Levalbuterol
(NDAUXUAQIAJITI-LBPRGKRZSA-N)
Structure
- SMILES
- OCc1cc(ccc1O)[C@H](CNC(C)(C)C)O
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C13H21NO3
- Molecular Weight:
- 239.311
- Log P:
- 1.6969
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 4
- TPSA:
- 72.72
- CAS Number(s):
- 18559-94-9; 34391-04-3
Synonym(s)
1.
Levalbuterol
2.
Levalbuterol Hydrochloride
3.
Levosalbutamol Hydrochloride
4.
Xopenex
5.
Hydrochloride, Levalbuterol
6.
Hydrochloride, Levosalbutamol
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 46 | US FAERS | |
| 2 | Asthma | FAERS: 14 | US FAERS | |
| 3 | Tremor | FAERS: 11 | US FAERS | |
| 4 | Dizziness | FAERS: 9 | US FAERS | |
| 5 | Palpitations | FAERS: 9 | US FAERS | |
| 6 | Pharmaceutical product complaint | FAERS: 9 | US FAERS | |
| 7 | Product substitution issue | FAERS: 8 | US FAERS | |
| 8 | Chest discomfort | FAERS: 7 | US FAERS | |
| 9 | Product quality issue | FAERS: 6 | US FAERS | |
| 10 | Vomiting | FAERS: 6 | US FAERS | |
| 11 | Endotracheal intubation complication | FAERS: 5 | US FAERS | |
| 12 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 13 | Headache | FAERS: 5 | US FAERS | |
| 14 | Medication Error | FAERS: 5 | US FAERS | |
| 15 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 16 | Asthenia | FAERS: 4 | US FAERS | |
| 17 | Bronchospasm | FAERS: 4 | US FAERS | |
| 18 | Disorientation | FAERS: 4 | US FAERS | |
| 19 | Dysphonia | FAERS: 4 | US FAERS | |
| 20 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 21 | Nervousness | FAERS: 4 | US FAERS | |
| 22 | Pruritus | FAERS: 4 | US FAERS | |
| 23 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 24 | Tachycardia | FAERS: 4 | US FAERS | |
| 25 | Throat irritation | FAERS: 4 | US FAERS | |
| 26 | Wheezing | FAERS: 4 | US FAERS | |
| 27 | Atelectasis | FAERS: 3 | US FAERS | |
| 28 | Chest Pain | FAERS: 3 | US FAERS | |
| 29 | Crying | FAERS: 3 | US FAERS | |
| 30 | Feeling jittery | FAERS: 3 | US FAERS | |
| 31 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 32 | Malaise | FAERS: 3 | US FAERS | |
| 33 | Nausea | FAERS: 3 | US FAERS | |
| 34 | Pneumonia | FAERS: 3 | US FAERS | |
| 35 | Product packaging issue | FAERS: 3 | US FAERS | |
| 36 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 37 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 38 | Respiratory distress | FAERS: 3 | US FAERS | |
| 39 | Abasia | FAERS: 2 | US FAERS | |
| 40 | Adverse event | FAERS: 2 | US FAERS | |
| 41 | Agitation | FAERS: 2 | US FAERS | |
| 42 | Bronchitis | FAERS: 2 | US FAERS | |
| 43 | Burning sensation | FAERS: 2 | US FAERS | |
| 44 | Choking | FAERS: 2 | US FAERS | |
| 45 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 46 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 47 | Dysgeusia | FAERS: 2 | US FAERS | |
| 48 | Expired product administered | FAERS: 2 | US FAERS | |
| 49 | Eye irritation | FAERS: 2 | US FAERS | |
| 50 | Flushing | FAERS: 2 | US FAERS | |
| 51 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 52 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 53 | Pain | FAERS: 2 | US FAERS | |
| 54 | Pallor | FAERS: 2 | US FAERS | |
| 55 | Syncope | FAERS: 2 | US FAERS | |
| 56 | Therapeutic product effect decreased | FAERS: 2 | US FAERS | |
| 57 | Urticaria | FAERS: 2 | US FAERS | |
| 58 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 59 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 60 | Airway peak pressure decreased | FAERS: 1 | US FAERS | |
| 61 | Anger | FAERS: 1 | US FAERS | |
| 62 | Anxiety | FAERS: 1 | US FAERS | |
| 63 | Aphasia | FAERS: 1 | US FAERS | |
| 64 | Apparent death | FAERS: 1 | US FAERS | |
| 65 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 66 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 67 | Back Pain | FAERS: 1 | US FAERS | |
| 68 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 69 | Bradycardia | FAERS: 1 | US FAERS | |
