asfotase alfa
(LPAUOXUZGSBGDU-ULCCENQXSA-N)
Structure
- SMILES
- CCCN=C1S/C(=C\c2ccc(c(c2)Cl)OC[C@@H](CO)O)/C(=O)N1c1ccccc1C
- Type(s)
- Investigational
- Molecular Formula:
- C23H25ClN2O4S
- Molecular Weight:
- 460.974
- Log P:
- 4.3323
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 107.66
- CAS Number(s):
- 854107-55-4
Synonym(s)
1.
asfotase alfa
2.
ENB-0040
3.
Strensiq
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 2 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 3 | Craniosynostosis | FAERS: 2 | US FAERS | |
| 4 | Injection site erythema | FAERS: 2 | US FAERS | |
| 5 | Irregular breathing | FAERS: 2 | US FAERS | |
| 6 | Pneumonia | FAERS: 2 | US FAERS | |
| 7 | Sepsis | FAERS: 2 | US FAERS | |
| 8 | Wheezing | FAERS: 2 | US FAERS | |
| 9 | Asthenia | FAERS: 1 | US FAERS | |
| 10 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 11 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 12 | Chest Pain | FAERS: 1 | US FAERS | |
| 13 | Chest discomfort | FAERS: 1 | US FAERS | |
| 14 | Dehydration | FAERS: 1 | US FAERS | |
| 15 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 16 | Growth retardation | FAERS: 1 | US FAERS | |
| 17 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 18 | Injection site mass | FAERS: 1 | US FAERS | |
| 19 | Nausea | FAERS: 1 | US FAERS | |
| 20 | Osteopenia | FAERS: 1 | US FAERS | |
| 21 | Platyspondylia | FAERS: 1 | US FAERS | |
| 22 | Rachitic rosary | FAERS: 1 | US FAERS | |
| 23 | Respiratory distress | FAERS: 1 | US FAERS | |
| 24 | Snoring | FAERS: 1 | US FAERS | |
| 25 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 26 | Tooth Loss | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.