | JC virus infection | FAERS: 1 | US FAERS | |
| 76 | Joint swelling | FAERS: 1 | US FAERS | |
| 77 | Lethargy | FAERS: 1 | US FAERS | |
| 78 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 79 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 80 | Lymphopenia | FAERS: 1 | US FAERS | |
| 81 | Malnutrition | FAERS: 1 | US FAERS | |
| 82 | Medication Error | FAERS: 1 | US FAERS | |
| 83 | Myalgia | FAERS: 1 | US FAERS | |
| 84 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 85 | Nausea | FAERS: 1 | SIDER US FAERS | |
| 86 | Neuralgia | FAERS: 1 | US FAERS | |
| 87 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 88 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 89 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 90 | Pain | FAERS: 1 | US FAERS | |
| 91 | Paraneoplastic pemphigus | FAERS: 1 | US FAERS | |
| 92 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 93 | Pleocytosis | FAERS: 1 | US FAERS | |
| 94 | Proteinuria | FAERS: 1 | US FAERS | |
| 95 | Pruritus | FAERS: 1 | SIDER US FAERS | |
| 96 | Recall phenomenon | FAERS: 1 | US FAERS | |
| 97 | Respirovirus test positive | FAERS: 1 | US FAERS | |
| 98 | Secretion discharge | FAERS: 1 | US FAERS | |
| 99 | Septic Shock | FAERS: 1 | US FAERS | |
| 100 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 101 | Skin reaction | FAERS: 1 | US FAERS | |
| 102 | Skin toxicity | FAERS: 1 | US FAERS | |
| 103 | Somnolence | FAERS: 1 | US FAERS | |
| 104 | Splenomegaly | FAERS: 1 | US FAERS | |
| 105 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 106 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 107 | Tonsillitis | FAERS: 1 | US FAERS | |
| 108 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 109 | Ulcer | FAERS: 1 | US FAERS | |
| 110 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 111 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 112 | Urticaria | FAERS: 1 | US FAERS | |
| 113 | Weight decreased | FAERS: 1 | US FAERS | |
| 114 | Anorexia | SIDER | ||
| 115 | Constipation | SIDER | ||
| 116 | Dermatitis | SIDER | ||
| 117 | Gastrointestinal Pain | SIDER | ||
| 118 | Lymphoma, Non-Hodgkin | 16467107 | CTD | |
| 119 | Night sweats | SIDER | ||
| 120 | Pharyngolaryngeal Pain | SIDER | ||
| 121 | Tachycardia | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.