Sevikar
(MLDQOPPBWWGIKR-UHFFFAOYSA-N)
Structure
- SMILES
- CCCc1nc(c(n1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)C(=O)O)C(O)(C)C.NCCOCC1=C(C(=O)OCC)C(C(=C(N1)C)C(=O)OC)c1ccccc1Cl
- Molecular Formula:
- C44H51ClN8O8
- Molecular Weight:
- 855.378
- Log P:
- 6.9520
- Hydrogen Bond Acceptor:
- 15
- Hydrogen Bond Donor:
- 5
- TPSA:
- 229.69
- CAS Number(s):
- 1188913-21-4
Synonym(s)
1.
Sevikar
External Link(s)
| PubChem Compound | 11607546 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Weight decreased | FAERS: 7 | US FAERS | |
| 2 | Asthenia | FAERS: 2 | US FAERS | |
| 3 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 4 | Colitis | FAERS: 2 | US FAERS | |
| 5 | Eosinophilic colitis | FAERS: 2 | US FAERS | |
| 6 | Hypotension | FAERS: 2 | US FAERS | |
| 7 | Malabsorption | FAERS: 2 | US FAERS | |
| 8 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 9 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 10 | Chest Pain | FAERS: 1 | US FAERS | |
| 11 | Dehydration | FAERS: 1 | US FAERS | |
| 12 | Drug ineffective | FAERS: 1 | US FAERS | |
| 13 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 14 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 15 | Intestinal villi atrophy | FAERS: 1 | US FAERS | |
| 16 | Leukopenia | FAERS: 1 | US FAERS | |
| 17 | Myalgia | FAERS: 1 | US FAERS | |
| 18 | Nausea | FAERS: 1 | US FAERS | |
| 19 | Sprue-like enteropathy | FAERS: 1 | US FAERS | |
| 20 | Vasculitis | FAERS: 1 | US FAERS | |
| 21 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.