ciprofloxacin, hydrocortisone drug combination
(LMCCVXQGNIODJA-WDCKKOMHSA-N)
Structure
- SMILES
- Fc1cc2c(cc1N1CCNCC1)n(cc(c2=O)C(=O)O)C1CC1.OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C
- Molecular Formula:
- C38H48FN3O8
- Molecular Weight:
- 693.801
- Log P:
- 3.7587
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 5
- TPSA:
- 169.4
- CAS Number(s):
- 494841-09-7
Synonym(s)
1.
ciprofloxacin, hydrocortisone drug combination
2.
Ciproxin HC
3.
ciprofloxacin - hydrocortisone
4.
ciprofloxacin-hydrocortisone combination
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 11 | US FAERS | |
| 2 | Medication residue present | FAERS: 4 | US FAERS | |
| 3 | Tympanic Membrane Perforation | FAERS: 4 | US FAERS | |
| 4 | Ear discomfort | FAERS: 3 | US FAERS | |
| 5 | Mitochondrial cytopathy | FAERS: 3 | US FAERS | |
| 6 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 7 | Deafness | FAERS: 2 | US FAERS | |
| 8 | Headache | FAERS: 2 | US FAERS | |
| 9 | nervous system disorder | FAERS: 2 | US FAERS | |
| 10 | Anxiety | FAERS: 1 | US FAERS | |
| 11 | Aspergillosis | FAERS: 1 | US FAERS | |
| 12 | Asthenia | FAERS: 1 | US FAERS | |
| 13 | Burning sensation | FAERS: 1 | US FAERS | |
| 14 | Chest discomfort | FAERS: 1 | US FAERS | |
| 15 | Dizziness | FAERS: 1 | US FAERS | |
| 16 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 17 | Dysarthria | FAERS: 1 | US FAERS | |
| 18 | Dysgeusia | FAERS: 1 | US FAERS | |
| 19 | Emotional distress | FAERS: 1 | US FAERS | |
| 20 | Facial Paresis | FAERS: 1 | US FAERS | |
| 21 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 22 | Hearing disability | FAERS: 1 | US FAERS | |
| 23 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 24 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 25 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 26 | Medication residue | FAERS: 1 | US FAERS | |
| 27 | Nausea | FAERS: 1 | US FAERS | |
| 28 | Nerve injury | FAERS: 1 | US FAERS | |
| 29 | Pain | FAERS: 1 | US FAERS | |
| 30 | Product storage error | FAERS: 1 | US FAERS | |
| 31 | Syncope | FAERS: 1 | US FAERS | |
| 32 | Tinnitus | FAERS: 1 | US FAERS | |
| 33 | Vomiting | FAERS: 1 | US FAERS | |
| 34 | Wrong technique in product usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.