Insulin, Isophane
(LEMUFSYUPGXXCM-JNEQYSBXSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)O)C(O)C)NC(=O)[C@@H]1CCCN1C(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H]1CSSC[C@H](NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H]2CSSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H]([C@H](CC)C)NC(=O)CN)CCC(=O)O)CCC(=O)N)C(=O)N[C@@H](CSSC[C@@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)C(C)C)CC(C)C)Cc1ccc(cc1)O)CC(C)C)C)CCC(=O)O)C(C)C)CC(C)C)CC1C=NC=N1)CO)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](Cc1ccccc1)N)CC(=O)N)CCC(=O)N)CC1C=NC=N1)CC(C)C)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2)[C@H](CC)C)CO)[C@H](O)C)C(=O)N[C@H](C(=O)O)CC(=O)N)CCC(=O)O)CCCNC(=N)N)Cc1ccccc1)Cc1ccc(cc1)O.[Zn]
- Molecular Formula:
- C257H383N65O77S6Zn
- Molecular Weight:
- 5872.950
- Log P:
- 2.7589
- Hydrogen Bond Acceptor:
- 148
- Hydrogen Bond Donor:
- 76
- TPSA:
- 2442.95
- CAS Number(s):
- N/A
Synonym(s)
1.
Insulin, Isophane
2.
Insulin, NPH
3.
Insulin, Protamine Zinc
4.
Isophane Insulin, Regular
5.
NPH Insulin
6.
Neutral Protamine Hagedorn Insulin
7.
Protamine Hagedorn Insulin
8.
Hagedorn Insulin, Protamine
9.
Isophane Insulin
10.
Protamine Zinc Insulin
11.
Regular Isophane Insulin
12.
Zinc Insulin, Protamine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood glucose decreased | FAERS: 7 | US FAERS | |
| 2 | Syncope | FAERS: 4 | US FAERS | |
| 3 | Blood glucose increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Mental status changes | FAERS: 3 | US FAERS | |
| 5 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 6 | Accidental overdose | FAERS: 1 | US FAERS | |
| 7 | Amnesia | FAERS: 1 | US FAERS | |
| 8 | Asthenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 10 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 11 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 12 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 13 | Diabetic Ketoacidosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Dizziness | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Drug administration error | FAERS: 1 | US FAERS | |
| 16 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 17 | Drug dose omission | FAERS: 1 | US FAERS | |
| 18 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 19 | Fatigue | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 20 | Flushing | FAERS: 1 | US FAERS | |
| 21 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 22 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 23 | Injection site erythema | FAERS: 1 | US FAERS | |
| 24 | Injection site pain | FAERS: 1 | US FAERS | |
| 25 | Lethargy | FAERS: 1 | US FAERS | |
| 26 | Medication Error | FAERS: 1 | US FAERS | |
| 27 | Nausea | FAERS: 1 | US FAERS | |
| 28 | Overdose | FAERS: 1 | US FAERS | |
| 29 | Unevaluable event | FAERS: 1 | US FAERS | |
| 30 | Abscess | Canada Vigilance: 1 | Canada Vigilance | |
| 31 | Chest discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 32 | Disorientation | Canada Vigilance: 1 | Canada Vigilance | |
| 33 | Drug ineffective | Canada Vigilance: 2 | Canada Vigilance | |
| 34 | Erythema | Canada Vigilance: 2 | Canada Vigilance | |
| 35 | Injection Site Reaction | Canada Vigilance: 6 | Canada Vigilance | |
| 36 | Injection site mass | Canada Vigilance: 1 | Canada Vigilance | |
| 37 | Lymphadenopathy | Canada Vigilance: 1 | Canada Vigilance | |
| 38 | Pruritus | Canada Vigilance: 2 | Canada Vigilance | |
| 39 | Skin reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 40 | Tremor | Canada Vigilance: 3 | Canada Vigilance | |
| 41 | Urticaria | Canada Vigilance: 2 | Canada Vigilance | |
| 42 | Vomiting | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.