Sovriad
(LLXQGDWGCCKOQP-OBABASCOSA-M)
Structure
- SMILES
- COc1ccc2c(c1C)nc(cc2O[C@@H]1C[C@@H]2[C@@H](C1)C(=O)N(C)CCCC/C=C\C1[C@](NC2=O)(C1)C(=O)[N-]S(=O)(=O)C1CC1)c1scc(n1)C(C)C.[Na+]
- Molecular Formula:
- C38H46N5NaO7S2
- Molecular Weight:
- 771.921
- Log P:
- 7.3857
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 1
- TPSA:
- 181.48
- CAS Number(s):
- 1241946-89-3
Synonym(s)
1.
Sovriad
External Link(s)
| PubChem Compound | 118984468 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Erythema Multiforme | FAERS: 3 | US FAERS | |
| 2 | Hepatitis C | FAERS: 3 | US FAERS | |
| 3 | Drug ineffective | FAERS: 2 | US FAERS | |
| 4 | Asthenia | FAERS: 1 | US FAERS | |
| 5 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 6 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 7 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 8 | Malaise | FAERS: 1 | US FAERS | |
| 9 | Product use issue | FAERS: 1 | US FAERS | |
| 10 | Pruritus | FAERS: 1 | US FAERS | |
| 11 | Stomatitis | FAERS: 1 | US FAERS | |
| 12 | Viral load increased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.