alcaftadine
(MWTBKTRZPHJQLH-UHFFFAOYSA-N)
Structure
- SMILES
- O=Cc1cnc2n1CCc1c(C2=C2CCN(CC2)C)cccc1
- Type(s)
- Approved
- ATC code(s)
- S01GX11
- Molecular Formula:
- C19H21N3O
- Molecular Weight:
- 307.390
- Log P:
- 2.7171
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 38.13
- CAS Number(s):
- 147084-10-4
Synonym(s)
1.
alcaftadine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 86 | SIDER US FAERS | |
| 2 | Eye pain | FAERS: 48 | US FAERS | |
| 3 | Hypersensitivity | FAERS: 30 | US FAERS | |
| 4 | Headache | FAERS: 15 | SIDER US FAERS | |
| 5 | Conjunctivitis | FAERS: 13 | US FAERS | |
| 6 | Drug ineffective | FAERS: 13 | US FAERS | |
| 7 | Eye inflammation | FAERS: 13 | US FAERS | |
| 8 | Instillation site pain | FAERS: 12 | US FAERS | |
| 9 | Fatigue | FAERS: 11 | US FAERS | |
| 10 | Somnolence | FAERS: 11 | US FAERS | |
| 11 | Foreign body sensation in eyes | FAERS: 10 | US FAERS | |
| 12 | Photophobia | FAERS: 10 | US FAERS | |
| 13 | Erythema | FAERS: 9 | US FAERS | |
| 14 | Eyelids pruritus | FAERS: 6 | US FAERS | |
| 15 | Activities of daily living impaired | FAERS: 5 | US FAERS | |
| 16 | Blepharitis | FAERS: 5 | US FAERS | |
| 17 | Dizziness | FAERS: 5 | US FAERS | |
| 18 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 19 | Eyelid exfoliation | FAERS: 4 | US FAERS | |
| 20 | Instillation site erythema | FAERS: 4 | US FAERS | |
| 21 | Nausea | FAERS: 4 | US FAERS | |
| 22 | Asthenia | FAERS: 3 | US FAERS | |
| 23 | Burning sensation | FAERS: 3 | US FAERS | |
| 24 | Eye Infection | FAERS: 3 | US FAERS | |
| 25 | Eye allergy | FAERS: 3 | US FAERS | |
| 26 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 27 | Mydriasis | FAERS: 3 | US FAERS | |
| 28 | Pain | FAERS: 3 | SIDER US FAERS | |
| 29 | Adverse event | FAERS: 2 | US FAERS | |
| 30 | Anxiety | FAERS: 2 | US FAERS | |
| 31 | Chemical burns of eye | FAERS: 2 | US FAERS | |
| 32 | Conjunctival irritation | FAERS: 2 | US FAERS | |
| 33 | Diplopia | FAERS: 2 | US FAERS | |
| 34 | Dysgeusia | FAERS: 2 | US FAERS | |
| 35 | Epistaxis | FAERS: 2 | US FAERS | |
| 36 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 37 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 38 | Inflammation | FAERS: 2 | US FAERS | |
| 39 | Keratitis | FAERS: 2 | US FAERS | |
| 40 | Lethargy | FAERS: 2 | US FAERS | |
| 41 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 42 | Pruritus | FAERS: 2 | US FAERS | |
| 43 | Throat irritation | FAERS: 2 | US FAERS | |
| 44 | Aphonia | FAERS: 1 | US FAERS | |
| 45 | Application site pain | FAERS: 1 | US FAERS | |
| 46 | Asthenopia | FAERS: 1 | US FAERS | |
| 47 | Back Pain | FAERS: 1 | US FAERS | |
| 48 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 49 | Corneal erosion | FAERS: 1 | US FAERS | |
| 50 | Corneal lesion | FAERS: 1 | US FAERS | |
| 51 | Cycloplegia | FAERS: 1 | US FAERS | |
| 52 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 53 | Dermatitis | FAERS: 1 | US FAERS | |
| 54 | Expired product administered | FAERS: 1 | US FAERS | |
| 55 | Eye Burns | FAERS: 1 | US FAERS | |
| 56 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 57 | Eyelid pain | FAERS: 1 | US FAERS | |
| 58 | Feeling Cold | FAERS: 1 | US FAERS | |
| 59 | Flushing | FAERS: 1 | US FAERS | |
| 60 | Instillation site abnormal sensation | FAERS: 1 | US FAERS | |
| 61 | Instillation site burn | FAERS: 1 | US FAERS | |
| 62 | Instillation site pruritus | FAERS: 1 | US FAERS | |
| 63 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 64 | Joint swelling | FAERS: 1 | US FAERS | |
| 65 | Medication residue | FAERS: 1 | US FAERS | |
| 66 | Myalgia | FAERS: 1 | US FAERS | |
| 67 | Noninfective conjunctivitis | FAERS: 1 | US FAERS | |
| 68 | Pain of skin | FAERS: 1 | US FAERS | |
| 69 | Palpitations | FAERS: 1 | US FAERS | |
| 70 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 71 | Pneumonia | FAERS: 1 | US FAERS | |
| 72 | Pregnancy | FAERS: 1 | US FAERS | |
| 73 | Product quality issue | FAERS: 1 | US FAERS | |
| 74 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 75 | Purulent discharge | FAERS: 1 | US FAERS | |
| 76 | Rash erythematous | FAERS: 1 | US FAERS | |
| 77 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 78 | Secretion discharge | FAERS: 1 | US FAERS | |
| 79 | Sneezing | FAERS: 1 | US FAERS | |
| 80 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 81 | Tension Headache | FAERS: 1 | US FAERS | |
| 82 | Urticaria | FAERS: 1 | US FAERS | |
| 83 | Visual Impairment | FAERS: 1 | US FAERS | |
| 84 | Vomiting | FAERS: 1 | US FAERS | |
| 85 | Eye Redness | SIDER | ||
| 86 | Influenza | SIDER | ||
| 87 | Nasopharyngitis | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.