Secnidazole
(KPQZUUQMTUIKBP-UHFFFAOYSA-N)
Structure
- SMILES
- CC(Cn1c(C)ncc1[N+](=O)[O-])O
- Type(s)
- Approved
- ATC code(s)
- J01RA07; P01AB07
- Molecular Formula:
- C7H11N3O3
- Molecular Weight:
- 185.181
- Log P:
- 1.0037
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 83.87
- CAS Number(s):
- 3366-95-8
Synonym(s)
1.
Secnidazole
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Vomiting | FAERS: 22 | US FAERS | |
| 2 | Nausea | FAERS: 12 | US FAERS | |
| 3 | Drug ineffective | FAERS: 10 | US FAERS | |
| 4 | Product taste abnormal | FAERS: 8 | US FAERS | |
| 5 | Wrong technique in product usage process | FAERS: 7 | US FAERS | |
| 6 | Dysgeusia | FAERS: 6 | US FAERS | |
| 7 | No adverse event | FAERS: 4 | US FAERS | |
| 8 | Chromaturia | FAERS: 3 | US FAERS | |
| 9 | Headache | FAERS: 3 | US FAERS | |
| 10 | Malaise | FAERS: 3 | US FAERS | |
| 11 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 12 | Chills | FAERS: 2 | US FAERS | |
| 13 | Dizziness | FAERS: 2 | US FAERS | |
| 14 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 15 | Product use issue | FAERS: 2 | US FAERS | |
| 16 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 17 | Ageusia | FAERS: 1 | US FAERS | |
| 18 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 19 | Asthenia | FAERS: 1 | US FAERS | |
| 20 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 21 | Dehydration | FAERS: 1 | US FAERS | |
| 22 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 23 | Expulsion of medication | FAERS: 1 | US FAERS | |
| 24 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 25 | Pain | FAERS: 1 | US FAERS | |
| 26 | Palpitations | FAERS: 1 | US FAERS | |
| 27 | Product packaging issue | FAERS: 1 | US FAERS | |
| 28 | Product physical issue | FAERS: 1 | US FAERS | |
| 29 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 30 | Rash erythematous | FAERS: 1 | US FAERS | |
| 31 | Retching | FAERS: 1 | US FAERS | |
| 32 | Stomatitis | FAERS: 1 | US FAERS | |
| 33 | Urticaria | FAERS: 1 | US FAERS | |
| 34 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.