dorzolamide-timolol combination
(KSBKLOORIKSXDP-BWJWWNBBSA-N)
Structure
- SMILES
- O[C@H](COc1nsnc1N1CCOCC1)CNC(C)(C)C.CCN[C@@H]1C[C@@H](C)S(=O)(=O)c2c1cc(s2)S(=O)(=O)N
- Molecular Formula:
- C23H40N6O7S4
- Molecular Weight:
- 640.860
- Log P:
- 4.8232
- Hydrogen Bond Acceptor:
- 15
- Hydrogen Bond Donor:
- 4
- TPSA:
- 259.31
- CAS Number(s):
- 146235-46-3
Synonym(s)
1.
dorzolamide-timolol combination
2.
Cosopt
3.
dorzolamide hydrochloride-timolol maleate combination
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 16 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 2 | Product substitution issue | FAERS: 11 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 3 | Eye pain | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Foreign body sensation in eyes | FAERS: 4 | US FAERS | |
| 5 | Product quality issue | FAERS: 4 | US FAERS | |
| 6 | Drug ineffective | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Dysgeusia | FAERS: 3 | US FAERS | |
| 8 | Product deposit | FAERS: 3 | US FAERS | |
| 9 | Eye Burns | FAERS: 2 | US FAERS | |
| 10 | Eye Infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Ocular discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Product storage error | FAERS: 2 | US FAERS | |
| 13 | Pruritus | FAERS: 2 | US FAERS | |
| 14 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 15 | Administration related reaction | FAERS: 1 | US FAERS | |
| 16 | Amnesia | FAERS: 1 | US FAERS | |
| 17 | Application site pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 19 | Conjunctival irritation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Discomfort | FAERS: 1 | US FAERS | |
| 21 | Expired product administered | FAERS: 1 | US FAERS | |
| 22 | Extra dose administered | FAERS: 1 | US FAERS | |
| 23 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 24 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 25 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 26 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 27 | Headache | FAERS: 1 | US FAERS | |
| 28 | Hypersensitivity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Instillation site irritation | FAERS: 1 | US FAERS | |
| 30 | Instillation site pain | FAERS: 1 | US FAERS | |
| 31 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 32 | Iritis | FAERS: 1 | US FAERS | |
| 33 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 34 | Myalgia | FAERS: 1 | US FAERS | |
| 35 | Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Palpitations | FAERS: 1 | US FAERS | |
| 37 | Photophobia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Pneumonia | FAERS: 1 | US FAERS | |
| 39 | Post procedural complication | FAERS: 1 | US FAERS | |
| 40 | Product container issue | FAERS: 1 | US FAERS | |
| 41 | Product formulation issue | FAERS: 1 | US FAERS | |
| 42 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 43 | Product packaging issue | FAERS: 1 | US FAERS | |
| 44 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 45 | Product residue present | FAERS: 1 | US FAERS | |
| 46 | Product use complaint | FAERS: 1 | US FAERS | |
| 47 | Somnolence | FAERS: 1 | US FAERS | |
| 48 | Syncope | FAERS: 1 | US FAERS | |
| 49 | Visual Impairment | FAERS: 1 | US FAERS | |
| 50 | treatment failure | FAERS: 1 | US FAERS | |
| 51 | Accelerated Idioventricular Rhythm | 15193844 | CTD | |
| 52 | Alopecia | Canada Vigilance: 1 | Canada Vigilance | |
| 53 | Application site irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 54 | Bradycardia | Canada Vigilance: 2 | Canada Vigilance | |
| 55 | Choroid Diseases | 14620750 | CTD | |
| 56 | Conjunctivitis | Canada Vigilance: 1 | Canada Vigilance | |
| 57 | Glaucoma, Open-Angle | 17416939 | CTD | |
| 58 | Glaucoma | 14620750 | CTD | |
| 59 | Hyperemia | 17416939 | CTD | |
| 60 | Ocular Hypotension | 14620750 | CTD | |
| 61 | Overdose | Canada Vigilance: 1 | Canada Vigilance | |
| 62 | Skin irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 63 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.