iso-sulfan blue
(NLUFDZBOHMOBOE-UHFFFAOYSA-M)
Structure
- SMILES
- CC[N+](=C1C=CC(=C(c2cc(ccc2S(=O)(=O)[O-])S(=O)(=O)[O-])c2ccc(cc2)N(CC)CC)C=C1)CC.[Na+]
- Molecular Formula:
- C27H31N2NaO6S2
- Molecular Weight:
- 566.665
- Log P:
- 5.9238
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 0
- TPSA:
- 137.41
- CAS Number(s):
- 68238-36-8
Synonym(s)
1.
iso-sulfan blue
2.
4-(alpha-(p-(diethylamino)phenyl)-(2,5-disulfobenzylidene)-2,5-cyclohexadien-1-ylidene)diethylammonium hydroxide inner salt, sodium salt
3.
Lymphazurin
4.
iso-sulphan blue
5.
isosulfan blue
6.
lymphazurin blue
External Link(s)
| MeSH | C025484 |
| PubChem Compound | 50108 |
| CHEMBL | CHEMBL1200859 |
| KEGG | dr:D04634 |
| Therapeutic Target Database | D0P2YD |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Hypotension | FAERS: 9 | US FAERS | |
| 2 | Incorrect route of drug administration | FAERS: 9 | US FAERS | |
| 3 | Procedural complication | FAERS: 5 | US FAERS | |
| 4 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 5 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 6 | Pruritus | FAERS: 3 | US FAERS | |
| 7 | Urticaria | FAERS: 3 | US FAERS | |
| 8 | Wheezing | FAERS: 3 | US FAERS | |
| 9 | Angioedema | FAERS: 2 | US FAERS | |
| 10 | Blood gases abnormal | FAERS: 2 | US FAERS | |
| 11 | Bradycardia | FAERS: 2 | US FAERS | |
| 12 | Cyanosis | FAERS: 2 | US FAERS | |
| 13 | Medication Error | FAERS: 2 | US FAERS | |
| 14 | Skin necrosis | FAERS: 2 | US FAERS | |
| 15 | Tachycardia | FAERS: 2 | US FAERS | |
| 16 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 17 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 18 | Adverse event | FAERS: 1 | US FAERS | |
| 19 | Alopecia | FAERS: 1 | US FAERS | |
| 20 | Amnesia | FAERS: 1 | US FAERS | |
| 21 | Auricular swelling | FAERS: 1 | US FAERS | |
| 22 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 23 | Bronchospasm | FAERS: 1 | US FAERS | |
| 24 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 25 | Chromaturia | FAERS: 1 | US FAERS | |
| 26 | Erythema | FAERS: 1 | US FAERS | |
| 27 | Expired product administered | FAERS: 1 | US FAERS | |
| 28 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 29 | Lip swelling | FAERS: 1 | US FAERS | |
| 30 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 31 | PO2 increased | FAERS: 1 | US FAERS | |
| 32 | Piloerection | FAERS: 1 | US FAERS | |
| 33 | Post procedural complication | FAERS: 1 | US FAERS | |
| 34 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 35 | Shock | FAERS: 1 | US FAERS | |
| 36 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 37 | Skin reaction | FAERS: 1 | US FAERS | |
| 38 | Unevaluable event | FAERS: 1 | US FAERS | |
| 39 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 40 | Vasospasm | FAERS: 1 | US FAERS | |
| 41 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 42 | Wrong technique in drug usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.