Disodium;2-(3-oxido-6-oxoxanthen-9-yl)benzoate
(NJDNXYGOVLYJHP-UHFFFAOYSA-L)
Structure
- SMILES
- [O-]c1ccc2c(c1)oc1c(c2c2ccccc2C(=O)[O-])ccc(=O)c1.[Na+].[Na+]
- Molecular Formula:
- C20H10Na2O5
- Molecular Weight:
- 376.270
- Log P:
- 3.0721
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 0
- TPSA:
- 93.4
- CAS Number(s):
- N/A
Synonym(s)
1.
Disodium;2-(3-oxido-6-oxoxanthen-9-yl)benzoate
2.
Fluorescite
External Link(s)
| PubChem Compound | 10608 3680403 |
| CHEMBL | CHEMBL1628233 |
| KEGG | dr:D02024 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 10 | US FAERS | |
| 2 | Malaise | FAERS: 5 | US FAERS | |
| 3 | Shock | FAERS: 5 | US FAERS | |
| 4 | Vomiting | FAERS: 5 | US FAERS | |
| 5 | Urticaria | FAERS: 4 | US FAERS | |
| 6 | Chest discomfort | FAERS: 3 | US FAERS | |
| 7 | Dizziness | FAERS: 3 | US FAERS | |
| 8 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 9 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 10 | Burning sensation | FAERS: 2 | US FAERS | |
| 11 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 12 | Procedural complication | FAERS: 2 | US FAERS | |
| 13 | Pruritus | FAERS: 2 | US FAERS | |
| 14 | Tremor | FAERS: 2 | US FAERS | |
| 15 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 16 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 17 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 18 | Chest Pain | FAERS: 1 | US FAERS | |
| 19 | Clonus | FAERS: 1 | US FAERS | |
| 20 | Cold sweat | FAERS: 1 | US FAERS | |
| 21 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 22 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 23 | Crying | FAERS: 1 | US FAERS | |
| 24 | Cyanosis | FAERS: 1 | US FAERS | |
| 25 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 26 | Discomfort | FAERS: 1 | US FAERS | |
| 27 | Disorientation | FAERS: 1 | US FAERS | |
| 28 | Drug ineffective | FAERS: 1 | US FAERS | |
| 29 | Erythema | FAERS: 1 | US FAERS | |
| 30 | Flushing | FAERS: 1 | US FAERS | |
| 31 | Headache | FAERS: 1 | US FAERS | |
| 32 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 33 | Hypotension | FAERS: 1 | US FAERS | |
| 34 | Hypoxia | FAERS: 1 | US FAERS | |
| 35 | Injection site bruising | FAERS: 1 | US FAERS | |
| 36 | Mouth swelling | FAERS: 1 | US FAERS | |
| 37 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 38 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 39 | Neck Pain | FAERS: 1 | US FAERS | |
| 40 | Pain | FAERS: 1 | US FAERS | |
| 41 | Pallor | FAERS: 1 | US FAERS | |
| 42 | Palpitations | FAERS: 1 | US FAERS | |
| 43 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 44 | Presyncope | FAERS: 1 | US FAERS | |
| 45 | Respiratory distress | FAERS: 1 | US FAERS | |
| 46 | Stress | FAERS: 1 | US FAERS | |
| 47 | Tachycardia | FAERS: 1 | US FAERS | |
| 48 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 49 | Throat irritation | FAERS: 1 | US FAERS | |
| 50 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 51 | Urinary Incontinence | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.