| 70 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 71 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 72 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 73 | Cataract | FAERS: 1 | US FAERS | |
| 74 | Catheter related complication | FAERS: 1 | US FAERS | |
| 75 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 76 | Device malfunction | FAERS: 1 | US FAERS | |
| 77 | Discomfort | FAERS: 1 | US FAERS | |
| 78 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 79 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 80 | Dry skin | FAERS: 1 | US FAERS | |
| 81 | Dyspepsia | FAERS: 1 | US FAERS | |
| 82 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 83 | Eosinophilia | FAERS: 1 | US FAERS | |
| 84 | Eructation | FAERS: 1 | US FAERS | |
| 85 | Fatigue | FAERS: 1 | US FAERS | |
| 86 | Food Allergy | FAERS: 1 | US FAERS | |
| 87 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 88 | Hyperventilation | FAERS: 1 | US FAERS | |
| 89 | Hypokinesia | FAERS: 1 | US FAERS | |
| 90 | Hypophagia | FAERS: 1 | US FAERS | |
| 91 | Impaired work ability | FAERS: 1 | US FAERS | |
| 92 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 93 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 94 | Infection | FAERS: 1 | US FAERS | |
| 95 | Influenza | FAERS: 1 | US FAERS | |
| 96 | Intestinal resection | FAERS: 1 | US FAERS | |
| 97 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 98 | Joint swelling | FAERS: 1 | US FAERS | |
| 99 | Leukocytosis | FAERS: 1 | US FAERS | |
| 100 | Lip swelling | FAERS: 1 | US FAERS | |
| 101 | Mechanical ventilation complication | FAERS: 1 | US FAERS | |
| 102 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 103 | Myalgia | FAERS: 1 | US FAERS | |
| 104 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 105 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 106 | Obstruction | FAERS: 1 | US FAERS | |
| 107 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 108 | Oral pain | FAERS: 1 | US FAERS | |
| 109 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 110 | Overdose | FAERS: 1 | US FAERS | |
| 111 | Product counterfeit | FAERS: 1 | US FAERS | |
| 112 | Product deposit | FAERS: 1 | US FAERS | |
| 113 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 114 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 115 | Product preparation error | FAERS: 1 | US FAERS | |
| 116 | Product shape issue | FAERS: 1 | US FAERS | |
| 117 | Product storage error | FAERS: 1 | US FAERS | |
| 118 | Product substitution | FAERS: 1 | US FAERS | |
| 119 | Product use complaint | FAERS: 1 | US FAERS | |
| 120 | Product use issue | FAERS: 1 | US FAERS | |
| 121 | Productive Cough | FAERS: 1 | US FAERS | |
| 122 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 123 | Pulmonary arterial pressure increased | FAERS: 1 | US FAERS | |
| 124 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 125 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 126 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 127 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 128 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 129 | Scab | FAERS: 1 | US FAERS | |
| 130 | Screaming | FAERS: 1 | US FAERS | |
| 131 | Shock | FAERS: 1 | US FAERS | |
| 132 | Skin lesion | FAERS: 1 | US FAERS | |
| 133 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 134 | Stomatitis | FAERS: 1 | US FAERS | |
| 135 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 136 | Swelling | FAERS: 1 | US FAERS | |
| 137 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 138 | Tension | FAERS: 1 | US FAERS | |
| 139 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 140 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 141 | Tracheostomy malfunction | FAERS: 1 | US FAERS | |
| 142 | Unevaluable event | FAERS: 1 | US FAERS | |
| 143 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 144 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 145 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 146 | heart rate | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.