Juluca
(LONQNVJNDYLYLN-JMQGDYTKSA-N)
Structure
- SMILES
- Fc1ccc(c(c1)F)CNC(=O)c1cn2C[C@@H]3OCC[C@H](N3C(=O)c2c(c1=O)O)C.N#C/C=C/c1cc(C)c(c(c1)C)Nc1ccnc(n1)Nc1ccc(cc1)C#N
- Molecular Formula:
- C42H37F2N9O5
- Molecular Weight:
- 785.797
- Log P:
- 6.8167
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 4
- TPSA:
- 198.29
- CAS Number(s):
- N/A
Synonym(s)
1.
Juluca
External Link(s)
| PubChem Compound | 131801472 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 11 | US FAERS | |
| 2 | Pruritus | FAERS: 7 | US FAERS | |
| 3 | Fatigue | FAERS: 6 | US FAERS | |
| 4 | Hypersensitivity | FAERS: 6 | US FAERS | |
| 5 | Nausea | FAERS: 6 | US FAERS | |
| 6 | Viral load increased | FAERS: 6 | US FAERS | |
| 7 | Drug ineffective | FAERS: 5 | US FAERS | |
| 8 | Constipation | FAERS: 4 | US FAERS | |
| 9 | Malaise | FAERS: 4 | US FAERS | |
| 10 | Product dose omission | FAERS: 4 | US FAERS | |
| 11 | Product storage error | FAERS: 4 | US FAERS | |
| 12 | Swelling | FAERS: 4 | US FAERS | |
| 13 | Transaminases increased | FAERS: 4 | US FAERS | |
| 14 | Anxiety | FAERS: 3 | US FAERS | |
| 15 | Arthralgia | FAERS: 3 | US FAERS | |
| 16 | Back Pain | FAERS: 3 | US FAERS | |
| 17 | Blood HIV RNA increased | FAERS: 3 | US FAERS | |
| 18 | Drug dose omission | FAERS: 3 | US FAERS | |
| 19 | Drug resistance | FAERS: 3 | US FAERS | |
| 20 | Flatulence | FAERS: 3 | US FAERS | |
| 21 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 22 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 23 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 24 | Arthritis | FAERS: 2 | US FAERS | |
| 25 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 26 | Bone pain | FAERS: 2 | US FAERS | |
| 27 | CD4 Lymphocytes Decreased | FAERS: 2 | US FAERS | |
| 28 | Completed Suicide | FAERS: 2 | US FAERS | |
| 29 | Dizziness | FAERS: 2 | US FAERS | |
| 30 | Dyspepsia | FAERS: 2 | US FAERS | |
| 31 | Food Poisoning | FAERS: 2 | US FAERS | |
| 32 | Hypervigilance | FAERS: 2 | US FAERS | |
| 33 | Memory impairment | FAERS: 2 | US FAERS | |
| 34 | Mental impairment | FAERS: 2 | US FAERS | |
| 35 | Pain | FAERS: 2 | US FAERS | |
| 36 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 37 | Therapy cessation | FAERS: 2 | US FAERS | |
| 38 | Urticaria | FAERS: 2 | US FAERS | |
| 39 | Virologic failure | FAERS: 2 | US FAERS | |
| 40 | Weight decreased | FAERS: 2 | US FAERS | |
| 41 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 42 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 43 | Accidental overdose | FAERS: 1 | US FAERS | |
| 44 | Alopecia | FAERS: 1 | US FAERS | |
| 45 | Amnesia | FAERS: 1 | US FAERS | |
| 46 | Ascites | FAERS: 1 | US FAERS | |
| 47 | Asthenia | FAERS: 1 | US FAERS | |
| 48 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 49 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 50 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 51 | Breast engorgement | FAERS: 1 | US FAERS | |
| 52 | Chest discomfort | FAERS: 1 | US FAERS | |
| 53 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 54 | Disorientation | FAERS: 1 | US FAERS | |
| 55 | Dysphemia | FAERS: 1 | US FAERS | |
| 56 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 57 | Erythema | FAERS: 1 | US FAERS | |
| 58 | Facial wasting | FAERS: 1 | US FAERS | |
| 59 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 60 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 61 | Infection | FAERS: 1 | US FAERS | |
| 62 | Inflammation | FAERS: 1 | US FAERS | |
| 63 | Intestinal resection | FAERS: 1 | US FAERS | |
| 64 | Joint swelling | FAERS: 1 | US FAERS | |
| 65 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 66 | Lethargy | FAERS: 1 | US FAERS | |
| 67 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 68 | Muscle tightness | FAERS: 1 | US FAERS | |
| 69 | Myalgia | FAERS: 1 | US FAERS | |
| 70 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 71 | Product availability issue | FAERS: 1 | US FAERS | |
| 72 | Product dispensing error | FAERS: 1 | US FAERS | |
| 73 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 74 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 75 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 76 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 77 | Sluggishness | FAERS: 1 | US FAERS | |
| 78 | Somnolence | FAERS: 1 | US FAERS | |
| 79 | Therapy change | FAERS: 1 | US FAERS | |
| 80 | Tremor | FAERS: 1 | US FAERS | |
| 81 | Unevaluable event | FAERS: 1 | US FAERS | |
| 82 | colonoscopy | FAERS: 1 | US FAERS | |
| 83 | nervous system disorder | FAERS: 1 | US FAERS | |
| 84 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.