brivaracetam
(MSYKRHVOOPPJKU-BDAKNGLRSA-N)
Structure
- SMILES
- CCC[C@H]1CN(C(=O)C1)[C@H](C(=O)N)CC
- Type(s)
- Approved; Investigational
- ATC code(s)
- N03AX23
- Molecular Formula:
- C11H20N2O2
- Molecular Weight:
- 212.289
- Log P:
- 1.5371
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 63.4
- CAS Number(s):
- 357336-20-0
Synonym(s)
1.
brivaracetam
2.
(2S)-2-((4R)-2-oxo-4-propylpyrrolidin-1-yl)butanamide
3.
1-pyrrolidineacetamide, alpha-ethyl-2-oxo-4-propyl-, (alphaS,4R)-
4.
2-(2-oxo-4-propylpyrrolidin-1-yl)butanamide
5.
Briviact
6.
UCB 34714
7.
UCB-34714
8.
UCB34714
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 34 | US FAERS | |
| 2 | Somnolence | FAERS: 16 | US FAERS | |
| 3 | Dizziness | FAERS: 11 | US FAERS | |
| 4 | Overdose | FAERS: 8 | US FAERS | |
| 5 | Disease Progression | FAERS: 6 | US FAERS | |
| 6 | Anxiety | FAERS: 5 | US FAERS | |
| 7 | Fatigue | FAERS: 5 | US FAERS | |
| 8 | Intentional product misuse | FAERS: 5 | US FAERS | |
| 9 | Product dose omission | FAERS: 5 | US FAERS | |
| 10 | Nausea | FAERS: 4 | US FAERS | |
| 11 | Vomiting | FAERS: 4 | US FAERS | |
| 12 | Alopecia | FAERS: 3 | US FAERS | |
| 13 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 14 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 15 | Pancreatitis | FAERS: 3 | US FAERS | |
| 16 | Pregnancy | FAERS: 3 | US FAERS | |
| 17 | Syncope | FAERS: 3 | US FAERS | |
| 18 | Unevaluable event | FAERS: 3 | US FAERS | |
| 19 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 20 | Agitation | FAERS: 2 | US FAERS | |
| 21 | Asthenia | FAERS: 2 | US FAERS | |
| 22 | Change in seizure presentation | FAERS: 2 | US FAERS | |
| 23 | Drug dose omission | FAERS: 2 | US FAERS | |
| 24 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 25 | Euphoric mood | FAERS: 2 | US FAERS | |
| 26 | Headache | FAERS: 2 | US FAERS | |
| 27 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 28 | Lip swelling | FAERS: 2 | US FAERS | |
| 29 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 30 | Myoclonic Epilepsy | FAERS: 2 | US FAERS | |
| 31 | Myoclonus | FAERS: 2 | US FAERS | |
| 32 | No adverse event | FAERS: 2 | US FAERS | |
| 33 | Pruritus | FAERS: 2 | US FAERS | |
| 34 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 35 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 36 | Tongue biting | FAERS: 2 | US FAERS | |
| 37 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 38 | Accidental overdose | FAERS: 1 | US FAERS | |
| 39 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 40 | Acute psychosis | FAERS: 1 | US FAERS | |
| 41 | Adverse event | FAERS: 1 | US FAERS | |
| 42 | Arthralgia | FAERS: 1 | US FAERS | |
| 43 | Aura | FAERS: 1 | US FAERS | |
| 44 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 45 | Bronchospasm | FAERS: 1 | US FAERS | |
| 46 | Burning sensation | FAERS: 1 | US FAERS | |
| 47 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 48 | Cleft Palate | FAERS: 1 | US FAERS | |
| 49 | Delirium | FAERS: 1 | US FAERS | |
| 50 | Depressed mood | FAERS: 1 | US FAERS | |
| 51 | Disability | FAERS: 1 | US FAERS | |
| 52 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 53 | Dry skin | FAERS: 1 | US FAERS | |
| 54 | Dysgeusia | FAERS: 1 | US FAERS | |
| 55 | Emotional disorder | FAERS: 1 | US FAERS | |
| 56 | Epilepsy | FAERS: 1 | 19787095 | CTD US FAERS |
| 57 | Erythema | FAERS: 1 | US FAERS | |
| 58 | Gait inability | FAERS: 1 | US FAERS | |
| 59 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 60 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 61 | Head discomfort | FAERS: 1 | US FAERS | |
| 62 | Hip surgery | FAERS: 1 | US FAERS | |
| 63 | Homicide | FAERS: 1 | US FAERS | |
| 64 | Hypersomnia | FAERS: 1 | US FAERS | |
| 65 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 66 | Infection | FAERS: 1 | US FAERS | |
| 67 | Intracranial meningioma malignant | FAERS: 1 | US FAERS | |
| 68 | Lethargy | FAERS: 1 | US FAERS | |
| 69 | Limb injury | FAERS: 1 | US FAERS | |
| 70 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 71 | Malaise | FAERS: 1 | US FAERS | |
| 72 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 73 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 74 | Menorrhagia | FAERS: 1 | US FAERS | |
| 75 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 76 | Mood swings | FAERS: 1 | US FAERS | |
| 77 | Neck Pain | FAERS: 1 | US FAERS | |
| 78 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 79 | Pain | FAERS: 1 | US FAERS | |
| 80 | Palpitations | FAERS: 1 | US FAERS | |
| 81 | Personality Change | FAERS: 1 | US FAERS | |
| 82 | Preictal state | FAERS: 1 | US FAERS | |
| 83 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 84 | Product complaint | FAERS: 1 | US FAERS | |
| 85 | Product label issue | FAERS: 1 | US FAERS | |
| 86 | Product packaging issue | FAERS: 1 | US FAERS | |
| 87 | Product quality issue | FAERS: 1 | US FAERS | |
| 88 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 89 | Restlessness | FAERS: 1 | US FAERS | |
| 90 | Sepsis | FAERS: 1 | US FAERS | |
| 91 | Skin reaction | FAERS: 1 | US FAERS | |
| 92 | Suicide attempt | FAERS: 1 | US FAERS | |
| 93 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 94 | Tinnitus | FAERS: 1 | US FAERS | |
| 95 | Transaminases increased | FAERS: 1 | US FAERS | |
| 96 | Tremor | FAERS: 1 | US FAERS | |
| 97 | Weight decreased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.